Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
twitter

MetaCyc Compound: ATP

Synonyms: adenylpyrophosphate, adenosine-triphosphate, adenosine-5'-triphosphate

Superclasses: a nucleic acid component a nucleotide a nucleoside triphosphate a ribonucleoside triphosphate a purine ribonucleoside 5'-triphosphate
a nucleic acid component a nucleotide a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-triphosphate
a nucleic acid component a nucleotide a ribonucleotide a purine ribonucleotide a purine ribonucleoside 5'-triphosphate
a nucleic acid component a nucleotide a ribonucleotide a ribonucleoside triphosphate a purine ribonucleoside 5'-triphosphate
a nucleic acid component
an organic heterocyclic compound an organic heterobicyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-triphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-triphosphate

Component of:
MgATP2-
MalT-Maltotriose-ATP DNA-binding transcriptional activator (extended summary available)

Chemical Formula: C10H12N5O13P3

Molecular Weight: 503.15 Daltons

Monoisotopic Molecular Weight: 506.99574515689994 Daltons

SMILES: C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OP(=O)([O-])[O-])([O-])=O

InChI: InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/p-4/t4-,6-,7-,10-/m1/s1

InChIKey: InChIKey=ZKHQWZAMYRWXGA-KQYNXXCUSA-J

Unification Links: CAS:56-65-5 , ChEBI:30616 , ChemSpider:4574455 , HMDB:HMDB00538 , IAF1260:33477 , KEGG:C00002 , MetaboLights:MTBLC30616 , PubChem:5461108

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -553.6995 Inferred by computational analysis [Latendresse13]

Reactions known to consume the compound:

(+)-camphor degradation , (-)-camphor degradation : [(1R)-4,5,5-trimethyl-2-oxocyclopent-3-enyl]acetate + ATP + coenzyme A → [(1R)-2,2,3-trimethyl-5-oxocyclopent-3-enyl]acetyl-CoA + AMP + diphosphate (-)-microperfuranone biosynthesis : 2 2-oxo-3-phenylpropanoate + 2 ATP + H2O → (-)-microperfuranone + 2 AMP + CO2 + 2 diphosphate (4R)-carveol and (4R)-dihydrocarveol degradation , limonene degradation I (D-limonene) : (3R)-3-isopropenyl-6-oxoheptanoate + ATP + coenzyme A → (3R)-3-isopropenyl-6-oxoheptanoyl-CoA + ADP + phosphate (4S)-carveol and (4S)-dihydrocarveol degradation , limonene degradation II (L-limonene) : (3S)-3-isopropenyl-6-oxoheptanoate + ATP + coenzyme A → (3S)-3-isopropenyl-6-oxoheptanoyl-CoA + ADP + phosphate (5R)-carbapenem carboxylate biosynthesis : (2S,5S)-5-carboxymethyl proline + ATP → (3S,5S)-carbapenam-3-carboxylate + AMP + diphosphate + H+ (Z)-9-tricosene biosynthesis : (15Z)-tetracosenoate + ATP + coenzyme A → (Z)-15-tetracosenoyl-CoA + AMP + diphosphate 1,3-propanediol biosynthesis (engineered) : β-D-glucose + ATP → β-D-glucose 6-phosphate + ADP + H+ ATP + β-D-fructofuranose 6-phosphate → ADP + fructose 1,6-bisphosphate + H+ 1,4-dihydroxy-2-naphthoate biosynthesis I : 2-succinylbenzoate + ATP + coenzyme A → 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + AMP + diphosphate 1,4-dihydroxy-2-naphthoate biosynthesis II (plants) : ATP + 2-succinylbenzoate + coenzyme A → 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA + ADP + phosphate 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3) : D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,4,5,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (1,3,4,5)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,4,5,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian) : D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,4,5)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza) : D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (3,4,6)-trisphosphate + ATP → D-myo-inositol (3,4,5,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (3,4)-bisphosphate + ATP → D-myo-inositol (3,4,6)-trisphosphate + ADP + H+ 1D-myo-inositol 3-monophosphate + ATP → D-myo-inositol (3,4)-bisphosphate + ADP + H+ D-myo-inositol (3,4,5,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ myo-inositol + ATP → 1D-myo-inositol 3-monophosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium) : D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (3,4,6)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (3,6)-bisphosphate + ATP → D-myo-inositol (3,4,6)-trisphosphate + ADP + H+ 1D-myo-inositol 3-monophosphate + ATP → D-myo-inositol (3,6)-bisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ myo-inositol + ATP → 1D-myo-inositol 3-monophosphate + ADP + H+ 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3) : D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,6)-tetrakisphosphate + ADP + H+ D-myo-inositol (1,3,4)-trisphosphate + ATP → D-myo-inositol (1,3,4,5)-tetrakisphosphate + ADP + H+ D-myo-inositol 1,3,4,5,6-pentakisphosphate + ATP → 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,3,4,5)-tetrakisphosphate + ATP → D-myo-inositol 1,3,4,5,6-pentakisphosphate + ADP + H+ 2'-deoxymugineic acid phytosiderophore biosynthesis , ethylene biosynthesis I (plants) , methionine degradation I (to homocysteine) , S-adenosyl-L-methionine biosynthesis , S-adenosyl-L-methionine cycle II : ATP + L-methionine + H2O → S-adenosyl-L-methionine + phosphate + diphosphate 2-amino-3-hydroxycyclopent-2-enone biosynthesis : 5-aminolevulinate + ATP + coenzyme A → 5-aminolevulinyl-CoA + AMP + diphosphate 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis , 4-hydroxy-2(1H)-quinolone biosynthesis , anthranilate degradation II (aerobic) , anthranilate degradation III (anaerobic) , aurachin A, B, C and D biosynthesis , aurachin RE biosynthesis : anthranilate + ATP + coenzyme A ↔ anthraniloyl-CoA + AMP + diphosphate 2-methylcitrate cycle I , 2-methylcitrate cycle II , β-alanine biosynthesis II , isoleucine biosynthesis IV : propanoate + ATP + coenzyme A → propanoyl-CoA + AMP + diphosphate 2-O-α-mannosyl-D-glycerate degradation , D-galactarate degradation I , D-glucarate degradation I , Entner-Doudoroff pathway II (non-phosphorylative) , formaldehyde assimilation I (serine pathway) : D-glycerate + ATP → 2-phospho-D-glycerate + ADP + H+ 3,3'-dithiodipropionate degradation : 3-sulfinopropionate + ATP + coenzyme A → 3-sulfinopropanoyl-CoA + ADP + phosphate 3-amino-3-phenylpropanoyl-CoA biosynthesis : L-β-phenylalanine + ATP + coenzyme A → (3R)-3-amino-3-phenylpropanoyl-CoA + AMP + diphosphate 3-amino-4,7-dihydroxy-coumarin biosynthesis : a NovH peptidyl-carrier protein + L-tyrosine + ATP → L-tyrosine-S-[NovH protein] + AMP + diphosphate 3-amino-5-hydroxybenzoate biosynthesis : kanosamine + ATP → D-kanosamine 6-phosphate + ADP + H+ 3-hydroxypropanoate cycle : 3-hydroxypropanoate + ATP + coenzyme A → 3-hydroxypropanoyl-CoA + AMP + diphosphate ATP + acetyl-CoA + hydrogen carbonate → malonyl-CoA + ADP + phosphate + H+ 3-hydroxypropanoate/4-hydroxybutanate cycle : 4-hydroxybutanoate + ATP + coenzyme A → 4-hydroxybutanoyl-CoA + AMP + diphosphate 3-hydroxypropanoate + ATP + coenzyme A → 3-hydroxypropanoyl-CoA + AMP + diphosphate ATP + acetyl-CoA + hydrogen carbonate → malonyl-CoA + ADP + phosphate + H+ 3-phenylpropionate degradation : 3-phenylpropanoate + ATP + coenzyme A → 3-phenylpropanoyl-CoA + AMP + diphosphate 3-phosphoinositide biosynthesis : a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ATP → a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate + ATP → 1-phosphatidyl-1D-myo-inositol 3,4,5-trisphosphate + ADP + H+ an L-1-phosphatidyl-inositol + ATP → a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ATP → 1-phosphatidyl-1D-myo-inositol 3,5-bisphosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 4-phosphate + ATP → a 1-phosphatidyl-1D-myo-inositol 3,4-bisphosphate + ADP + H+ an L-1-phosphatidyl-inositol + ATP → a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ADP + H+ 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis : 4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP 4-amino-2-methyl-5-phosphomethylpyrimidine biosynthesis (yeast) : pyridoxal + ATP → pyridoxal 5'-phosphate + ADP + H+ ATP + pyridoxine → ADP + pyridoxine 5'-phosphate + H+ 4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP 4-chlorobenzoate degradation : ATP + 4-chlorobenzoate + coenzyme A → AMP + 4-chlorobenzoyl-coA + diphosphate 4-coumarate degradation (anaerobic) : 4-coumarate + ATP + coenzyme A → 4-coumaryl-CoA + AMP + diphosphate 4-hydroxybenzoate + ATP + coenzyme A → 4-hydroxybenzoyl-CoA + AMP + diphosphate 4-ethylphenol degradation (anaerobic) : 4-hydroxybenzoyl-acetate + ATP + coenzyme A → 4-hydroxybenzoyl-acetyl-CoA + AMP + diphosphate 4-hydroxyacetophenone + CO2 + ATP + 2 H2O → 4-hydroxybenzoyl-acetate + AMP + 2 phosphate + 3 H+ 4-hydroxybenzoate biosynthesis I (eukaryotes) , 4-hydroxybenzoate biosynthesis V , flavonoid biosynthesis , naringenin biosynthesis (engineered) , phaselate biosynthesis , phenylpropanoid biosynthesis , umbelliferone biosynthesis , xanthohumol biosynthesis : 4-coumarate + ATP + coenzyme A → 4-coumaryl-CoA + AMP + diphosphate 4-methyl-5(β-hydroxyethyl)thiazole salvage (yeast) : ATP + 4-methyl-5-(β-hydroxyethyl)thiazole → ADP + 4-methyl-5-(2-phosphonooxyethyl)thiazole + H+ 5,6-dimethylbenzimidazole biosynthesis : riboflavin + ATP → ADP + FMN + H+ 5-aminoimidazole ribonucleotide biosynthesis I : ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → L-glutamate + ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + phosphate + H+ 5-phospho-β-D-ribosylamine + ATP + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+ ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+ 5-aminoimidazole ribonucleotide biosynthesis II : N1-(5-phospho-β-D-ribosyl)glycinamide + formate + ATPN2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + ADP + phosphate + H+ ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → L-glutamate + ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + phosphate + H+ 5-phospho-β-D-ribosylamine + ATP + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+ ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+ 5-dehydro-4-deoxy-D-glucuronate degradation , D-fructuronate degradation , D-galacturonate degradation I , Entner-Doudoroff pathway III (semi-phosphorylative) : 2-dehydro-3-deoxy-D-gluconate + ATP → 2-dehydro-3-deoxy-D-gluconate 6-phosphate + ADP + H+ 5-hydroxymethylfurfural degradation , furfural degradation : 2-furoate + ATP + coenzyme A → 2-furoyl-CoA + AMP + diphosphate 5-N-acetylardeemin biosynthesis : anthranilate + L-alanine + L-tryptophan + 3 ATP → ardeemin FQ + 3 AMP + 3 diphosphate + H2O + 2 H+ 6-gingerol analog biosynthesis : 4-coumarate + ATP + coenzyme A → 4-coumaryl-CoA + AMP + diphosphate octanoate + ATP + coenzyme A → octanoyl-CoA + AMP + diphosphate 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I , 6-hydroxymethyl-dihydropterin diphosphate biosynthesis II (archaea) , 6-hydroxymethyl-dihydropterin diphosphate biosynthesis III (Chlamydia) : 6-hydroxymethyl-7,8-dihydropterin + ATP → (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate + AMP + H+ 8-amino-7-oxononanoate biosynthesis III : pimelate + ATP + coenzyme A → pimeloyl-CoA + AMP + diphosphate acetate conversion to acetyl-CoA , chitin degradation to ethanol , ethanol degradation II , ethanol degradation IV , oxidative ethanol degradation III : acetate + ATP + coenzyme A → acetyl-CoA + AMP + diphosphate acetone degradation II (to acetoacetate) : acetone + CO2 + ATP + 2 H2O → acetoacetate + AMP + 2 phosphate + 3 H+ acetyl-CoA biosynthesis III (from citrate) : oxaloacetate + acetyl-CoA + ADP + phosphate ← citrate + ATP + coenzyme A acetylaszonalenin biosynthesis : L-tryptophan + anthranilate + 2 ATP → (R)-benzodiazepinedione + 2 ADP + 2 phosphate + H+ achromobactin biosynthesis : diaminobutyryl-citryl-ethanolamino-α-ketoglutarate + ATP + 2-oxoglutarate → achromobactin + AMP + diphosphate + H+ α-ketoglutaryl-diaminobutyryl-citryl-ethanolamine + ATP + 2-oxoglutarate → achromobactin + AMP + diphosphate + H+ diaminobutyryl-citryl-ethanolamine + ATP + 2-oxoglutarate → diaminobutyryl-citryl-ethanolamino-α-ketoglutarate + AMP + diphosphate + H+ diaminobutyryl-citryl-ethanolamine + ATP + 2-oxoglutarate → α-ketoglutaryl-diaminobutyryl-citryl-ethanolamine + AMP + diphosphate + H+ O-citryl-ethanolamine + ATP + L-2,4-diaminobutanoate → diaminobutyryl-citryl-ethanolamine + AMP + diphosphate + H+ citrate + ATP + ethanolamine → O-citryl-ethanolamine + AMP + diphosphate citrate + ATP + L-serine → O-citryl-L-serine + AMP + diphosphate acridone alkaloid biosynthesis : N-methylanthranilate + ATP + coenzyme A → N-methylanthraniloyl-CoA + AMP + diphosphate adenine and adenosine salvage II : adenosine + ATP → AMP + ADP + H+ adenine and adenosine salvage V : inosine + ATP → IMP + ADP + H+ adenosine deoxyribonucleotides de novo biosynthesis : dADP + ATP → dATP + ADP adenosine deoxyribonucleotides de novo biosynthesis II : dATP + an oxidized flavodoxin + H2O ← ATP + a reduced flavodoxin dADP + ATP → dATP + ADP adenosine ribonucleotides de novo biosynthesis : ATP + AMP ↔ 2 ADP

