Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015
twitter

MetaCyc Compound: L-ornithine

Synonyms: Ornithine, 2, 5-diaminovaleric acid, 2, 5-diaminopentanoic acid, 2, 5-diaminopentanoate, α,δ-diaminovaleric acid

Superclasses: an acid all carboxy acids a carboxylate an amino acid an alpha amino acid a non-standard alpha amino acid ornithine
an acid all carboxy acids a carboxylate an amino acid an alpha amino acid a non-standard alpha amino acid
an acid all carboxy acids a carboxylate an amino acid an L-amino acid
an amino acid or its derivative an amino acid an alpha amino acid a non-standard alpha amino acid ornithine
an amino acid or its derivative an amino acid an alpha amino acid a non-standard alpha amino acid
an amino acid or its derivative an amino acid an L-amino acid

Chemical Formula: C5H13N2O2

Molecular Weight: 133.17 Daltons

Monoisotopic Molecular Weight: 132.0898776398 Daltons

L-ornithine compound structure

SMILES: C(C[N+])CC([N+])C([O-])=O

InChI: InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m0/s1

InChIKey: InChIKey=AHLPHDHHMVZTML-BYPYZUCNSA-O

Unification Links: ChEBI:46911 , ChemSpider:5360242 , HMDB:HMDB00214 , IAF1260:37976 , KEGG:C00077 , MetaboLights:MTBLC46911 , PubChem:6992088

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): 47.5525 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

echinocandin B biosynthesis :
linoleyl-ACP + L-ornithine + ATP → L-ornithine-linoleyl-ACP + ADP + phosphate + H+

ferrichrome A biosynthesis , pyoverdine I biosynthesis :
L-ornithine + NADPH + oxygen → N5-hydroxy-L-ornithine + NADP+ + H2O

gramicidin S biosynthesis :
D-phenylalanyl-[gramicidin-S synthetase] + L-proline + L-valine + L-ornithine + L-leucine + 4 ATP → D-phenylalanyl-L-prolyl-L-valyl-L-ornithyl-L-leucyl-[NRPS-pcp] + 4 AMP + 4 diphosphate + 4 H+

L-arginine degradation VII (arginase 3 pathway) , L-ornithine degradation I (L-proline biosynthesis) :
L-ornithine → L-proline + ammonium

L-Nδ-acetylornithine biosynthesis :
L-ornithine → L-Nδ-acetylornithine

ornithine lipid biosynthesis :
L-ornithine + a (3R)-3-hydroxyacyl-[acyl-carrier protein] → a lyso-ornithine lipid + a holo-[acyl-carrier protein] + H+

putrescine biosynthesis III , putrescine biosynthesis IV , superpathway of ornithine degradation :
L-ornithine + H+ → CO2 + putrescine

Not in pathways:
L-ornithine + NAD(P)H + oxygen → N5-hydroxy-L-ornithine + NAD(P)+ + H2O
L-ornithine + 2-oxoglutarate + NADPH + H+ → ornaline + NADP+ + H2O

prodigiosin biosynthesis :
(S)-3-acetyloctanal + an L-amino acid → 2-methyl-3-n-amyl-dihydropyrrole + a 2-oxo acid + H2O

rhizocticin A and B biosynthesis :
2-keto-5-phosphono-3-cis-pentenoate + an L-amino acidL-2-amino-5-phosphono-3-cis-pentenoate + a 2-oxo carboxylate
2-keto-4-hydroxy-5-phosphonopentanoate + an L-amino acid → 2-amino-4-hydroxy-5-phosphonopentanoate + a 2-oxo carboxylate

3-hydroxy-L-homotyrosine biosynthesis :
4-(4-hydroxyphenyl)-2-oxobutanoate + an amino acidL-homotyrosine + a 2-oxo acid

methyl ketone biosynthesis :
a carboxylate + ATP + coenzyme A → an acyl-CoA + AMP + diphosphate

Not in pathways:
an acyl-protein synthetase + a carboxylate + ATP → an acyl-protein thioester + AMP + diphosphate
a carboxylate + GTP + coenzyme A → an acyl-CoA + GDP + phosphate

Reactions known to produce the compound:

creatine biosynthesis :
glycine + L-arginine → guanidinoacetate + L-ornithine

D-cycloserine biosynthesis :
Nω-hydroxy-L-arginine + H2O → L-ornithine + hydroxyurea

