
MetaCyc Compound: palmitate

Synonyms: hexadecanoate (n-C16:0), palmitic acid, hexadecanoate, hexadecanoic acid

Superclasses: an acid all carboxy acids a carboxylate a fatty acid a 2,3,4-saturated fatty acid a saturated fatty acid
an acid all carboxy acids a carboxylate a fatty acid a 2,3,4-saturated fatty acid a straight chain 2,3,4-saturated fatty acid an even numbered straight chain 2,3,4-saturated fatty acid
an acid all carboxy acids a carboxylate a fatty acid a long-chain fatty acid

Palmitate (palmitic acid) is one of the most common saturated fatty acids found in animals and plants.

The compound was discovered by Edmond Frémy in 1840 in saponified palm oil, of which it is a major component, and was named "palmitique".

It is the first fatty acid produced during lipogenesis (fatty acid synthesis). In cells palmitate is usually found in the form of palmitoyl-[acp], palmitoyl-CoA or incorporated into lipids.

Chemical Formula: C16H31O2

Molecular Weight: 255.42 Daltons

Monoisotopic Molecular Weight: 256.2402302714 Daltons

palmitate compound structure


InChI: InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1


Unification Links: CAS:57-10-3 , ChEBI:7896 , ChemSpider:440215 , HMDB:HMDB00220 , IAF1260:34386 , KEGG:C00249 , MetaboLights:MTBLC7896 , PubChem:504166 , Wikipedia:Palmitic_acid

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 256.09268 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

cutin biosynthesis , suberin monomers biosynthesis :
palmitate + NADPH + H+ + oxygen → 16-hydroxypalmitate + NADP+ + H2O

stearate biosynthesis I (animals and fungi) :
palmitate + ATP + coenzyme A → palmitoyl-CoA + AMP + diphosphate

Not in pathways:
palmitate + hydrogen peroxide + H+ → 1-pentadecene + CO2 + 2 H2O
palmitate + a holo-[acyl-carrier protein] + ATP → a palmitoyl-[acp] + AMP + diphosphate

fatty acid α-oxidation III :
an even numbered straight chain 2,3,4-saturated fatty acid + NAD(P)H + H+ + oxygen → a (R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acid + NAD(P)+ + H2O

alkane biosynthesis I :
a long-chain fatty acid + a holo-[acyl-carrier protein] + ATP → a long-chain acyl-[acp] + AMP + diphosphate

alkane biosynthesis II , fatty acid activation , long chain fatty acid ester synthesis for microdiesel production , phosphatidylcholine acyl editing , wax esters biosynthesis II :
a long-chain fatty acid + ATP + coenzyme A → a long-chain acyl-CoA + AMP + diphosphate

terminal olefins biosynthesis I :
a long-chain fatty acid + hydrogen peroxide + H+ → a terminal olefin + CO2 + 2 H2O

fatty acid α-oxidation I :
a 2,3,4-saturated fatty acid + oxygen → a 2(R)-hydroperoxy fatty acid

fatty acid β-oxidation (peroxisome, yeast) , fatty acid β-oxidation I , fatty acid β-oxidation II (peroxisome) , fatty acid β-oxidation VI (peroxisome) :
a 2,3,4-saturated fatty acid + ATP + coenzyme A → a 2,3,4-saturated fatty acyl CoA + AMP + diphosphate

alkane oxidation :
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

rhizobactin 1021 biosynthesis :
rhizobactin 1021 core + a fatty acid → rhizobactin 1021

sophorolipid biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an (ω-1)-hydroxy fatty acid + NADP+ + H2O

sporopollenin precursor biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an in-chain hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

Not in pathways:
ATP + a holo-[acyl-carrier protein] + a fatty acid → AMP + a 2,3,4-saturated fatty acyl-[acp] + diphosphate
a fatty acid + S-adenosyl-L-methionine → S-adenosyl-L-homocysteine + a fatty acid-methyl ester

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

palmitate biosynthesis I (animals and fungi) :
palmitoyl-CoA + H2O → palmitate + coenzyme A + H+
a palmitoyl-[acp] + H2O → palmitate + a holo-[acyl-carrier protein] + H+

palmitate biosynthesis II (bacteria and plants) :
a palmitoyl-[acp] + H2O → palmitate + a holo-[acyl-carrier protein] + H+

phospholipid remodeling (phosphatidylcholine, yeast) :
1,2-dipalmitoyl-phosphatidylcholine + H2O → 1-16:0-2-lysophosphatidylcholine + palmitate + H+

Not in pathways:
a palmitoylated protein + H2O → palmitate + a protein
all-trans-retinyl palmitate + H2O → all-trans-retinol + palmitate + H+
11-cis-retinyl palmitate + H2O → palmitate + 11-cis-retinol + H+
all-trans-retinyl palmitate + H2O → a retinol + palmitate + H+
all-trans-retinyl palmitate + H2O → 11-cis-retinol + palmitate + H+
1-palmitoyl-2-linoleoyl-phosphatidylcholine + H2O → 1-18:2-lysophosphatidylcholine + palmitate + H+

phosphatidylcholine acyl editing :
a phosphatidylcholine + H2O → a 1-acyl 2-lyso-phosphatidylcholine + a long-chain fatty acid + H+
a phosphatidylcholine + H2O → a 2-acyl 1-lyso-phosphatidylcholine + a long-chain fatty acid + H+

phospholipases :
a phosphatidylcholine + H2O → a 1-acyl 2-lyso-phosphatidylcholine + a long-chain fatty acid + H+
a phosphatidylcholine + H2O → a 2-acyl 1-lyso-phosphatidylcholine + a long-chain fatty acid + H+

retinol biosynthesis :
an all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+
a dietary all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+