Reactions known to produce the compound:

Not in pathways:
a tRNA precursor + H2O → a tRNA + a ribonucleotide

Reactions known to both consume and produce the compound:

1-butanol autotrophic biosynthesis :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

3-hydroxypropanoate cycle , 3-hydroxypropanoate/4-hydroxybutanate cycle , propionyl CoA degradation :
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+

acetate formation from acetyl-CoA I , acetylene degradation , gallate degradation III (anaerobic) , lysine fermentation to acetate and butyrate , methanogenesis from acetate , purine nucleobases degradation I (anaerobic) , purine nucleobases degradation II (anaerobic) , pyruvate fermentation to acetate II , pyruvate fermentation to acetate IV , superpathway of fermentation (Chlamydomonas reinhardtii) :
ATP + acetate ↔ ADP + acetyl phosphate

acetate formation from acetyl-CoA II , pyruvate fermentation to acetate III :
acetate + ATP + coenzyme A ↔ acetyl-CoA + ADP + phosphate

adenosine nucleotides degradation IV , PRPP biosynthesis II :
α-D-ribose 1,5-bisphosphate + ATP ↔ 5-phospho-α-D-ribose 1-diphosphate + ADP

adenosine ribonucleotides de novo biosynthesis :
ATP + 3 H+[in] + H2O ↔ ADP + phosphate + 4 H+[out]

adenosylcobalamin salvage from cobinamide I :
adenosylcobinamide + ATP ↔ adenosyl-cobinamide phosphate + ADP + H+

allantoin degradation IV (anaerobic) , citrulline degradation :
ammonium + CO2 + ATP ↔ carbamoyl-phosphate + ADP + 2 H+

anaerobic energy metabolism (invertebrates, cytosol) , Entner-Doudoroff pathway II (non-phosphorylative) , Entner-Doudoroff pathway III (semi-phosphorylative) , gluconeogenesis II (Methanobacterium thermoautotrophicum) , glycolysis V (Pyrococcus) , photosynthetic 3-hydroxybutyrate biosynthesis (engineered) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

anaerobic energy metabolism (invertebrates, mitochondrial) :
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]

arginine biosynthesis II (acetyl cycle) , arginine biosynthesis III (via N-acetyl-L-citrulline) , ornithine biosynthesis :
N-acetyl-L-glutamate + ATPN-acetylglutamyl-phosphate + ADP

benzoyl-CoA degradation II (anaerobic) , benzoyl-CoA degradation III (anaerobic) :
cyclohex-1,5-diene-1-carbonyl-CoA + an oxidized ferredoxin + 2 ADP + 2 phosphate ↔ benzoyl-CoA + a reduced ferredoxin + 2 ATP + 2 H2O

Bifidobacterium shunt :
ATP + acetate ↔ ADP + acetyl phosphate
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

Calvin-Benson-Bassham cycle :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
D-ribulose 5-phosphate + ATP ↔ D-ribulose-1,5-bisphosphate + ADP + H+

chorismate biosynthesis from 3-dehydroquinate :
shikimate + ATP ↔ shikimate 3-phosphate + ADP + H+

creatine-phosphate biosynthesis :
creatine + ATP ↔ creatine-phosphate + ADP + H+

D-arabinose degradation II , ribitol degradation :
ATP + D-ribulose ↔ ADP + D-ribulose 5-phosphate + H+

D-galactose degradation V (Leloir pathway) , galactose degradation I (Leloir pathway) , galactose degradation III , stachyose degradation :
α-D-galactose + ATP ↔ α-D-galactose 1-phosphate + ADP + H+

ectoine biosynthesis , grixazone biosynthesis , homoserine biosynthesis , lysine biosynthesis I , lysine biosynthesis II , lysine biosynthesis III , lysine biosynthesis VI , norspermidine biosynthesis , spermidine biosynthesis II :
L-aspartate + ATP ↔ L-aspartyl-4-phosphate + ADP

ethylmalonyl pathway , formaldehyde assimilation I (serine pathway) :
(S)-malate + ATP + coenzyme A ↔ (S)-malyl-CoA + ADP + phosphate

formaldehyde assimilation III (dihydroxyacetone cycle) , gluconeogenesis I , gluconeogenesis III , sucrose biosynthesis I (from photosynthesis) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycerol degradation I :
glycerol + ATPsn-glycerol 3-phosphate + ADP + H+

glycerol degradation to butanol :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycolysis I (from glucose 6-phosphate) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycolysis II (from fructose 6-phosphate) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycolysis III (from glucose) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycolysis IV (plant cytosol) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycolysis VI (metazoan) :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

heterolactic fermentation :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

histidine biosynthesis :
1-(5-phospho-β-D-ribosyl)-ATP + diphosphate ↔ ATP + 5-phospho-α-D-ribose 1-diphosphate + H+

incomplete reductive TCA cycle , pyruvate fermentation to acetate V , pyruvate fermentation to acetate VI , reductive TCA cycle I , reductive TCA cycle II , TCA cycle I (prokaryotic) , TCA cycle II (plants and fungi) , TCA cycle III (animals) , TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase) , TCA cycle VI (obligate autotrophs) :
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]

isoprene biosynthesis II (engineered) :
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+
(R)-mevalonate 5-phosphate + ATP ↔ (R)-mevalonate diphosphate + ADP

L-1,2-propanediol degradation , threonine degradation I :
ATP + propanoate ↔ ADP + propanoyl phosphate

methylaspartate cycle :
propanoyl-CoA + ATP + hydrogen carbonate ↔ (S)-methylmalonyl-CoA + ADP + phosphate + H+
succinate[mitochondrial lumen] + ATP[mitochondrial lumen] + coenzyme A[mitochondrial lumen] ↔ succinyl-CoA[mitochondrial lumen] + ADP[mitochondrial lumen] + phosphate[mitochondrial lumen]

mevalonate pathway I :
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+
(R)-mevalonate 5-phosphate + ATP ↔ (R)-mevalonate diphosphate + ADP

mevalonate pathway II (archaea) :
isopentenyl phosphate + ATP ↔ isopentenyl diphosphate + ADP
(R)-mevalonate + ATP ↔ (R)-mevalonate 5-phosphate + ADP + H+

mevalonate pathway III (archaea) :
isopentenyl phosphate + ATP ↔ isopentenyl diphosphate + ADP

mixed acid fermentation :
ATP + acetate ↔ ADP + acetyl phosphate
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+

phosphatidate metabolism, as a signaling molecule :
a 1,2-diacyl-sn-glycerol 3-phosphate + ATP ↔ a 1,2-diacyl-sn-glycerol 3-diphosphate + ADP

