Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
Updated BioCyc iOS App now
available in iTunes store
twitter

MetaCyc Compound Class: NAD(P)H

Synonyms: β-NAD(P)H

Superclasses: a nucleic acid componenta nucleotidea dinucleotidea dinucleotide electron carrier
a nucleic acid componenta nucleotidea dinucleotide electron carrier
a nucleic acid componentan oligonucleotidea dinucleotidea dinucleotide electron carrier
an acceptora redox electron carrier

Summary:
NAD(P)H is a class of compounds including the instances NADH and NADPH.

NAD(P)H compound structure

Instances:
NADH,
NADPH

SMILES: C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O[R])C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)

Unification Links: ChEBI:13392

Reactions known to consume the compound:

1,4-dichlorobenzene degradation , 2,4,5-trichlorophenoxyacetate degradation , 2,4,6-trichlorophenol degradation , 3,4,6-trichlorocatechol degradation , 3,5-dichlorocatechol degradation , 3-chlorocatechol degradation I (ortho) , 3-chlorocatechol degradation II (ortho) , 4,5-dichlorocatechol degradation , 4-aminophenol degradation , 4-chlorocatechol degradation , 4-hydroxyacetophenone degradation , 4-sulfocatechol degradation , chlorosalicylate degradation , γ-hexachlorocyclohexane degradation , pentachlorophenol degradation , resorcinol degradation :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+

1,5-anhydrofructose degradation :
1,5-anhydro-D-mannitol + NAD(P)+ ← 1,5-anhydro-D-fructose + NAD(P)H + H+

2'-deoxymugineic acid phytosiderophore biosynthesis :
2'-deoxymugineate + NAD(P)+ ← 3''-deamino-3''-oxonicotianamine + NAD(P)H + H+

2,4-dinitrotoluene degradation :
4-methyl-5-nitrocatechol + NAD(P)H + oxygen → 2-hydroxy-5-methylquinone + nitrite + NAD(P)+ + H+ + H2O

2-hydroxyphenazine biosynthesis :
phenazine-1-carboxylate + NAD(P)H + oxygen + H+ → 2-hydroxyphenazine-1-carboxylate + NAD(P)+ + H2O

2-nitrobenzoate degradation II :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+
2-hydroxylaminobenzoate + NAD(P)H + H+ → anthranilate + NAD(P)+ + H2O

4-methyl-proline biosynthesis :
4-methyl-proline + NAD(P)H + H+ + oxygen → 4-methyl-3-hydroxy-proline + NAD(P)+ + H2O

4-nitrobenzoate degradation :
4-nitrobenzoate + 2 NAD(P)H + 2 H+ → 4-hydroxylaminobenzoate + 2 NAD(P)+ + H2O

4-nitrophenol degradation I :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrophenol + NAD(P)H + oxygen + H+ → 1,4-benzoquinone + nitrite + NAD(P)+ + H2O

4-nitrophenol degradation II :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrocatechol + NAD(P)H + oxygen → 2-hydroxy-1,4-benzoquinone + nitrite + NAD(P)+ + H2O + H+

5,6-dimethylbenzimidazole biosynthesis I (aerobic) , bacterial bioluminescence :
FMNH2 + NAD(P)+ ← FMN + NAD(P)H + 2 H+

8-O-methylfusarubin biosynthesis :
pentadecane-2,4,6,8,10,12,14-heptonyl-[acp] + NAD(P)H + H+ → 6-O-demethylfusarubinaldehyde + a holo-[acyl-carrier protein] + NAD(P)+ + 2 H2O

ajmaline and sarpagine biosynthesis :
10-deoxysarpagine + NAD(P)H + oxygen + H+ → sarpagine + NAD(P)+ + H2O

alkane biosynthesis I :
a long-chain aldehyde + a holo-[acyl-carrier protein] + NAD(P)+ ← a long-chain acyl-[acyl-carrier protein] + NAD(P)H + H+

alkylnitronates degradation , nitrate reduction V (assimilatory) :
ammonium + 3 NAD(P)+ + 2 H2O ← nitrite + 3 NAD(P)H + 5 H+

