Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015

MetaCyc Compound: oleate

Synonyms: oleic acid, (9Z)-octadec-9-enoate, (9Z)-octadecenoate, (9Z)-octadecenoic acid, (9Z)-octadec-9-enoic acid, (Z)-octadec-9-enoic acid, 18:1 n-9, 18:1Δ9cis, C18:1 n-9, cis-9-octadecenoic acid, cis-Δ9-octadecenoic acid, cis-oleic acid, octadec-9-enoic acid, octadecenoate (n-C18:1), 9-octadecenoic acid

Superclasses: an acid all carboxy acids a carboxylate a fatty acid a long-chain fatty acid
an acid all carboxy acids a carboxylate a fatty acid an unsaturated fatty acid a monounsaturated fatty acid

Oleate is an unsaturated fatty acid found in plant and animal oils and fats; It is an important ingredient of olive oil, and is used for making soap, cosmetics and other products.

Chemical Formula: C18H33O2

Molecular Weight: 281.46 Daltons

Monoisotopic Molecular Weight: 282.2558803356 Daltons


InChI: InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9-


Unification Links: CAS:112-80-1 , ChEBI:30823 , ChemSpider:4573837 , HMDB:HMDB00207 , IAF1260:1451011 , KEGG:C00712 , MetaboLights:MTBLC30823 , PubChem:5460221

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 300.16492 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

cutin biosynthesis :
oleate + NADPH + oxygen + H+ → 18-hydroxyoleate + NADP+ + H2O
a lipid hydroperoxide + oleate → 9,10-epoxystearate + a lipid alcohol

cyclopropane and cyclopropene fatty acid biosynthesis :
oleate + S-adenosyl-L-methionine → dihydrosterculate + S-adenosyl-L-homocysteine + H+

dimorphecolate biosynthesis :
oleate → (9Z,12E)-octadecadienoate + 2 H+

linoleate biosynthesis I (plants) , linoleate biosynthesis II (animals) :
oleate + ATP + coenzyme A → oleoyl-CoA + AMP + diphosphate

ricinoleate biosynthesis :
oleate + NADH + oxygen + H+ → ricinoleate + NAD+ + H2O

stigma estolide biosynthesis :
3 oleate + OH- → estolide + CO2

suberin monomers biosynthesis :
oleate + NADPH + oxygen + H+ → 18-hydroxyoleate + NADP+ + H2O

Not in pathways:
oleate + hydrogen peroxide + H+ → 1,8-heptadecadiene + CO2 + 2 H2O
oleate + oxygen → (8E,10S)-10-hydroperoxyoctadec-8-enoate
oleate + ethanol + H+ → ethyl oleate + H2O
oleate + a reduced electron acceptor + oxygen → linoleate + an oxidized electron acceptor + 2 H2O

alkane biosynthesis I :
a long-chain fatty acid + a holo-[acyl-carrier protein] + ATP → a long-chain acyl-[acp] + AMP + diphosphate

alkane biosynthesis II , fatty acid activation , long chain fatty acid ester synthesis for microdiesel production , phosphatidylcholine acyl editing , wax esters biosynthesis II :
a long-chain fatty acid + ATP + coenzyme A → a long-chain acyl-CoA + AMP + diphosphate

terminal olefins biosynthesis I :
a long-chain fatty acid + hydrogen peroxide + H+ → a terminal olefin + CO2 + 2 H2O

alkane oxidation :
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

sophorolipid biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an (ω-1)-hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

sporopollenin precursor biosynthesis :
a fatty acid + NADPH + oxygen + H+ → an in-chain hydroxy fatty acid + NADP+ + H2O
a fatty acid + NADPH + oxygen + H+ → an ω-hydroxy fatty acid + NADP+ + H2O

ATP + a holo-[acyl-carrier protein] + a fatty acid → AMP + a 2,3,4-saturated fatty acyl-[acp] + diphosphate
a fatty acid + S-adenosyl-L-methionine → S-adenosyl-L-homocysteine + a fatty acid-methyl ester