PRPP biosynthesis I :
D-ribose 5-phosphate + ATP ↔ 5-phospho-α-D-ribose 1-diphosphate + AMP + H+

pyruvate fermentation to butanoate :
butanoate + ATP ↔ butanoyl phosphate + ADP

Rubisco shunt :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
D-ribulose 5-phosphate + ATP ↔ D-ribulose-1,5-bisphosphate + ADP + H+

selenocysteine biosynthesis II (archaea and eukaryotes) :
L-seryl-tRNAsec + ATPO-phospho-L-seryl-tRNASec + ADP

sulfate activation for sulfonation :
sulfate + ATP + H+ ↔ adenosine 5'-phosphosulfate + diphosphate
adenosine 5'-phosphosulfate + ATP ↔ 3'-phosphoadenylyl-sulfate + ADP + H+

sulfate reduction II (assimilatory) , sulfate reduction III (assimilatory) , sulfate reduction IV (dissimilatory) , sulfate reduction V (dissimilatory) , sulfite oxidation III :
sulfate + ATP + H+ ↔ adenosine 5'-phosphosulfate + diphosphate

superpathway of glucose and xylose degradation :
pyruvate + ATP ↔ phosphoenolpyruvate + ADP + H+
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

Not in pathways:
propanoate + ATP + coenzyme A ↔ propanoyl-CoA + ADP + phosphate
L-serine + ATP ↔ L-seryl-AMP + diphosphate
ATP + (polyphosphate)(n) ↔ ADP + (polyphosphate)(n+1)
taurocyamine + ATP ↔ N(ω)-phosphotaurocyamine + ADP + 2 H+
a reduced nitrogenase-reductase + an oxidized nitrogenase + 16 ATP ↔ an oxidized nitrogenase-reductase + a reduced nitrogenase + 16 ADP + 16 phosphate
lombricine + ATP ↔ N-phospholombricine + ADP + H+
guanidinoacetate + ATP ↔ guanidinoacetate-phosphate + ADP + H+
L-arginine + ATP ↔ Nω-phospho-L-arginine + ADP + H+
an isocitrate dehydrogenase + ATP ↔ a phosphorylated isocitrate dehydrogenase + ADP

In Reactions of unknown directionality:

Not in pathways: adenosine tetraphosphate + H2O = ATP + phosphate + 2 H+ AMP + an aryl aldehyde + NADP+ + diphosphate = ATP + an aromatic carboxylate + NADPH 5',5'''-diadenosine hexaphosphate + H2O = 2 ATP + 2 H+ 5',5'''-diadenosine pentaphosphate + H2O = ADP + ATP + 2 H+ 5',5'''-diadenosine tetraphosphate + H2O = ATP + AMP + 2 H+ a [protein]-L-arginine + ATP = a [protein]-Nω-phospho-L-arginine + ADP + H+ 4-methoxy-2,2'-bipyrrole-5-carbaldehyde + 2-undecylpyrrole + ATP = undecylprodigiosin + ADP + phosphate + H+ 4-hydroxy-2,2'-bipyrrole-5-carbaldehyde + 2-methyl-3-n-amyl-pyrrole + ATP = norprodigiosin + ADP + phosphate + H+ 2-amino-3-hydroxycyclopent-2-enone + 2,4,6-octatrienoate + ATP = 2,4,6-octatrienyl-2-amino-3-hydroxycyclopent-2-enone + AMP + diphosphate N6-L-threonylcarbamoyladenine37 in tRNA + ATP = cyclic N6-L-threonylcarbamoyladenosine 37 in tRNA + ADP + phosphate ATP + GTP = cyclic 3',5'-AMP-GMP + 2 diphosphate ATP + GTP = pppGp(2'-5')A + diphosphate carbamoyl-phosphate + ATP + H2O = O-carbamoyladenylate + diphosphate + phosphate sucrose + ATP = sucrose 6-phosphate + ADP + H+ ATP + H2O + H+ = ammonium + ITP ATP + a [protein]-L-histidine = a protein-Nπ-phospho-L-histidine + ADP + H+ a [protein]-L-histidine + ATP = a protein-Nτ-phospho-L-histidine + ADP + H+ O-alkylglycerone + ATP = 1-alkyl-glycerone 3-phosphate + ADP + H+ ATP + a [protein]-L-threonine = ADP + a [protein] L-threonine phosphate + H+ ATP + a [protein]-L-serine = ADP + a protein L-serine phosphate + H+ 6 a reduced flavodoxin + N2 + n ATP + 6 H+ = 6 an oxidized flavodoxin + 2 ammonium + n ADP + n phosphate ammonium + ATP = phosphoramidate + ADP + 2 H+ ATP + O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-mannosyl]-L-threonyl-[protein] = ADP + O2-[N-acetyl-β-D-galactosaminyl-(1→3)-N-acetyl-β-D-glucosaminyl-(1→4)-α-D-(6-phospho)mannosyl]-L-threonyl-[protein] + H+ glycine + ATP = glycyl-AMP + diphosphate L-aspartate + ATP + H+ = L-aspartyl adenylate + diphosphate L-threonine + ATP = L-threonyl-AMP + diphosphate D-tagatofuranose + ATP = D-tagatofuranose 6-phosphate + ADP + H+ aldehydo-D-arabinose + ATP = D-arabinose 5-phosphate + ADP + H+ ATP + α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)-[α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)]n-α-D-Man-(1→3)-α-D-Man-(1→3)-α-D-GlcNAc-diphospho-ditrans,octacis-undecaprenol = ADP + 3-O-phospho-α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)-[α-D-Man-(1→2)-α-D-Man-(1→2)-α-D-Man-(1→3)-α-D-Man-(1→3)]n-α-D-Man-(1→3)-α-D-Man-(1→3)-α-D-GlcNAc-diphospho-ditrans,octacis-undecaprenol L-threonine + hydrogen carbonate + ATP = L-threonylcarbamoyladenylate + diphosphate + H2O cobyrinate + L-glutamine + ATP + H2O = cob(II)yrinate c-monoamide + L-glutamate + ADP + phosphate + H+ ATP + [low-density-lipoprotein receptor]-L-serine = ADP + [low-density-lipoprotein receptor]-O-phospho-L-serine + H+ α-D-ribose 5-phosphate + ATP = α-D-ribose 1,5-bisphosphate + ADP + H+ 2 ATP = cyclic di-3',5'-adenylate + 2 diphosphate cob(II)yrinate c-monoamide + L-glutamine + ATP + H2O = cob(II)yrinate a,c-diamide + L-glutamate + ADP + phosphate + H+ ATP + dIDP = ADP + dITP 2'-deoxyribose + ATP = 2-deoxy-D-ribose 5-phosphate + ADP + H+ carbamate + ATP = carbamoyl-phosphate + ADP ATP + IDP = ITP + ADP 2'-deoxycytidine + ATP = dCMP + ADP + H+ ATP + (S)-NADPHX = ADP + NADPH + phosphate + H+ ATP + a diphospho-1D-myo-inositol pentakisphosphate = ADP + a bis(diphospho)-1D-myo-inositol tetrakisphosphate 4-methylbenzoyl-CoA + 2 ATP + a reduced electron acceptor + 2 H2O = 4-methylcyclohex-1,5-diene-1-carbonyl-CoA + 2 ADP + an oxidized electron acceptor + 2 phosphate + 2 H+ an [acetyl-CoA carboxylase] + ATP + H2O = an [acetyl-CoA carboxylase] phosphate + ADP + 2 H+ a D-hexose + ATP = D-hexose 6-phosphate + ADP + H+ ATP + ribulose = ADP + L(or D)-ribulose 5-phosphate + H+ an N-acyl-D-mannosamine + ATP = an N-acyl-α-D-mannosamine 6-phosphate + ADP + H+ a ceramide + ATP = a ceramide 1-phosphate + ADP + H+ a 1-phosphatidyl-1D-myo-inositol 3-phosphate + ATP = a 1-phosphatidyl-1D-myo-inositol 3,4-bisphosphate + ADP + H+ a linear α-D-glucan + ATP + H2O = [phospho-α-glucan] + AMP + phosphate + 2 H+ a double stranded DNA + ATP = a negatively supercoiled DNA + ADP + phosphate ATP + UDP-N-acetyl-α-D-glucosamine = ADP + UDP-N-acetyl-α-D-glucosamine 3'-phosphate + H+ ATP + α-maltose = ADP + α-maltose 1-phosphate + H+ D-myo-inositol (1,4,5)-trisphosphate + 2 ATP = D-myo-inositol 1,3,4,5,6-pentakisphosphate + 2 ADP + 2 H+ D-ornithine + L-lysine + ATP = D-ornithyl-Nε-L-lysine + ADP + phosphate oleandomycin + ATP = oleandomycin 2'-O-phosphate + ADP + H+ a [Co(II) trimethylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) trimethylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate a [Co(II) dimethylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) dimethylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate a [Co(II) methylamine-specific corrinoid protein] + ATP + a reduced electron acceptor = a [Co(I) methylamine-specific corrinoid protein] + ADP + an oxidized electron acceptor + phosphate poly (D-glutamate)n + L-glutamate + ATP = poly (D-glutamate)(n+1) + ADP + phosphate p-tRNAHis + ATP = App-tRNAHis + diphosphate p-tRNAHis + ATP + GTP = pppGp-tRNAHis + AMP + diphosphate a [protein]-N6-D-ribulosyl-L-lysine + ATP = a [protein]-N6-(3-O-phospho-D-ribulosyl)-L-lysine + ADP a [protein]-N6-D-fructosyl-L-lysine + ATP = a [protein]-N6-(3-O-phospho-D-fructosyl)-L-lysine + ADP + H+ an N5-formyl-tetrahydrofolate + L-glutamate + ATP = 5-formyl-THF-Glun+1 + ADP + phosphate peroxiredoxin-(S-hydroxy-S-oxocysteine) + ATP + a protein dithiol = peroxiredoxin-(S-hydroxycysteine) + ADP + a protein disulfide + phosphate + H+ a 1-monoglyceride + ATP = a 1-acyl-sn-glycerol 3-phosphate + ADP + H+ an N-acetyl-D-hexosamine + ATP = an N-acetyl-α-D-hexosamine 1-phosphate + ADP + H+ a nucleoside 5'-monophosphate + ATP = a 5'-phosphonucleoside 3'-diphosphate + AMP + H+ a kanamycin + ATP = a kanamycin 3-phosphate + ADP + H+ 2 ATP + ERK = phospho-ERK + 2 ADP MEK + 2 ATP = 2 ADP + phospho-MEK geranylgeraniol + ATP = all-trans-geranyl-geranyl monophosphate + ADP + H+ geraniol + ATP = geranyl monophosphate + ADP + H+ (2E,6E)-farnesol + ATP = 2-trans,-6-trans-farnesyl monophosphate + ADP + H+ 1-O-alkyl-sn-glycerol + ATP = a 1-alkyl-sn-glycerol 3-phosphate + ADP + H+ a 6-phosphogluco-maltodextrin + n ATP + n H2O = a poly-6-phosphogluco-maltodextrin + n AMP + n phosphate a maltodextrin + ATP + H2O = a 6-phosphogluco-maltodextrin + AMP + phosphate a [protein]-N6-D-erythrulosyl-L-lysine + ATP = a [protein]-N6-(O3)-phospho-D-erythrulosyl-L-lysine + ADP a [protein]-N6-D-psicosyl-L-lysine + ATP = a [protein]-N6-(O3)-phospho-D-psicosyl-L-lysine + ADP a supercoiled duplex DNA + ATP = a single stranded DNA + ADP + phosphate α-Kdo-(2→6)-lipid IVA + ATP = 4-O-phospho-α-Kdo-(2→6)-lipid IVA + ADP + H+ 3 N-hydroxy-N-succinylcadaverine + ATP = desferrioxamine G1 + ADP + phosphate + H+ + H2O D-myo-inositol (4,5)-bisphosphate + ATP = D-myo-inositol (1,4,5)-trisphosphate + ADP + H+ hygromycin-B + ATP = 4-O-phosphohygromycin + ADP + H+ ATP + an mRNA = an mRNA + diphosphate a myosin heavy chain + ATP = a myosin-heavy chain-phosphate + ADP a phosphorylase b + 2 ATP = a phosphorylase a + 2 ADP di-trans,octa-cis-undecaprenol + ATP = di-trans,octa-cis-undecaprenyl phosphate + ADP + H+ ATP + a β-adrenergic receptor = ADP + a phosphorylated β-adrenergic receptor ATP + a pyruvate dehydrogenase = ADP + a phosphorylated pyruvate dehydrogenase ATP + a branched-chain 2-keto acid dehydrogenase = ADP + a phosphorylated branched-chain 2-keto acid dehydrogenase a rhodopsin + ATP = a phosphorhodopsin + ADP ATP + [tyrosine-3-monooxygenase] = ADP + phosphorylated [tyrosine-3-monooxygenase] ATP + an IκB protein = ADP + a phosphorylated IκB protein ATP + a G-protein-coupled-receptor = ADP + a phosphorylated G-protein-coupled-receptor ATP + elongation-factor 2 = ADP + phosphorylated elongation-factor 2 ATP + a protein = ADP + a phosphoprotein ATP + mitogen-activated protein kinase kinase = ADP + phosphorylated mitogen-activated protein kinase kinase ATP + a receptor protein = ADP + a phosphorylated receptor protein Fas-activated serine/threonine protein + ATP = Fas-activated serine/threonine phosphoprotein + ADP Goodpasture antigen-binding protein + ATP = Goodpasture antigen-binding phosphoprotein + ADP ATP + myosin light-chain + H+ = ADP + myosin light-chain phosphate ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + a protein = ADP + a phosphoprotein ATP + ATP + H+ = 5',5'''-diadenosine tetraphosphate + diphosphate ATP + [phospho-α-glucan] + H2O = AMP + O-phospho-[phospho-α-glucan] + phosphate ATP + N-acetyl-α-D-galactosamine = ADP + N-acetyl-α-D-galactosamine 1-phosphate + H+ 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate + ATP = 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate + ADP + H+ D-myo-inositol (1,3,4,6)-tetrakisphosphate + ATP = 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate + ADP + H+ D-myo-inositol (1,4,5,6)-tetrakisphosphate + ATP = D-myo-inositol (1,2,4,5,6)-pentakisphosphate + ADP + H+ hypotaurocyamine + ATP = Nω-phosphohypotaurocyamine + ADP + H+ ATP + a 3-hydroxy-3-methylglutaryl-CoA reductase = ADP + a 3-hydroxy-3-methylglutaryl-CoA reductase-phosphate dihydrostreptomycin 6-phosphate + ATP = dihydrostreptomycin 3'-α-6-bisphosphate + ADP + H+ citramalate lyase, inactive + acetate + ATP = citramalate lyase, active + AMP + diphosphate L-phenylalanine + ATP + H2O = D-phenylalanine + AMP + diphosphate + H+ L-ascorbate + ATP = 2-phospho-L-ascorbate + ADP + H+ β-D-cellobiose + ATP = β-D-cellobiose 6'-phosphate + ADP + H+ erythritol + ATP = D-erythritol 4-phosphate + ADP + H+ ATP + dephospho-[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase = ADP + [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase hygromycin-B + ATP = 7''-O-phosphohygromycin B + ADP + H+ D-hamamelose + ATP = D-hamamelose 2'-phosphate + ADP + H+ α-D-glucose 1-phosphate + ATP = α-glucose 1,6-bisphosphate + ADP + H+ pantetheine + ATP = 4'-phosphopantetheine + ADP + H+ streptomycin + ATP = streptomycin 3''-phosphate + ADP + H+ D-sedoheptulose + ATP = D-sedoheptulose 7-phosphate + ADP + H+ a 5'-dephospho-DNA + ATP = a 5'-phospho-DNA + ADP ATP + [a DNA-directed RNA-polymerase] = ADP + phospho-[DNA-directed RNA-polymerase] xylitol + ATP = xylitol 5-phosphate + ADP + H+ viomycin + ATP = O-phosphoviomycin + ADP + H+ ATP + a tropomyocin = ADP + an O-phosphotropomyocin ATP + a tau protein = ADP + an O-phospho-tau protein isobutyrate + ATP = 2-methylpropanoyl phosphate + ADP formate + ATP = formyl phosphate + ADP L-glutamate + ATP = α-L-glutamyl phosphate + ADP agmatine + ATP = N4-Phosphoagmatine + ADP + 2 H+ guanidinoethyl methyl phosphate + ATP = N'-phosphoguanidinoethyl methyl phosphate + ADP + H+ (2E,6E)-farnesyl diphosphate + ATP = farnesyl triphosphate + ADP deoxy-5-methylcytidylate + ATP = 5-methyldeoxycytidine diphosphate + ADP ATP + ADP + H+ = 5',5'''-diadenosine tetraphosphate + phosphate streptomycin + ATP = 3''-adenylylstreptomycin + diphosphate