α-cyclopiazonate detoxification :
α-cyclopiazonate + NAD(P)H + H+ + oxygen → 2-oxocyclopiazonate + NAD(P)+ + H2O

anthranilate degradation I (aerobic) , indole-3-acetate degradation VIII (bacterial) :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+

anthranilate degradation II (aerobic) :
anthraniloyl-CoA + 2 NAD(P)H + oxygen + 2 H+ → 2-amino-5-oxocyclohex-1-enecarboxyl-CoA + 2 NAD(P)+ + H2O

arabidopyrone biosynthesis :
iso-arabidopaldehyde + NAD(P)H + H+iso-arabidopyl alcohol + NAD(P)+
arabidopaldehyde + NAD(P)H + H+ → arabidopyl alcohol + NAD(P)+

arachidonate biosynthesis I (6-desaturase, lower eukaryotes) , arachidonate biosynthesis III (6-desaturase, mammals) :
3-oxo-dihomo γ-linolenoyl-CoA + NAD(P)H + H+ → 3R-hydroxy-dihomo γ-linolenoyl-CoA + NAD(P)+

archaetidylserine and archaetidylethanolamine biosynthesis :
2,3-bis-O-phytanyl-sn-glycerol 1-phosphate + 8 NAD(P)+ ← 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate + 8 NAD(P)H + 8 H+

Reactions known to produce the compound:

(Z)-phenylmethanethial S-oxide biosynthesis :
phenylmethanesulfenate + NAD(P)+ → (Z)-phenylmethanethial S-oxide + NAD(P)H + H+

3,6-anhydro-α-L-galactopyranose degradation :
3,6-anhydro-L-galactofuranose + NAD(P)+ + H2O → 3,6-anhydro-L-galactonate + NAD(P)H + 2 H+

4-aminobutanoate degradation III :
succinate semialdehyde + NAD(P)+ + H2O → succinate + NAD(P)H + 2 H+

4-coumarate degradation (anaerobic) :
4-hydroxybenzaldehyde + NAD(P)+ + H2O → 4-hydroxybenzoate + NAD(P)H + 2 H+

abscisic acid biosynthesis shunt :
trans-abscisic alcohol + 2 NAD(P)+ + H2O → 2-trans-abscisate + 2 NAD(P)H + 3 H+
cis-abscisic alcohol + 2 NAD(P)+ + H2O → 2-cis-abscisate + 2 NAD(P)H + 3 H+

acrylate degradation :
3-oxopropanoate + coenzyme A + NAD(P)+ → acetyl-CoA + CO2 + NAD(P)H

allantoin degradation IV (anaerobic) :
S-ureidoglycolate + NAD(P)+ → oxalurate + NAD(P)H + H+

arabidopyrone biosynthesis :
arabidopaldehyde + NAD(P)+ + H2O → arabidopate + NAD(P)H + 2 H+
iso-arabidopaldehyde + NAD(P)+ + H2O → iso-arabidopate + NAD(P)H + 2 H+

aurofusarin biosynthesis :
dimeric rubrofusarin-9-hydroxyrubrofusarin + NAD(P)+ → fuscofusarin + NAD(P)H + H+
dimeric 9-hydroxyrubrofusarin-fuscofusarin + NAD(P)+ → aurofusarin + NAD(P)H + H+
dimeric 9-hydroxyrubrofusarin + 2 NAD(P)+ → aurofusarin + 2 NAD(P)H + 2 H+

β-alanine biosynthesis I , β-alanine biosynthesis IV :
3-aminopropanal + NAD(P)+ + H2O → β-alanine + NAD(P)H + 2 H+

bikaverin biosynthesis :
7-hydroxy-pre-bikaverin + NAD(P)+ → 7,10-diketo-pre-bikaverin + NAD(P)H + 3 H+

cholesterol biosynthesis I :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

cholesterol biosynthesis II (via 24,25-dihydrolanosterol) :
4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ → 4α-methyl-5α-cholesta-8-en-3-one + CO2 + NAD(P)H
4α-carboxy-5α-cholesta-8-en-3β-ol + NAD(P)+ → 5α-cholesta-8-en-3-one + CO2 + NAD(P)H

cholesterol biosynthesis III (via desmosterol) :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

dehydro-D-arabinono-1,4-lactone biosynthesis :
D-arabinofuranose + NAD(P)+ → D-arabinono-1,4-lactone + NAD(P)H + H+

ferulate and sinapate biosynthesis :
coniferaldehyde + NAD(P)+ + H2O → ferulate + NAD(P)H + 2 H+

fluorene degradation I :
9-fluorenol + NAD(P)+ → 9-fluorenone + NAD(P)H + H+

heterolactic fermentation :
D-gluconate 6-phosphate + NAD(P)+ → D-ribulose 5-phosphate + CO2 + NAD(P)H