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

monoacylglycerol metabolism (yeast) :
2-oleoylglycerol + H2O → glycerol + oleate + H+
1-oleoylglycerol + H2O → glycerol + oleate + H+

oleate biosynthesis I (plants) :
an oleoyl-[acp] + H2O → a holo-[acyl-carrier protein] + oleate + H+

oleate biosynthesis II (animals and fungi) , stigma estolide biosynthesis :
oleoyl-CoA + H2O → oleate + coenzyme A + H+

phospholipid remodeling (phosphatidate, yeast) :
1-18:1-2-18:1-phosphatidate + H2O → 1-oleyl-2-lyso-phosphatidate + oleate + H+

phospholipid remodeling (phosphatidylethanolamine, yeast) :
1-18:1-lysophosphatidylethanolamine + H2O → sn-glycero-3-phosphoethanolamine + oleate + H+
1-18:1-2-18:1-phosphatidylethanolamine + H2O → 1-18:1-lysophosphatidylethanolamine + oleate + H+

sterol:steryl ester interconversion (yeast) :
lanosteryl oleate + H2O → lanosterol + oleate + H+
ergosteryl oleate + H2O → ergosterol + oleate + H+

Not in pathways:
1-18:1-2-16:0-monogalactosyldiacylglycerol + H2O → sn-1-lyso-2-16:0-monogalactosyldiacylglycerol + oleate + H+

retinol biosynthesis :
an all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+
a dietary all-trans-retinyl ester + H2O → all-trans-retinol + a long-chain fatty acid + H+

a long-chain-fatty-acyl ethyl ester + H2O → a long-chain fatty acid + ethanol + H+

acyl-ACP thioesterase pathway :
an acyl-[acyl-carrier protein] + H2O → a fatty acid + a holo-[acyl-carrier protein] + H+

alkane oxidation , fatty acid α-oxidation I :
a fatty aldehyde + NAD+ + H2O → a fatty acid + NADH + 2 H+

ceramide degradation :
a ceramide + H2O → a sphingoid base + a fatty acid

phosphatidylcholine acyl editing :
a phosphatidylcholine + H2O → a 2-lyso-phosphatidylcholine + a fatty acid + H+
a phosphatidylcholine + H2O → a 1-lysophosphatidylcholine + a fatty acid + H+

phospholipases :
a phosphatidylcholine + H2O → a 2-lyso-phosphatidylcholine + a fatty acid + H+
a phosphatidylcholine + H2O → a 1-lysophosphatidylcholine + a fatty acid + H+

sphingolipid biosynthesis (mammals) , sphingomyelin metabolism :
an N-acyl-sphingosylphosphorylcholine + H2O → a fatty acid + sphingosylphosphorylcholine

sphingosine and sphingosine-1-phosphate metabolism :
an N-acylsphingosine + H2O → sphingosine + a fatty acid

the visual cycle I (vertebrates) :
an all-trans-retinyl ester + H2O → 11-cis-retinol + a fatty acid

triacylglycerol degradation :
a 1-monoglyceride + H2O → a fatty acid + glycerol + H+
a triglyceride + H2O → a 1,2-diglyceride + a fatty acid + H+
a 1,2-diglyceride + H2O → a 2-monoglyceride + a fatty acid + H+

a 3-(acyloxy)acyl group of bacterial toxin + H2O → a 3-hydroxyacyl group of bacterial toxin + a fatty acid + H+
a steryl-ester + H2O → a fatty acid + a sterol + H+
an L-1-phosphatidyl-ethanolamine[periplasmic space] + H2O[periplasmic space] → a 1-lyso-2-acyl-sn-glycero-3-phosphoethanolamine[periplasmic space] + a fatty acid[periplasmic space] + H+[periplasmic space]
a 2-monoglyceride + H2O → glycerol + a fatty acid + H+
an L-1-phosphatidyl-ethanolamine[periplasmic space] + H2O[periplasmic space]a fatty acid[periplasmic space] + a 2-lyso-phosphatidyl-ethanolamine[periplasmic space] + H+[periplasmic space]
a 1,3-diglyceride + H2O → a monoglyceride + a fatty acid
an all-trans-retinyl ester + H2O → 13-cis-retinol + a fatty acid
an 11-cis-retinyl ester + H2O → 11-cis-retinol + a fatty acid
a 1,2-diacyl-sn-glycerol + H2O → a monoglyceride + a fatty acid
an O-acyl-L-carnitine + H2O → L-carnitine + a fatty acid