In Transport reactions:
ATP[cytosol]ATP[chloroplast stroma] ,
ATP[cytosol] + ADP[chloroplast stroma] + phosphate[chloroplast stroma]ATP[chloroplast stroma] + ADP[cytosol] + phosphate[cytosol] ,
Na+[in] + ATP + H2O ↔ Na+[out] + ADP + phosphate + H+ ,
Mg2+[extracellular space] + ATP + H2O → Mg2+[cytosol] + ADP + phosphate + H+ ,
a phospholipid[in] + ATP + H2O → a phospholipid[out] + ADP + phosphate + H+ ,
ATP + 4 H+[in] + H2O ↔ ADP + phosphate + 5 H+[out] ,
ATP + L-histidine[periplasmic space] + H2O → ADP + L-histidine[cytosol] + phosphate + H+ ,
ATP + D-xylose[periplasmic space] + H2O → ADP + D-xylose[cytosol] + phosphate + H+ ,
glutathione[periplasmic space] + ATP + H2O → glutathione[cytosol] + ADP + phosphate + H+ ,
Cu+[cytosol] + ATP + H2O → Cu+[periplasmic space] + ADP + phosphate + H+ ,
methyl-β-D-galactoside[periplasmic space] + ATP + H2O → methyl-β-D-galactoside[cytosol] + ADP + phosphate + H+ ,
ATP + β-D-galactose[periplasmic space] + H2O → ADP + β-D-galactose[cytosol] + phosphate + H+ ,
ATP + L-valine[periplasmic space] + H2O → ADP + L-valine[cytosol] + phosphate + H+ ,
Ni2+[periplasmic space] + ATP + H2O → Ni2+[cytosol] + ADP + phosphate + H+ ,
D-allose[periplasmic space] + ATP + H2O → D-allose[cytosol] + ADP + phosphate + H+ ,
L-cysteine[cytosol] + ATP + H2O → L-cysteine[periplasmic space] + ADP + phosphate + H+ ,
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[periplasmic space] + ATP + H2O → (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[cytosol] + ADP + phosphate + H+ ,
ATP + spermidine[periplasmic space] + H2O → ADP + spermidine[cytosol] + phosphate + H+ ,
Zn2+[periplasmic space] + ATP + H2O → Zn2+[cytosol] + ADP + phosphate + H+ ,
K+[periplasmic space] + ATP + H2O → K+[cytosol] + ADP + phosphate + H+ ,
selenite[periplasmic space] + ATP + H2O → selenite[cytosol] + ADP + phosphate + H+ ,
ATP + ferric enterobactin complex[periplasmic space] + H2O → ADP + ferric enterobactin complex[cytosol] + phosphate + H+ ,
ATP + phosphate[periplasmic space] + H2O → ADP + 2 phosphate[cytosol] + H+ ,
sulfate[periplasmic space] + ATP + H2O → sulfate[cytosol] + ADP + phosphate + H+ ,
Mg2+[periplasmic space] + ATP + H2O → Mg2+[cytosol] + ADP + phosphate + H+ ,
maltotriose[periplasmic space] + ATP + H2O → ADP + maltotriose[cytosol] + phosphate + H+ ,
ATP + L-glutamate[periplasmic space] + H2O → ADP + L-glutamate[cytosol] + phosphate + H+ ,
ATP + thiamin[periplasmic space] + H2O → ADP + thiamin[cytosol] + phosphate + H+ ,
a quaternary amine[periplasmic space] + ATP + H2O → a quaternary amine[cytosol] + ADP + phosphate + H+ ,
ATP + D-methionine[periplasmic space] + H2O → ADP + D-methionine[cytosol] + phosphate + H+ ,
L-methionine S-oxide[periplasmic space] + ATP + H2O → L-methionine S-oxide[cytosol] + ADP + phosphate + H+ ,
maltose[periplasmic space] + ATP + H2O → maltose[cytosol] + ADP + phosphate + H+ ,
ATP + L-leucine[periplasmic space] + H2O → ADP + L-leucine[cytosol] + phosphate + H+ ,
ATP + L-arabinose[periplasmic space] + H2O → ADP + L-arabinose[cytosol] + phosphate + H+ ,
ATP + L-arginine[periplasmic space] + H2O → ADP + L-arginine[cytosol] + phosphate + H+ ,
ATP + L-alanyl-γ-D-glutamyl-meso-diaminopimelate[periplasmic space] + H2O → L-alanyl-γ-D-glutamyl-meso-diaminopimelate[cytosol] + ADP + phosphate + H+ ,
ATP + an alkylphosphonate[periplasmic space] + H2O → ADP + an alkylphosphonate[cytosol] + phosphate + H+ ,
ATP + an aliphatic sulfonate[periplasmic space] + H2O → an aliphatic sulfonate[cytosol] + ADP + phosphate + H+ ,
selenate[periplasmic space] + ATP + H2O → selenate[cytosol] + ADP + phosphate + H+ ,
ATP + L-proline[periplasmic space] + H2O → ADP + L-proline[cytosol] + phosphate + H+ ,
ATP + thiosulfate[periplasmic space] + H2O → ADP + thiosulfate[cytosol] + phosphate + H+ ,
β-D-galactofuranose[periplasmic space] + ATP + H2O → β-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
ATP + L-glutamine[periplasmic space] + H2O → ADP + L-glutamine[cytosol] + phosphate + H+ ,
L-lysine[periplasmic space] + ATP + H2O → L-lysine[cytosol] + ADP + phosphate + H+ ,
ATP + ferric dicitrate[periplasmic space] + H2O → ADP + ferric dicitrate[cytosol] + phosphate + H+ ,
heme b[cytosol] + ATP + H2O → heme b[periplasmic space] + ADP + phosphate + H+ ,
N-acetyl-DL-methionine[periplasmic space] + ATP + H2O → N-acetyl-DL-methionine[cytosol] + ADP + phosphate + H+ ,
ATP + L-isoleucine[periplasmic space] + H2O → ADP + L-isoleucine[cytosol] + phosphate + H+ ,
ATP + sn-glycerol 3-phosphate[periplasmic space] + H2O → ADP + sn-glycerol 3-phosphate[cytosol] + phosphate + H+ ,
glutathione[cytosol] + ATP + H2O → glutathione[periplasmic space] + ADP + phosphate + H+ ,
ATP + L-aspartate[periplasmic space] + H2O → L-aspartate[cytosol] + ADP + phosphate + H+ ,
a glycerophosphodiester[periplasmic space] + ATP + H2O → a glycerophosphodiester[cytosol] + ADP + phosphate + H+ ,
ATP + molybdate[periplasmic space] + H2O → ADP + molybdate[cytosol] + phosphate + H+ ,
ATP + L-ornithine[periplasmic space] + H2O → ADP + L-ornithine[cytosol] + phosphate + H+ ,
ATP + cob(I)alamin[periplasmic space] + H2O → ADP + cob(I)alamin[cytosol] + phosphate + H+ ,
ATP + L-methionine[periplasmic space] + H2O → ADP + L-methionine[cytosol] + phosphate + H+ ,
ATP + putrescine[periplasmic space] + H2O → ADP + putrescine[cytosol] + phosphate + H+ ,
taurine[periplasmic space] + ATP + H2O → taurine[cytosol] + ADP + phosphate + H+ ,
α-D-galactofuranose[periplasmic space] + ATP + H2O → α-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
ATP + a ferric hydroxamate complex[periplasmic space] + H2O → ADP + a ferric hydroxamate complex[cytosol] + phosphate ,
ATP + β-D-ribopyranose[periplasmic space] + H2O → ADP + β-D-ribopyranose[cytosol] + phosphate + H+ ,
ATP + a dipeptide[periplasmic space] + H2O → ADP + a dipeptide[cytosol] + phosphate + H+ ,
ATP + arsenate[cytosol] + H2O → ADP + arsenate[periplasmic space] + phosphate + H+ ,
maltotetraose[periplasmic space] + ATP + H2O → ADP + maltotetraose[cytosol] + phosphate + H+ ,
maltose[extracellular space] + ATP + H2O → maltose[cytosol] + ADP + phosphate + H+ ,
2 K+[extracellular space] + 3 Na+[cytosol] + ATP + H2O → 2 K+[cytosol] + 3 Na+[extracellular space] + ADP + phosphate + H+ ,
ATP + H+[cytosol] + H2O → ADP + phosphate + H+[extracellular space] ,
Na+[cytosol] + ATP + H2O ↔ Na+[extracellular space] + ADP + phosphate + H+ ,
tungstate[periplasmic space] + ATP + H2O → tungstate[cytosol] + ADP + phosphate + H+ ,
an Fe(III)-siderophore[extracellular space] + ATP + H2O → an Fe(III)-siderophore[cytosol] + ADP + phosphate + H+ ,
Cu2+[cytosol] + ATP + H2O → Cu2+[extracellular space] + ADP + phosphate + H+ ,
ATP + phosphate[periplasmic space] + H2O ↔ ADP + phosphate[cytosol] + phosphate[cytosol] + H+ ,
Cu+[cytosol] + ATP + H2O ↔ Cu+[extracellular space] + ADP + phosphate + H+ ,
an aminoalkylphosphonate[periplasmic space] + ATP + H2O → an aminoalkylphosphonate[cytosol] + ADP + phosphate + H+ ,
Cu2+[out] + ATP + H2O ↔ Cu2+[in] + ADP + phosphate + H+ ,
lipid A-core[cytosol] + ATP + H2O → lipid A-core[periplasmic space] + ADP + phosphate + H+ ,
a long-chain acyl-CoA[peroxisomal membrane] + ATP + H2O ↔ a long-chain acyl-CoA[peroxisomal membrane] + ADP + phosphate + H+ ,
Zn2+[cytosol] + ATP + H2O → Zn2+[periplasmic space] + ADP + phosphate + H+ ,
Ca2+[out] + ATP + H2O ↔ Ca2+[in] + ADP + phosphate + H+ ,
Ca2+[in] + ATP + H2O ↔ Ca2+[out] + ADP + phosphate + H+ ,
Ca2+[plastid stroma] + ATP + H2O ↔ Ca2+[cytosol] + ADP + phosphate + H+ ,
Ag+[cytosol] + ATP + H2O ↔ Ag+[extracellular space] + ADP + phosphate + H+ ,
Cd2+[cytosol] + ATP + H2O ↔ Cd2+[vacuolar lumen] + ADP + phosphate + H+ ,
heme b[cytosol] + ATP + H2O ↔ heme b[periplasmic space] + ADP + phosphate + H+ ,
guanine[extracellular space] + ATP + H2O ↔ guanine[cytosol] + ADP + phosphate + H+ ,
taurine[extracellular space] + ATP + H2O ↔ taurine[cytosol] + ADP + phosphate + H+ ,
Mn2+[extracellular space] + ATP + H2O ↔ Mn2+[cytosol] + ADP + phosphate + H+ ,
Fe3+[extracellular space] + ATP + H2O ↔ Fe3+[cytosol] + ADP + phosphate + H+ ,
Cd2+[cytosol] + ATP + H2O ↔ Cd2+[extracellular space] + ADP + phosphate + H+ ,
molybdate[extracellular space] + ATP + H2O ↔ molybdate[cytosol] + ADP + phosphate + H+ ,
phosphonate[extracellular space] + ATP + H2O ↔ phosphonate[cytosol] + ADP + phosphate + H+ ,
nitrate[extracellular space] + ATP + H2O ↔ nitrate[cytosol] + ADP + phosphate + H+ ,
sulfate[extracellular space] + ATP + H2O ↔ sulfate[cytosol] + ADP + phosphate + H+ ,
Ni2+[extracellular space] + ATP + H2O ↔ Ni2+[cytosol] + ADP + phosphate + H+ ,
sn-glycerol 3-phosphate[extracellular space] + ATP + H2O ↔ sn-glycerol 3-phosphate[cytosol] + ADP + phosphate + H+ ,
ATP + K+[out] + H2O ↔ ADP + K+[in] + phosphate + H+ ,
chloride[extracellular space] + ATP + H2O ↔ chloride[cytosol] + ADP + phosphate + H+ ,
ATP + K+[out] + H2O + H+[in] → ADP + K+[in] + phosphate + H+[in] + H+[in] ,
a capsular polysaccharide[in] + ATP + H2O ↔ a capsular polysaccharide[out] + ADP + phosphate ,
chloride[cytosol] + ATP + H2O ↔ chloride[extracellular space] + ADP + phosphate + H+ ,
a polyamine[extracellular space] + ATP + H2O ↔ a polyamine[cytosol] + ADP + phosphate ,
a non-polar amino acid[extracellular space] + ATP + H2O ↔ a non-polar amino acid[cytosol] + ADP + phosphate ,
a polar amino acid[extracellular space] + ATP + H2O ↔ a polar amino acid[cytosol] + ADP + phosphate ,
a lipopolysaccharide[cytosol] + ATP + H2O → a lipopolysaccharide[periplasmic space] + ADP + phosphate + H+ ,
a teichoic acid[cytosol] + ATP + H2O ↔ a teichoic acid[cell wall] + ADP + phosphate ,
a peptide[cytosol] + ATP + H2O ↔ a peptide[extracellular space] + ADP + phosphate ,
a xenobiotic[cytosol] + ATP + H2O ↔ a xenobiotic[extracellular space] + ADP + phosphate ,
α factor[cytosol] + ATP + H2O ↔ α factor[extracellular space] + ADP + phosphate ,
a monosaccharide[extracellular space] + ATP + H2O ↔ a monosaccharide[cytosol] + ADP + phosphate ,
a β-D glucan[cytosol] + ATP + H2O ↔ a β-D glucan[extracellular space] + ADP + phosphate ,
a vitamin B12[extracellular space] + ATP + H2O ↔ a vitamin B12[cytosol] + ADP + phosphate ,
a quaternary amine[extracellular space] + ATP + H2O ↔ a quaternary amine[cytosol] + ADP + phosphate + H+ ,
an oligopeptide[extracellular space] + ATP + H2O ↔ an oligopeptide[cytosol] + ADP + phosphate ,
an oligosaccharide[extracellular space] + ATP + H2O ↔ an oligosaccharide[cytosol] + ADP + phosphate