L-arginine biosynthesis II (acetyl cycle) :
L-glutamate + N-acetyl-L-ornithine → N-acetyl-L-glutamate + L-ornithine

L-arginine biosynthesis IV (archaebacteria) :
an [L-2-aminoadipate carrier protein]-L-ornithine + H2O → L-ornithine + a [LysW protein]-L-glutamate

L-proline biosynthesis II (from arginine) :
L-citrulline + 2 H+ + H2O → L-ornithine + CO2 + ammonium

streptomycin biosynthesis :
L-arginine + 1-amino-1-deoxy-scyllo-inositol 4-phosphate → 1-guanidino-1-deoxy-scyllo-inositol 4-phosphate + L-ornithine
N1-amidinostreptamine 6-phosphate + L-arginine → streptidine 6-phosphate + L-ornithine

Not in pathways:
amino acids(n) + H2O → amino acids(n-1) + an α amino acid
an α amino acid ester + H2O → an alcohol + an α amino acid + H+
a protein + H2O → a protein + an α amino acid

γ-glutamyl cycle :
an (γ-L-glutamyl)-L-amino acid → an L-amino acid + 5-oxo-L-proline

Not in pathways:
a peptide + H2O → an L-amino acid + a peptide
a peptide + H2O → a peptide + an L-amino acid
a N-methyl L-amino acid + oxygen + H2O → an L-amino acid + formaldehyde + hydrogen peroxide
a polypeptide + H2O → a polypeptide + an L-amino acid

3,3'-thiodipropanoate degradation :
3-sulfinopropionate + an acyl-CoA → 3-sulfinopropanoyl-CoA + a carboxylate

dimethylsulfoniopropanoate degradation II (cleavage) :
dimethylsulfoniopropanoate + an acyl-CoA → dimethylsulfoniopropioyl-CoA + a carboxylate

NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast) :
an aldehyde + NADP+ + H2O → a carboxylate + NADPH + 2 H+
an aldehyde + NAD+ + H2O → a carboxylate + NADH + 2 H+

phosphatidylcholine resynthesis via glycerophosphocholine :
a phosphatidylcholine + 2 H2O → sn-glycero-3-phosphocholine + 2 a carboxylate + 2 H+

Not in pathways:
a 1-acyl 2-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space]a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an acyl-CoA + H2O → a carboxylate + coenzyme A + H+
an L-1-phosphatidyl-inositol + H2O → a 1-acyl-sn-glycero-3-phospho-D-myo-inositol + a carboxylate + H+
a carboxylic ester + H2O → an alcohol + a carboxylate + H+
an aldehyde + oxygen + H2O → a carboxylate + hydrogen peroxide + H+

Reactions known to both consume and produce the compound:

L-arginine biosynthesis I (via L-ornithine) , L-arginine biosynthesis II (acetyl cycle) , L-arginine biosynthesis IV (archaebacteria) , L-citrulline degradation :
L-ornithine + carbamoyl-phosphate ↔ L-citrulline + phosphate + H+

L-arginine degradation I (arginase pathway) :
L-arginine + H2O ↔ urea + L-ornithine
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-arginine degradation VI (arginase 2 pathway) :
L-arginine + H2O ↔ urea + L-ornithine
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-arginine degradation VII (arginase 3 pathway) , putrescine biosynthesis IV :
L-arginine + H2O ↔ urea + L-ornithine

L-citrulline biosynthesis :
L-arginine + H2O ↔ urea + L-ornithine
L-ornithine + carbamoyl-phosphate ↔ L-citrulline + phosphate + H+
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-Nδ-acetylornithine biosynthesis :
L-arginine + H2O ↔ urea + L-ornithine
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-ornithine biosynthesis :
N-acetyl-L-ornithine + H2O ↔ L-ornithine + acetate

L-ornithine de novo biosynthesis , L-proline biosynthesis III :
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-ornithine degradation II (Stickland reaction) :
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde
L-ornithine ↔ D-ornithine

L-proline biosynthesis II (from arginine) :
L-ornithine + carbamoyl-phosphate ↔ L-citrulline + phosphate + H+
L-ornithine + 2-oxoglutarate ↔ L-glutamate + L-glutamate-5-semialdehyde

L-proline biosynthesis IV :
L-ornithine + 2-oxoglutarate ↔ L-glutamate + 2-keto-ornithine

urea cycle :
L-arginine + H2O ↔ urea + L-ornithine
L-ornithine + carbamoyl-phosphate ↔ L-citrulline + phosphate + H+