3,3'-thiodipropionate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropionate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+
a 1-lysophosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + FMNH2 + oxygen → hν + a carboxylate + FMN + H2O + 2 H+
an acylcholine + H2O → choline + a carboxylate + H+
a 1,2-diacyl-3-β-D-galactosyl-sn-glycerol + 2 H2O → 2 a carboxylate + 3-β-D-galactosyl-sn-glycerol + 2 H+
an acyl phosphate + H2O → a carboxylate + phosphate + H+
an S-acylglutathione + H2O → a carboxylate + glutathione
an N-acyl-L-aspartate + H2O → L-aspartate + a carboxylate

Reactions known to both consume and produce the compound:

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

poly-hydroxy fatty acids biosynthesis :
oleate + 2 NADPH + oxygen = 9,10-epoxystearate + 2 NADP+ + H2O

Not in pathways:
(R)-10-Hydroxystearate = oleate + H2O
oleamide + H2O = oleate + ammonium
oleate = (11Z)-eicos-11-enoate

acetyl-CoA + n malonyl-CoA + 2n NADPH + 2n H+ = a long-chain fatty acid + n CO2 + (n+1) coenzyme A + 2n NADP+

a fatty acid + hydrogen peroxide = a 3- or 2-hydroxy fatty acid + H2O
a D-glucosyl-N-acylsphingosine + H2O = a fatty acid + D-glucosyl-sphingosine
a 1,2-diacyl-sn-glycerol + H2O = a 1-monoglyceride + a fatty acid + H+
a glycosphingolipid + H2O = a lyso-glycosphingolipid + a fatty acid

eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
an aldehyde + pyrroloquinoline quinone + H2O = a carboxylate + pyrroloquinoline quinol + H+
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an oxidized electron acceptor + H2O = a carboxylate + a reduced electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an N-acyl-D-glutamate + H2O = a carboxylate + D-glutamate
an anilide + H2O = aniline + a carboxylate + H+
a 5'-acylphosphoadenosine + H2O = a carboxylate + AMP + 2 H+
a 3-acylpyruvate + H2O = a carboxylate + pyruvate + H+
an N6acyl-L-lysine + H2O = a carboxylate + L-lysine
an N-acyl-D-aspartate + H2O = a carboxylate + D-aspartate

In Transport reactions:
a long-chain fatty acid[periplasmic space]a long-chain fatty acid[cytosol] ,
a long-chain fatty acid[extracellular space]a long-chain fatty acid[periplasmic space]

Enzymes activated by oleate, sorted by the type of activation, are:

Activator (Mechanism unknown) of: acyl-CoA oxidase [Dmochowska90] , phospholipase D [Wang01b]

Enzymes inhibited by oleate, sorted by the type of inhibition, are:

Inhibitor (Mechanism unknown) of: (25R)-3α,7α,12α-trihydroxy-5β-cholestanoyl-CoA ligase [Falany02] , pyruvate dehydrogenase [Camp88]


Camp88: Camp, Pamela J, Miernyk, Jan A, Randall, Douglas D (1988). "Some kinetic and regulatory properties of the pea chloroplast pyruvate dehydrogenase complex." Biochimica et Biophysica Acta, 933:269-275.

Dmochowska90: Dmochowska A, Dignard D, Maleszka R, Thomas DY (1990). "Structure and transcriptional control of the Saccharomyces cerevisiae POX1 gene encoding acyl-coenzyme A oxidase." Gene 88(2);247-52. PMID: 2189786

Falany02: Falany CN, Xie X, Wheeler JB, Wang J, Smith M, He D, Barnes S (2002). "Molecular cloning and expression of rat liver bile acid CoA ligase." J Lipid Res 43(12);2062-71. PMID: 12454267

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Wang01b: Wang C, Wang X (2001). "A novel phospholipase D of Arabidopsis that is activated by oleic acid and associated with the plasma membrane." Plant Physiol 2001;127(3);1102-12. PMID: 11706190

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Sun Mar 1, 2015, BIOCYC14A.