Enzymes activated by ATP, sorted by the type of activation, are:

Activator (Allosteric) of: aspartate transcarbamylase [Ke84, Gerhart62] , thymidine kinase [Iwatsuki67, Chen78, Comment 1] , ribonucleoside-triphosphate reductase [Eliasson94, Comment 2] , [protein-PII] uridylyltransferase , AMP deaminase [BauschJurken95] , IMP 5'-nucleotidase [Spychala88] , GDP reductase , methyl-coenzyme M reductase [Gunsalus78] , dimethylamine methyltransferase [Wassenaar98]

Activator (Mechanism unknown) of: biotin-[acetyl-CoA-carboxylase] ligase [Barker81] , guanosine-3',5'-bis(diphosphate) 3'-diphosphatase [Heinemeyer77] , homoserine dehydrogenase [Ogilvie75] , glycerol kinase [Pettigrew90] , inosine kinase [HoveJensen89a] , guanosine kinase [HoveJensen89a] , phosphoglycerate kinase , tRNA C32 thiolase [Bouvier14] , isocitrate dehydrogenase phosphatase [Nimmo84a] , ribonucleoside-diphosphate reductase [Thelander78] , arginine kinase [Yao09] , sucrose phosphate phosphatase [But13] , sucrose phosphate synthase [But13] , decarbamoylnovobiocin carbamoyltranferase [Freel04] , CDP reductase [Roshick00] , oleanolate UDP-glucuronosyltransferase [Wojciechowski75] , 3-hydroxymethylcephem O-carbamoyltransferase [Brewer80] , deacetoxycephalosporin C hydroxylase [Baker91] , deacetoxycephalosporin C hydroxylase [Dotzlaf87] , deacetoxycephalosporin C synthase [Dotzlaf87] , nicotinate phosphoribosyltransferase [Wagner86b] , 2-(2'-methylthio)ethylmalate synthase [Textor04] , lactyl-CoA dehydratase [Comment 3] , succinate dehydrogenase [Dey97] , phytyl-P kinase [Ischebeck06]