Not in pathways:
L-ornithine + a 2-oxo carboxylate ↔ a standard α amino acid + L-glutamate-5-semialdehyde
L-ornithine[chloroplast stroma] + carbamoyl-phosphate[chloroplast stroma] ↔ L-citrulline[chloroplast stroma] + phosphate[chloroplast stroma] + H+[chloroplast stroma]
L-ornithine + 2-oxoglutarate ↔ 1-pyrroline-5-carboxylate + L-glutamate + H+ + H2O

Not in pathways:
L-alanine + a 2-oxo carboxylate ↔ pyruvate + an L-amino acid

sphingolipid recycling and degradation (yeast) :
a dihydroceramide + H2O ↔ sphinganine + a carboxylate

In Reactions of unknown directionality:

Not in pathways:
N5-(L-1-carboxyethyl)-L-ornithine + NADP+ + H2O = pyruvate + L-ornithine + NADPH + H+
L-arginine + L-lysine = L-homoarginine + L-ornithine
L-ornithine + succinyl-CoA = N2-succinyl-L-ornithine + coenzyme A + H+
L-ornithine + 2 benzoyl-CoA = N2,N5-dibenzoyl-L-ornithine + 2 coenzyme A + 2 H+

Not in pathways:
an L-amino acid = a D-amino acid
an L-amino acid + NAD+ + H2O = a 2-oxo carboxylate + ammonium + NADH + H+
an N-carbamoyl-L-amino acid + H2O + 2 H+ = an L-amino acid + ammonium + CO2
S-ureidoglycine + a 2-oxo carboxylate = oxalurate + an L-amino acid

Not in pathways:
a 5-L-glutamyl-[peptide] + an amino acid = a 5-L-glutamyl-amino acid + a peptide

Not in pathways:
eugenol + a carboxylate + NADP+ = a coniferyl ester + NADPH
a 2-acyl 1-lyso-phosphatidylcholine[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + sn-glycero-3-phosphocholine[periplasmic space] + H+[periplasmic space]
an aldehyde + an electron-transfer quinone + H2O = a carboxylate + an electron-transfer quinol + H+
a triacyl-sn-glycerol + H2O = a 1,2-diacyl-sn-glycerol + a carboxylate + H+
a penicillin + H2O = 6-aminopenicillanate + a carboxylate
an aldehyde[periplasmic space] + FAD[periplasmic space] + H2O[periplasmic space] = a carboxylate[periplasmic space] + FADH2[periplasmic space]
a nitrile + 2 H2O = a carboxylate + ammonium
an aliphatic nitrile + 2 H2O = a carboxylate + ammonium
an N-acyl-L-homoserine lactone + H2O = L-homoserine lactone + a carboxylate
an aldehyde + an oxidized unknown electron acceptor + H2O = a carboxylate + an reduced unknown electron acceptor + H+
an N-acylated aromatic-L-amino acid + H2O = a carboxylate + an aromatic L-amino acid
an N-acylated-D-amino acid + H2O = a D-amino acid + a carboxylate
an N-acylated aliphatic-L-amino acid + H2O = a carboxylate + an aliphatic L-amino acid
a D-hexose + an acyl phosphate = a D-hexose-phosphate + a carboxylate
an aldehyde + 2 an oxidized ferredoxin + H2O = a carboxylate + 2 a reduced ferredoxin + 3 H+
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+

In Transport reactions:
L-ornithine[cytosol]L-ornithine[mitochondrial lumen] ,
putrescine[cytosol] + L-ornithine[periplasmic space] → putrescine[periplasmic space] + L-ornithine[cytosol] ,
ATP + L-ornithine[periplasmic space] + H2O → ADP + L-ornithine[cytosol] + phosphate + H+

Enzymes activated by L-ornithine, sorted by the type of activation, are:

Activator (Allosteric) of: carbamoyl phosphate synthetase [Anderson77, Trotta74] , arginase [Colleluori01]

Enzymes inhibited by L-ornithine, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: acetylornithine deacetylase [Comment 1] , arginine decarboxylase, degradative [Blethen68] , lysine:cadaverine antiporter [Soksawatmaekhin04] , cadaverine:H+ symporter [Soksawatmaekhin04] , L-arginine:glycine amidinotransferase [Sipila80] , arginine deiminase [Hill67] , arginase [BSUB93] , arginase [Schrell89]

Inhibitor (Noncompetitive) of: agmatinase [Satishchandran86]