Not in pathways:
a wax ester + H2O → a long-chain alcohol + a long-chain fatty acid + H+
a long-chain-fatty-acyl ethyl ester + H2O → a long-chain fatty acid + ethanol + H+

acyl-CoA hydrolysis :
a 2,3,4-saturated fatty acyl CoA + H2O → a 2,3,4-saturated fatty acid + coenzyme A + H+

acyl-ACP thioesterase pathway :
an acyl-[acyl-carrier protein] + H2O → a fatty acid + a holo-[acyl-carrier protein] + H+

alkane oxidation , fatty acid α-oxidation I :
a fatty aldehyde + NAD+ + H2O → a fatty acid + NADH + 2 H+

ceramide degradation :
a ceramide + H2O → a sphingoid base + a fatty acid

sphingolipid biosynthesis (mammals) , sphingomyelin metabolism :
an N-acyl-sphingosylphosphorylcholine + H2O → a fatty acid + sphingosylphosphorylcholine

sphingosine and sphingosine-1-phosphate metabolism :
a (4E)-sphing-4-enine ceramide + H2O → sphingosine + a fatty acid

the visual cycle I (vertebrates) :
an all-trans-retinyl ester + H2O → 11-cis-retinol + a fatty acid + H+

Reactions known to both consume and produce the compound:

Not in pathways:
a 2,3,4-saturated fatty acyl CoA + acetate ↔ a 2,3,4-saturated fatty acid + acetyl-CoA

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
aculeacin A + H2O = a cyclo-hexapeptide + palmitate
2 hydrogen peroxide + palmitate + H+ = CO2 + pentadecanal + 3 H2O

Not in pathways:
an acylglycerone phosphate + a long-chain alcohol = a 1-alkyl-glycerone 3-phosphate + a long-chain fatty acid + H+
a long-chain alcohol + 2 NAD+ + H2O = a long-chain fatty acid + 2 NADH + 3 H+
a long-chain aldehyde + NAD+ + H2O = a long-chain fatty acid + NADH + 2 H+
an N-long-chain-fatty-acyl-L-glutamate + H2O = L-glutamate + a long-chain fatty acid
an N-(long-chain-acyl)ethanolamine + H2O = a long-chain fatty acid + ethanolamine
acetyl-CoA + n malonyl-CoA + 2n NADPH + 2n H+ = a long-chain fatty acid + n CO2 + (n+1) coenzyme A + 2n NADP+

Not in pathways:
a fatty acid + hydrogen peroxide = a 3- or 2-hydroxy fatty acid + H2O
a D-glucosyl-N-acylsphingosine + H2O = a fatty acid + O-glucosyl-sphingosine
a 1,2-diacyl-sn-glycerol + H2O = a 1-monoglyceride + a fatty acid + H+
a glycosphingolipid + H2O = a lyso-glycosphingolipid + a fatty acid

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an unknown oxidized electron acceptor + H2O = a carboxylate + an unknown reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid

In Transport reactions:
a long-chain fatty acid[periplasmic space]a long-chain fatty acid[cytosol] ,
a long-chain fatty acid[extracellular space]a long-chain fatty acid[periplasmic space]

Enzymes activated by palmitate, sorted by the type of activation, are:

Activator (Allosteric) of: pyruvate oxidase [Kiuchi84]

Activator (Mechanism unknown) of: pantoate:β-alanine ligase [Genschel99] , pyruvate dehydrogenase [Camp88]

This compound has been characterized as an alternative substrate of the following enzymes: fatty acid (ω-1)-hydroxylase , fatty-acid peroxygenase , alkane ω-hydroxylase , long-chain acyl-CoA synthetase , palmitoyl-CoA 11-desaturase


Camp88: Camp, Pamela J, Miernyk, Jan A, Randall, Douglas D (1988). "Some kinetic and regulatory properties of the pea chloroplast pyruvate dehydrogenase complex." Biochimica et Biophysica Acta, 933:269-275.

Genschel99: Genschel U, Powell CA, Abell C, Smith AG (1999). "The final step of pantothenate biosynthesis in higher plants: cloning and characterization of pantothenate synthetase from Lotus japonicus and Oryza sativum (rice)." Biochem J 341 ( Pt 3);669-78. PMID: 10417331

Kiuchi84: Kiuchi K, Hager LP (1984). "Reconstitution of the lipid-depleted pyruvate oxidase system of Escherichia coli: the palmitic acid effect." Arch Biochem Biophys 233(2);776-84. PMID: 6385860

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Wed May 27, 2015, BIOCYC14B.