Enzymes inhibited by ATP, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: D-mannonate oxidoreductase [MandrandBerthel77] , GTP cyclohydrolase [Yim76] , citrate synthase , malate:quinone oxidoreductase [Narindrasorasak79] , 6-phosphogluconate dehydrogenase [Westwood74, Comment 4] , methylenetetrahydrofolate dehydrogenase [Comment 5] , tRNA(i6A37) synthase [Leung97] , ITPase [Zheng05] , fumarase [Payne79] , phosphoenolpyruvate carboxykinase (GTP) [Rohrer86] , (S)-ethylmalonyl-coA decarboxylase [Linster11] , FAD-AMP lyase (cyclizing) [Cabezas01] , cytidine 5'-monophosphate N-acetylneuraminate synthetase [RodriguezAparic92] , pyruvate kinase [Singh98] , NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase [Crow79] , butanol dehydrogenase [Comment 6] , trehalose phosphorylase [Wannet98] , dimethylallyl-diphosphate:AMP dimethylallyltransferase [Takei01] , ADP-dependent phosphofructokinase [Tuininga99] , sorbitol-6-phosphate dehydrogenase [kanayamaY93] , dopamine sulfotransferase [Whittemore85]

Inhibitor (Uncompetitive) of: APS kinase [Lillig01]

Inhibitor (Noncompetitive) of: phosphate acetyltransferase [Suzuki69, CamposBermudez10, Comment 7] , pyruvate kinase [Singh98] , succinate semialdehyde dehydrogenase [Busch99]

Inhibitor (Allosteric) of: 6-phosphofructokinase [Guixe98, Kotlarz81] , adenylate cyclase [Yang83a] , glycogen phosphorylase [Arrese95] , NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase [Brunner98] , mannitol-1-phosphate 5-dehydrogenase [Brown77a] , pyruvate kinase [Turner00]

Inhibitor (Mechanism unknown) of: dTMP kinase [Nelson69, Helmward89, Comment 8] , glutaminase B [Prusiner76] , L-xylulose kinase [Sanchez94] , thiamine phosphate synthase [Kayama73, Kawasaki79, Comment 9] , pyruvate kinase [Comment 10] , phosphoenolpyruvate carboxykinase (ATP) [Krebs80] , malate dehydrogenase, NAD-requiring [Milne79] , D-lactate dehydrogenase [Tarmy68a] , mannose isomerase [Itoh08a] , m7GTP pyrophosphatase [Tchigvintsev13] , McrBC restriction endonuclease [Sutherland92] , deoxyribonucleoside 5'-monophosphate phosphatase [Proudfoot04] , adenosine 3'-phosphate phosphohydrolase [Proudfoot04] , ADP-sugar pyrophosphatase [MorenoBruna01] , GMP reductase [Mager60, Comment 11] , GTPase [Jain09] , pyruvate kinase [Holwerda73] , glycerol 3-phosphate dehydrogenase [Albertyn92] , arginine kinase [Yao09] , phosphoribosylpyrophosphate amidotransferase [Satyanarayana71] , glycogen phosphorylase [Dombradi85] , D-galacturonate dehydrogenase [Wagner76] , phosphoenolpyruvate carboxylase [Patel04] , glucose-6-phosphate dehydrogenase [Chistoserdova00] , ornithine carbamoyltransferase, catabolic [Ruepp95] , adenylosuccinate synthetase [Comment 12] , D-lactate dehydrogenase [Schweiger84] , phosphotransbutyrylase [Comment 13] , phosphoribosylpyrophosphate amidotransferase [Satyanarayana71] , L-lactate dehydrogenase [Gordon76] , homogalacturonan methyltransferase [Goubet99] , triose phosphate isomerase [Tomlinson79] , L-lactate dehydrogenase [Davies72] , acetyl-CoA acetyltransferase [Wiesenborn88, Comment 14] , canavaninosuccinate synthetase [Hwang96] , L-α-aminoadipate δ-semialdehyde:NAD oxidoreductase [Rodwell71] , 6-phosphofructokinase [Garland80] , 6-phosphofructokinase [Garland80] , 6-phosphofructokinase [Knowles90] , 6-phosphofructokinase [Knowles90] , fructose-1,6-bisphosphate aldolase [Lal05] , methylenetetrahydrofolate dehydrogenase [Uyeda67]

Inhibitor (Other types) of: cyclic ADP-ribose hydrolase [Takasawa93] , 3-phosphoglycerate kinase [KopkeSecundo90] , 3-phosphoglycerate kinase [KopkeSecundo90]

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: N6,N6,O-tridemethylpuromycin synthetase , carbapenam synthetase , AMP deaminase


References

Albertyn92: Albertyn J, van Tonder A, Prior BA (1992). "Purification and characterization of glycerol-3-phosphate dehydrogenase of Saccharomyces cerevisiae." FEBS Lett 308(2);130-2. PMID: 1499720

Arrese95: Arrese EL, Rojas-Rivas BI, Wells MA (1995). "Purification and properties of glycogen phosphorylase from the fat body of larval Manduca sexta." Insect Biochem Mol Biol 25(2);209-16. PMID: 7711751

Baker91: Baker BJ, Dotzlaf JE, Yeh WK (1991). "Deacetoxycephalosporin C hydroxylase of Streptomyces clavuligerus. Purification, characterization, bifunctionality, and evolutionary implication." J Biol Chem 266(8);5087-93. PMID: 2002049

Barker81: Barker DF, Campbell AM (1981). "The birA gene of Escherichia coli encodes a biotin holoenzyme synthetase." J Mol Biol 146(4);451-67. PMID: 7024555

BauschJurken95: Bausch-Jurken MT, Sabina RL (1995). "Divergent N-terminal regions in AMP deaminase and isoform-specific catalytic properties of the enzyme." Arch Biochem Biophys 321(2);372-80. PMID: 7646062

Bouvier14: Bouvier D, Labessan N, Clemancey M, Latour JM, Ravanat JL, Fontecave M, Atta M (2014). "TtcA a new tRNA-thioltransferase with an Fe-S cluster." Nucleic Acids Res 42(12);7960-70. PMID: 24914049

Brewer80: Brewer SJ, Taylor PM, Turner MK (1980). "An adenosine triphosphate-dependent carbamoylphosphate--3-hydroxymethylcephem O-carbamoyltransferase from Streptomyces clavuligerus." Biochem J 185(3);555-64. PMID: 6248024

Brown77a: Brown AT, Bowles RD (1977). "Polyol metabolism by a caries-conducive Streptococcus: purification and properties of a nicotinamide adenine dinucleotide-dependent mannitol-1-phosphate dehydrogenase." Infect Immun 16(1);163-73. PMID: 873604

Brunner98: Brunner NA, Brinkmann H, Siebers B, Hensel R (1998). "NAD+-dependent glyceraldehyde-3-phosphate dehydrogenase from Thermoproteus tenax. The first identified archaeal member of the aldehyde dehydrogenase superfamily is a glycolytic enzyme with unusual regulatory properties." J Biol Chem 273(11);6149-56. PMID: 9497334

Busch99: Busch KB, Fromm H (1999). "Plant succinic semialdehyde dehydrogenase. Cloning, purification, localization in mitochondria, and regulation by adenine nucleotides." Plant Physiol 121(2);589-97. PMID: 10517851

But13: But SY, Khmelenina VN, Reshetnikov AS, Trotsenko YA (2013). "Bifunctional sucrose phosphate synthase/phosphatase is involved in the sucrose biosynthesis by Methylobacillus flagellatus KT." FEMS Microbiol Lett. PMID: 23865613

Cabezas01: Cabezas A, Pinto RM, Fraiz F, Canales J, Gonzalez-Santiago S, Cameselle JC (2001). "Purification, characterization, and substrate and inhibitor structure-activity studies of rat liver FAD-AMP lyase (cyclizing): preference for FAD and specificity for splitting ribonucleoside diphosphate-X into ribonucleotide and a five-atom cyclic phosphodiester of X, either a monocyclic compound or a cis-bicyclic phosphodiester-pyranose fusion." Biochemistry 40(45);13710-22. PMID: 11695920

CamposBermudez10: Campos-Bermudez VA, Bologna FP, Andreo CS, Drincovich MF (2010). "Functional dissection of Escherichia coli phosphotransacetylase structural domains and analysis of key compounds involved in activity regulation." FEBS J 277(8);1957-66. PMID: 20236319

Chen78: Chen MS, Prusoff WH (1978). "Thymidine kinase from Escherichia coli." Methods Enzymol 1978;51;354-60. PMID: 357898

Chistoserdova00: Chistoserdova L, Gomelsky L, Vorholt JA, Gomelsky M, Tsygankov YD, Lidstrom ME (2000). "Analysis of two formaldehyde oxidation pathways in Methylobacillus flagellatus KT, a ribulose monophosphate cycle methylotroph." Microbiology 146 ( Pt 1);233-8. PMID: 10658669

Crow79: Crow VL, Wittenberger CL (1979). "Separation and properties of NAD+- and NADP+-dependent glyceraldehyde-3-phosphate dehydrogenases from Streptococcus mutans." J Biol Chem 254(4);1134-42. PMID: 33184

Davies72: Davies DD, Davies S (1972). "Purification and properties of L(+)-lactate dehydrogenase from potato tubers." Biochem J 129(4);831-9. PMID: 4144124

Dev78a: Dev IK, Harvey RJ (1978). "A complex of N5,N10-methylenetetrahydrofolate dehydrogenase and N5,N10-methenyltetrahydrofolate cyclohydrolase in Escherichia coli. Purification, subunit structure, and allosteric inhibition by N10-formyltetrahydrofolate." J Biol Chem 1978;253(12);4245-53. PMID: 350870

Dey97: Dey, PM, Harborne, JB "Plant Biochemistry." Academic Press 1997.

Dombradi85: Dombradi V, Hajdu J, Friedrich P, Bot G (1985). "Purification and characterization of glycogen phosphorylase from Drosophila melanogaster." Insect Biochem. Vol. 15, No. 3, pp. 403-410.