Inhibitor (Allosteric) of: arginine deiminase [Monstadt91, Comment 2]

Inhibitor (Mechanism unknown) of: S-methyl-L-methionine decarboxylase [Kocsis00] , L-lysine-α-ketoglutarate reductase [Hutzler75] , ornithine carbamoyltransferase [Comment 3]

This compound has been characterized as an alternative substrate of the following enzymes: L-lysine α-oxidase , L-lysine monooxygenase , cadaverine aminotransferase , lysine ε-aminotransferase , L-2,4-diaminobutyrate decarboxylase , L-arginine:pyruvate transaminase , L-lysine 6-aminotransferase , arginine racemase , D-nopaline synthase , L-lysine cyclodeaminase , lysine decarboxylase


References

Anderson77: Anderson PM (1977). "Binding of allosteric effectors to carbamyl-phosphate synthetase from Escherichia coli." Biochemistry 1977;16(4);587-93. PMID: 189806

Blethen68: Blethen SL, Boeker EA, Snell EE (1968). "Argenine decarboxylase from Escherichia coli. I. Purification and specificity for substrates and coenzyme." J Biol Chem 1968;243(8);1671-7. PMID: 4870599

BSUB93: "Bacillus subtilis and Other Gram-Positive Bacteria: Biochemistry, Physiology, and Molecular Genetics." (1993). Editors: Sonenshein, A.L., Hoch, J.A., Losick, R. American Society For Microbiology, Washington, DC.

Colleluori01: Colleluori DM, Morris SM, Ash DE (2001). "Expression, purification, and characterization of human type II arginase." Arch Biochem Biophys 389(1);135-43. PMID: 11370664

Hill67: Hill DL, Chambers P (1967). "The biosynthesis of proline by Tetrahymena pyriformis." Biochim Biophys Acta 148(2);435-47. PMID: 6075416

Hutzler75: Hutzler J, Dancis J (1975). "Lysine-ketoglutarate reductase in human tissues." Biochim Biophys Acta 377(1);42-51. PMID: 235294

Issaly74: Issaly IM, Issaly AS (1974). "Control of ornithine carbamoyltransferase activityby arginase in Bacillus subtilis." Eur J Biochem 1974;49(3);485-95. PMID: 4216455

JavidMajd00: Javid-Majd F, Blanchard JS (2000). "Mechanistic analysis of the argE-encoded N-acetylornithine deacetylase." Biochemistry 2000;39(6);1285-93. PMID: 10684608

Kocsis00: Kocsis MG, Hanson AD (2000). "Biochemical evidence for two novel enzymes in the biosynthesis of 3-dimethylsulfoniopropionate in Spartina alterniflora." Plant Physiol 123(3);1153-61. PMID: 10889264

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Monstadt91: Monstadt GM, Holldorf AW (1991). "Arginine deiminase from Halobacterium salinarium. Purification and properties." Biochem J 1991;273 ( Pt 3);739-45. PMID: 1847623

Satishchandran86: Satishchandran C, Boyle SM (1986). "Purification and properties of agmatine ureohydrolyase, a putrescine biosynthetic enzyme in Escherichia coli." J Bacteriol 1986;165(3);843-8. PMID: 3081491

Schrell89: Schrell A, Alt-Moerbe J, Lanz T, Schroeder J (1989). "Arginase of Agrobacterium Ti plasmid C58. DNA sequence, properties, and comparison with eucaryotic enzymes." Eur J Biochem 184(3);635-41. PMID: 2806247

Sipila80: Sipila I (1980). "Inhibition of arginine-glycine amidinotransferase by ornithine. A possible mechanism for the muscular and chorioretinal atrophies in gyrate atrophy of the choroid and retina with hyperornithinemia." Biochim Biophys Acta 613(1);79-84. PMID: 7378422

Soksawatmaekhin04: Soksawatmaekhin W, Kuraishi A, Sakata K, Kashiwagi K, Igarashi K (2004). "Excretion and uptake of cadaverine by CadB and its physiological functions in Escherichia coli." Mol Microbiol 51(5);1401-12. PMID: 14982633

Trotta74: Trotta PP, Pinkus LM, Haschemeyer RH, Meister A (1974). "Reversible dissociation of the monomer of glutamine-dependent carbamyl phosphate synthetase into catalytically active heavy and light subunits." J Biol Chem 1974;249(2);492-9. PMID: 4358555


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Fri Aug 28, 2015, biocyc14.