Dotzlaf87: Dotzlaf JE, Yeh WK (1987). "Copurification and characterization of deacetoxycephalosporin C synthetase/hydroxylase from Cephalosporium acremonium." J Bacteriol 169(4);1611-8. PMID: 3558321

Eliasson94: Eliasson R, Pontis E, Sun X, Reichard P (1994). "Allosteric control of the substrate specificity of the anaerobic ribonucleotide reductase from Escherichia coli." J Biol Chem 269(42);26052-7. PMID: 7929317

Freel04: Freel Meyers CL, Oberthur M, Xu H, Heide L, Kahne D, Walsh CT (2004). "Characterization of NovP and NovN: completion of novobiocin biosynthesis by sequential tailoring of the noviosyl ring." Angew Chem Int Ed Engl 43(1);67-70. PMID: 14694473

Garland80: Garland WJ, Dennis DT (1980). "Plastid and cytosolic phosphofructokinase from the developing endosperm of Ricinus communis. I. Separation, purification, and initial characterization of the isozymes." Arch Biochem Biophys 204(1);302-9. PMID: 6448583

Gerhart62: GERHART JC, PARDEE AB (1962). "The enzymology of control by feedback inhibition." J Biol Chem 237;891-6. PMID: 13897943

Gordon76: Gordon GL, Doelle HW (1976). "Purification, properties and immunological relationship of L (+)-lactate dehydrogenase from Lactobacillus casei." Eur J Biochem 67(2);543-55. PMID: 823016

Goubet99: Goubet F, Mohnen D (1999). "Solubilization and partial characterization of homogalacturonan-methyltransferase from microsomal membranes of suspension-cultured tobacco cells." Plant Physiol 121(1);281-90. PMID: 10482684

Guixe98: Guixe V, Rodriguez PH, Babul J (1998). "Ligand-induced conformational transitions in Escherichia coli phosphofructokinase 2: evidence for an allosteric site for MgATP2-." Biochemistry 37(38);13269-75. PMID: 9748334

Gunsalus78: Gunsalus RP, Wolfe RS (1978). "ATP activation and properties of the methyl coenzyme M reductase system in Methanobacterium thermoautotrophicum." J Bacteriol 135(3);851-7. PMID: 29032

Heinemeyer77: Heinemeyer EA, Richter D (1977). "In vitro degradation of guanosine tetraphosphate (ppGpp) by an enzyme associated with the ribosomal fraction from Escherichia coli." FEBS Lett 1977;84(2);357-61. PMID: 340264

Helmward89: Helmward Z "Handbook of Enzyme Inhibitors. 2nd, revised and enlarged edition." Weinheim, Federal Republic of Germany ; New York, NY, USA , 1989.

Hofmeister92: Hofmeister AE, Buckel W (1992). "(R)-lactyl-CoA dehydratase from Clostridium propionicum. Stereochemistry of the dehydration of (R)-2-hydroxybutyryl-CoA to crotonyl-CoA." Eur J Biochem 1992;206(2);547-52. PMID: 1597194

Holwerda73: Holwerda DA, de Zwaan A (1973). "Kinetic and molecular characteristics of allosteric pyruvate kinase from muscle tissue of the sea mussel Mytilus edulis L." Biochim Biophys Acta 309(2);296-306. PMID: 4354457

HoveJensen89a: Hove-Jensen B, Nygaard P (1989). "Role of guanosine kinase in the utilization of guanosine for nucleotide synthesis in Escherichia coli." J Gen Microbiol 135(5);1263-73. PMID: 2559948

Hwang96: Hwang, In Doo, Lee, Yi, Kim, Sang-Gu, Lee, Jong Seob, Kwong, Young Myung (1996). "Enzyme activities of canavanine metabolism in Canavalia lineata L. callus." J. Plant Physiol., 1996, 149:494-500.

Ischebeck06: Ischebeck T, Zbierzak AM, Kanwischer M, Dormann P (2006). "A salvage pathway for phytol metabolism in Arabidopsis." J Biol Chem 281(5);2470-7. PMID: 16306049

Itoh08a: Itoh T, Mikami B, Hashimoto W, Murata K (2008). "Crystal structure of YihS in complex with D-mannose: structural annotation of Escherichia coli and Salmonella enterica yihS-encoded proteins to an aldose-ketose isomerase." J Mol Biol 377(5);1443-59. PMID: 18328504

Iwatsuki67: Iwatsuki N, Okazaki R (1967). "Mechanism of regulation of deoxythymidine kinase of Escherichia coli. I. Effect of regulatory deoxynucleotides on the state of aggregation of the enzyme." J Mol Biol 1967;29(1);139-54. PMID: 4861610

Jain09: Jain N, Dhimole N, Khan AR, De D, Tomar SK, Sajish M, Dutta D, Parrack P, Prakash B (2009). "E. coli HflX interacts with 50S ribosomal subunits in presence of nucleotides." Biochem Biophys Res Commun 379(2);201-5. PMID: 19109926

kanayamaY93: kanayama Y., Yamaki S. (1993). "Purification and properties of NADP-dependent sorbitol-6-phosphate dehydrogenase from apple seedlings." Plant Cell Physiol. 34(6):819-823.

Kawasaki79: Kawasaki T (1979). "Thiamine phosphate pyrophosphorylase." Methods Enzymol 1979;62;69-73. PMID: 374983

Kayama73: Kayama Y, Kawasaki T (1973). "Purification and properties of thiaminephosphate pyrophosphorylase of Escherichia coli." Arch Biochem Biophys 1973;158(1);242-8. PMID: 4580841

Ke84: Ke HM, Honzatko RB, Lipscomb WN (1984). "Structure of unligated aspartate carbamoyltransferase of Escherichia coli at 2.6-A resolution." Proc Natl Acad Sci U S A 1984;81(13);4037-40. PMID: 6377306

Knowles90: Knowles VL, Greyson MF, Dennis DT (1990). "Characterization of ATP-Dependent Fructose 6-Phosphate 1-Phosphotransferase Isozymes from Leaf and Endosperm Tissues of Ricinus communis." Plant Physiol 92(1);155-159. PMID: 16667239

KopkeSecundo90: Kopke-Secundo E., Molnar I., Schnarrenberger C. (1990). "Isolation and characterization of the cytosolic and chloroplastic 3-phosphoglycerate kinase from spinach leaves." Plant Physiol. 93:40-47.

Kotlarz81: Kotlarz D, Buc H (1981). "Regulatory properties of phosphofructokinase 2 from Escherichia coli." Eur J Biochem 1981;117(3);569-74. PMID: 6456900

Krebs80: Krebs A, Bridger WA (1980). "The kinetic properties of phosphoenolpyruvate carboxykinase of Escherichia coli." Can J Biochem 1980;58(4);309-18. PMID: 6991069

Kuchta85: Kuchta RD, Abeles RH (1985). "Lactate reduction in Clostridium propionicum. Purification and properties of lactyl-CoA dehydratase." J Biol Chem 1985;260(24);13181-9. PMID: 4055736

Lal05: Lal A, Plaxton WC, Kayastha AM (2005). "Purification and characterization of an allosteric fructose-1,6-bisphosphate aldolase from germinating mung beans (Vigna radiata)." Phytochemistry 66(9);968-74. PMID: 15896364

Latendresse13: Latendresse M. (2013). "Computing Gibbs Free Energy of Compounds and Reactions in MetaCyc."

Leung97: Leung HC, Chen Y, Winkler ME (1997). "Regulation of substrate recognition by the MiaA tRNA prenyltransferase modification enzyme of Escherichia coli K-12." J Biol Chem 272(20);13073-83. PMID: 9148919

Lillig01: Lillig CH, Schiffmann S, Berndt C, Berken A, Tischka R, Schwenn JD (2001). "Molecular and catalytic properties of Arabidopsis thaliana adenylyl sulfate (APS)-kinase." Arch Biochem Biophys 392(2);303-10. PMID: 11488606

Linster11: Linster CL, Noel G, Stroobant V, Vertommen D, Vincent MF, Bommer GT, Veiga-da-Cunha M, Van Schaftingen E (2011). "Ethylmalonyl-CoA decarboxylase, a new enzyme involved in metabolite proofreading." J Biol Chem 286(50);42992-3003. PMID: 22016388

Lipps99: Lipps G, Krauss G (1999). "Adenylosuccinate synthase from Saccharomyces cerevisiae: homologous overexpression, purification and characterization of the recombinant protein." Biochem J 1999;341 ( Pt 3);537-43. PMID: 10417315

Mager60: Mager J, Magasanik B (1960). "Guanosine 5'-phosphate reductase and its role in the interconversion of purine nucleotides." J Biol Chem 1960;235(5):1474-1478.

MandrandBerthel77: Mandrand-Berthelot MA, Lagarde AE (1977). ""Hit-and-run" mechanism for D-glucuronate reduction catalyzed by D-mannonate:NAD oxidoreductase of Escherichia coli." Biochim Biophys Acta 1977;483(1);6-23. PMID: 195622

Milne79: Milne JA, Cook RA (1979). "Role of metal cofactors in enzyme regulation. Differences in the regulatory properties of the Escherichia coli nicotinamide adenine dinucleotide specific malic enzyme depending on whether Mg2+ or Mn2+ serves as divalent cation." Biochemistry 18(16);3604-10. PMID: 224913

MorenoBruna01: Moreno-Bruna B, Baroja-Fernandez E, Munoz FJ, Bastarrica-Berasategui A, Zandueta-Criado A, Rodriguez-Lopez M, Lasa I, Akazawa T, Pozueta-Romero J (2001). "Adenosine diphosphate sugar pyrophosphatase prevents glycogen biosynthesis in Escherichia coli." Proc Natl Acad Sci U S A 98(14);8128-32. PMID: 11416161

Narindrasorasak79: Narindrasorasak S, Goldie AH, Sanwal BD (1979). "Characteristics and regulation of a phospholipid-activated malate oxidase from Escherichia coli." J Biol Chem 1979;254(5);1540-5. PMID: 368072

Nelson69: Nelson DJ, Carter CE (1969). "Purification and characterization of Thymidine 5-monophosphate kinase from Escherichia coli B." J Biol Chem 1969;244(19);5254-62. PMID: 4899016

Nimmo84a: Nimmo GA, Borthwick AC, Holms WH, Nimmo HG (1984). "Partial purification and properties of isocitrate dehydrogenase kinase/phosphatase from Escherichia coli ML308." Eur J Biochem 141(2);401-8. PMID: 6329756

Ogilvie75: Ogilvie JW, Vickers LP, Clark RB, Jones MM (1975). "Aspartokinase I-homoserine dehydrogenase I of Escherichia coli K12 (lambda). Activation by monovalent cations and an analysis of the effect of the adenosine triphosphate-magnesium ion complex on this activation process." J Biol Chem 250(4);1242-50. PMID: 163250

Patel04: Patel HM, Kraszewski JL, Mukhopadhyay B (2004). "The phosphoenolpyruvate carboxylase from Methanothermobacter thermautotrophicus has a novel structure." J Bacteriol 186(15);5129-37. PMID: 15262949

Payne79: Payne M, Powley D, Harris B (1979). "Purification, characterization and the presumptive role of fumarase in the energy metabolism of Ascaris suum." J. Parasitol. 65 833-841.

Pettigrew90: Pettigrew DW, Yu GJ, Liu Y (1990). "Nucleotide regulation of Escherichia coli glycerol kinase: initial-velocity and substrate binding studies." Biochemistry 1990;29(37);8620-7. PMID: 2148683

Proudfoot04: Proudfoot M, Kuznetsova E, Brown G, Rao NN, Kitagawa M, Mori H, Savchenko A, Yakunin AF (2004). "General enzymatic screens identify three new nucleotidases in Escherichia coli. Biochemical characterization of SurE, YfbR, and YjjG." J Biol Chem 279(52);54687-94. PMID: 15489502

Prusiner76: Prusiner S, Stadtman ER (1976). "Regulation of glutaminase B in Escherichia coli. III. Control by nucleotides and divalent cations." J Biol Chem 1976;251(11);3463-9. PMID: 776970

RodriguezAparic92: Rodriguez-Aparicio LB, Luengo JM, Gonzalez-Clemente C, Reglero A (1992). "Purification and characterization of the nuclear cytidine 5'-monophosphate N-acetylneuraminic acid synthetase from rat liver." J Biol Chem 267(13);9257-63. PMID: 1577759

Rodwell71: Rodwell V.W. (1971). "Δ1-Piperideine-6-carboxylic acid and α-aminoadipic acid δ-semialdehyde." Methods Enzymol. 178:188-199.

Rohrer86: Rohrer SP, Saz HJ, Nowak T (1986). "Purification and characterization of phosphoenolpyruvate carboxykinase from the parasitic helminth Ascaris suum." J Biol Chem 261(28);13049-55. PMID: 3759946

Roshick00: Roshick C, Iliffe-Lee ER, McClarty G (2000). "Cloning and characterization of ribonucleotide reductase from Chlamydia trachomatis." J Biol Chem 275(48);38111-9. PMID: 10984489

Ruepp95: Ruepp A, Muller HN, Lottspeich F, Soppa J (1995). "Catabolic ornithine transcarbamylase of Halobacterium halobium (salinarium): purification, characterization, sequence determination, and evolution." J Bacteriol 1995;177(5);1129-36. PMID: 7868583

Sanchez94: Sanchez JC, Gimenez R, Schneider A, Fessner WD, Baldoma L, Aguilar J, Badia J (1994). "Activation of a cryptic gene encoding a kinase for L-xylulose opens a new pathway for the utilization of L-lyxose by Escherichia coli." J Biol Chem 1994;269(47);29665-9. PMID: 7961955

Satyanarayana71: Satyanarayana T, Kaplan JG (1971). "Regulation of the purine pathway in bakers yeast: activity and feedback inhibition of phosphoribosyl-pyrophosphate amidotransferase." Arch Biochem Biophys 1971;142(1);40-7. PMID: 4322810

Schweiger84: Schweiger G, Buckel W (1984). "On the dehydration of (R)-lactate in the fermentation of alanine to propionate by Clostridium propionicum." FEBS Lett 1984;171(1);79-84. PMID: 6586495

Singh98: Singh DK, Malhotra SP, Singh R (1998). "Purification and characterizaton of plastidic pyruvate kinase from developing seeds of Brassica campestris L." Indian J Biochem Biophys 35(6);346-52. PMID: 10412228

Speranza89: Speranza ML, Valentini G, Iadarola P, Stoppini M, Malcovati M, Ferri G (1989). "Primary structure of three peptides at the catalytic and allosteric sites of the fructose-1,6-bisphosphate-activated pyruvate kinase from Escherichia coli." Biol Chem Hoppe Seyler 1989;370(3);211-6. PMID: 2653362

Spychala88: Spychala J, Madrid-Marina V, Fox IH (1988). "High Km soluble 5'-nucleotidase from human placenta. Properties and allosteric regulation by IMP and ATP." J Biol Chem 263(35);18759-65. PMID: 2848805

Sutherland92: Sutherland E, Coe L, Raleigh EA (1992). "McrBC: a multisubunit GTP-dependent restriction endonuclease." J Mol Biol 225(2);327-48. PMID: 1317461

Suzuki69: Suzuki T (1969). "Phosphotransacetylase of Escherichia coli B, activation by pyruvate and inhibition by NADH and certain nucleotides." Biochim Biophys Acta 1969;191(3);559-69. PMID: 4312205

Takasawa93: Takasawa S, Tohgo A, Noguchi N, Koguma T, Nata K, Sugimoto T, Yonekura H, Okamoto H (1993). "Synthesis and hydrolysis of cyclic ADP-ribose by human leukocyte antigen CD38 and inhibition of the hydrolysis by ATP." J Biol Chem 268(35);26052-4. PMID: 8253715

Takei01: Takei K, Sakakibara H, Sugiyama T (2001). "Identification of genes encoding adenylate isopentenyltransferase, a cytokinin biosynthesis enzyme, in Arabidopsis thaliana." J Biol Chem 276(28);26405-10. PMID: 11313355

Tarmy68a: Tarmy EM, Kaplan NO (1968). "Kinetics of Escherichia coli B D-lactate dehydrogenase and evidence for pyruvate-controlled change in conformation." J Biol Chem 1968;243(10);2587-96. PMID: 4297266

Tchigvintsev13: Tchigvintsev A, Tchigvintsev D, Flick R, Popovic A, Dong A, Xu X, Brown G, Lu W, Wu H, Cui H, Dombrowski L, Joo JC, Beloglazova N, Min J, Savchenko A, Caudy AA, Rabinowitz JD, Murzin AG, Yakunin AF (2013). "Biochemical and structural studies of conserved Maf proteins revealed nucleotide pyrophosphatases with a preference for modified nucleotides." Chem Biol 20(11);1386-98. PMID: 24210219

Textor04: Textor S, Bartram S, Kroymann J, Falk KL, Hick A, Pickett JA, Gershenzon J (2004). "Biosynthesis of methionine-derived glucosinolates in Arabidopsis thaliana: recombinant expression and characterization of methylthioalkylmalate synthase, the condensing enzyme of the chain-elongation cycle." Planta 218(6);1026-35. PMID: 14740211

Thelander78: Thelander L, Sjoberg BR, Eriksson S (1978). "Ribonucleoside diphosphate reductase (Escherichia coli)." Methods Enzymol 1978;51;227-37. PMID: 357894

Tomlinson79: Tomlinson J.D., Turner J.F. "Pea seed triose phosphate isomerase." Phytochemistry (1979) 18:1959-1962.

Tuininga99: Tuininga JE, Verhees CH, van der Oost J, Kengen SW, Stams AJ, de Vos WM (1999). "Molecular and biochemical characterization of the ADP-dependent phosphofructokinase from the hyperthermophilic archaeon Pyrococcus furiosus." J Biol Chem 274(30);21023-8. PMID: 10409652

Turner00: Turner WL, Plaxton WC (2000). "Purification and characterization of cytosolic pyruvate kinase from banana fruit." Biochem J 352 Pt 3;875-82. PMID: 11104698

Uyeda67: Uyeda K, Rabinowitz JC (1967). "Enzymes of clostridial purine fermentation. Methylenetetrahydrofolate dehydrogenase." J Biol Chem 242(19);4378-85. PMID: 4383631

Wagner76: Wagner G, Hollmann S (1976). "Uronic acid dehydrogenase from Pseudomonas syringae. Purification and properties." Eur J Biochem 61(2);589-96. PMID: 2471

Wagner86b: Wagner R, Feth F, Wagner KG (1986). "The pyridine-nucleotide cycle in tobacco. Enzyme activities for the recycling of NAD." Planta,167, 226-232.

Wannet98: Wannet WJ, Op den Camp HJ, Wisselink HW, van der Drift C, Van Griensven LJ, Vogels GD (1998). "Purification and characterization of trehalose phosphorylase from the commercial mushroom Agaricus bisporus." Biochim Biophys Acta 1425(1);177-88. PMID: 9813313

Wassenaar98: Wassenaar RW, Keltjens JT, van der Drift C, Vogels GD (1998). "Purification and characterization of dimethylamine:5-hydroxybenzimidazolyl-cobamide methyltransferase from Methanosarcina barkeri Fusaro." Eur J Biochem 253(3);692-7. PMID: 9654067

Welch89: Welch RW, Rudolph FB, Papoutsakis ET (1989). "Purification and characterization of the NADH-dependent butanol dehydrogenase from Clostridium acetobutylicum (ATCC 824)." Arch Biochem Biophys 1989;273(2);309-18. PMID: 2673038

Westwood74: Westwood AW, Doelle HW "Glucose-6-phosphate and 6-phosphogluconate dehydrogenases and their control mechanisms in Escherichia coli K-12." Microbios 1974;9:143-165.

Whittemore85: Whittemore RM, Pearce LB, Roth JA (1985). "Purification and kinetic characterization of a dopamine-sulfating form of phenol sulfotransferase from human brain." Biochemistry 24(10);2477-82. PMID: 3860259

Wiesenborn88: Wiesenborn DP, Rudolph FB, Papoutsakis ET (1988). "Thiolase from Clostridium acetobutylicum ATCC 824 and Its Role in the Synthesis of Acids and Solvents." Appl Environ Microbiol 54(11);2717-2722. PMID: 16347774

Wiesenborn89: Wiesenborn DP, Rudolph FB, Papoutsakis ET (1989). "Phosphotransbutyrylase from Clostridium acetobutylicum ATCC 824 and its role in acidogenesis." Appl Environ Microbiol 1989;55(2);317-22. PMID: 2719475

Wojciechowski75: Wojciechowski, ZdzisImageaw A. (1975). "Biosynthesis of oleanolic acid glycosides by subcellular fractions of Calendula officinalis seedlings." Phytochemistry. 14:1749-1753.

Yang83a: Yang JK, Epstein W (1983). "Purification and characterization of adenylate cyclase from Escherichia coli K12." J Biol Chem 1983;258(6);3750-8. PMID: 6300054

Yao09: Yao CL, Ji PF, Kong P, Wang ZY, Xiang JH (2009). "Arginine kinase from Litopenaeus vannamei: cloning, expression and catalytic properties." Fish Shellfish Immunol 26(3);553-8. PMID: 19239924

Yim76: Yim JJ, Brown GM (1976). "Characteristics of guanosine triphosphate cyclohydrolase I purified from Escherichia coli." J Biol Chem 1976;251(16);5087-94. PMID: 821948

Zheng05: Zheng J, Singh VK, Jia Z (2005). "Identification of an ITPase/XTPase in Escherichia coli by structural and biochemical analysis." Structure 13(10);1511-20. PMID: 16216582


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Tue Nov 25, 2014, biocyc14.