Reactions known to both consume and produce the compound:

allopregnanolone biosynthesis :
allopregnanolone + NAD(P)+ ↔ 5-α-pregnane-3,20-dione + NAD(P)H + H+

cholate degradation (bacteria, anaerobic) :
choloyl-CoA + NAD(P)+ ↔ 3-oxo-cholyl-CoA + NAD(P)H + H+

formaldehyde assimilation I (serine pathway) :
D-glycerate + NAD(P)+ ↔ hydroxypyruvate + NAD(P)H + H+

formaldehyde oxidation II (glutathione-dependent) :
S-hydroxymethylglutathione + NAD(P)+S-formylglutathione + NAD(P)H + H+

formaldehyde oxidation V (H4MPT pathway) :
5,10-methylene-tetrahydromethanopterin + NAD(P)+ ↔ 5,10-methenyltetrahydromethanopterin + NAD(P)H

GABA shunt , L-glutamate biosynthesis II , L-glutamate degradation X , L-ornithine biosynthesis II :
L-glutamate + NAD(P)+ + H2O ↔ 2-oxoglutarate + ammonium + NAD(P)H + H+

gliotoxin inactivation :
gliotoxin + NAD(P)H + H+ ↔ dithiolgliotoxin + NAD(P)+

imidazole-lactate degradation , L-histidine degradation IV :
imidazole-lactate + NAD(P)+ ↔ imidazole-pyruvate + NAD(P)H + H+

L-idonate degradation :
L-idonate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+
D-gluconate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+

L-ornithine degradation II (Stickland reaction) :
(2R,4S)-2, 4-diaminopentanoate + NAD(P)+ + H2O ↔ 2-amino-4-oxopentanoate + ammonium + NAD(P)H + H+

L-sorbose degradation :
keto-L-sorbose 1-phosphate + NAD(P)H + H+ ↔ D-sorbitol 6-phosphate + NAD(P)+

morphine biosynthesis :
morphine + NAD(P)+ ↔ morphinone + NAD(P)H + H+

pyruvate fermentation to butanol I , pyruvate fermentation to butanol II :
butanal + coenzyme A + NAD(P)+ ↔ butanoyl-CoA + NAD(P)H + H+

superpathway of photosynthetic hydrogen production :
a plastoquinone + NAD(P)H + H+ ↔ a plastoquinol + NAD(P)+

Not in pathways:
D-glyceraldehyde 3-phosphate + NAD(P)+ + phosphate ↔ 1,3-bisphospho-D-glycerate + NAD(P)H + H+
NAD(P)+ + H2NAD(P)H + H+
(2R)-3-sulfolactate + NAD(P)+ ↔ 3-sulfopyruvate + NAD(P)H + H+
(S)-malate + NAD(P)+ ↔ oxaloacetate + NAD(P)H + H+
D-glucopyranose + NAD(P)+ ↔ D-glucono-1,5-lactone + NAD(P)H + H+

In Reactions of unknown directionality:

Not in pathways:
16-α-hydroxysteroid + NAD(P)+ = 16-oxosteroid + NAD(P)H + H+
1-indanol + NAD(P)+ = indanone + NAD(P)H + H+
a protein dithiol + NAD(P)+ = a protein disulfide + NAD(P)H + H+
an n-alkanal + NAD(P)+ = an alk-2-enal + NAD(P)H + H+
nitrous oxide + NAD(P)+ + H2O = 2 nitric oxide + NAD(P)H + H+
23,24-dihydrocucurbitacin B + NAD(P)+ = cucurbitacin B + NAD(P)H + H+
2-acetamidofluorene + NAD(P)+ + H2O = N-hydroxy-2-acetamidofluorene + NAD(P)H + H+
thiomorpholine-3-carboxylate + NAD(P)+ = 3,4-dehydrothiomorpholine-3-carboxylate + NAD(P)H + 2 H+
3-oxopropanoate + NAD(P)+ + H2O = malonate + NAD(P)H + 2 H+
D-glycerate + CO2 + NAD(P)+ = 2-hydroxy-3-oxosuccinate + NAD(P)H + 2 H+
estradiol-17α + NAD(P)+ = estrone + NAD(P)H + H+
D-mannonate + NAD(P)+ = D-mannuronate + NAD(P)H + H+
D-ribitol 5-phosphate + NAD(P)+ = D-ribulose 5-phosphate + NAD(P)H + H+
2 a reduced rubredoxin + NAD(P)+ + H+ = 2 an oxidized rubredoxin + NAD(P)H
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
nitrite + NAD(P)+ + H2O = nitrate + NAD(P)H + H+
(+)-thujan-3-ol + NAD(P)+ = (+)-thujan-3-one + NAD(P)H + H+
(20S)-17,20-dihydroxypregn-4-en-3-one + NAD(P)+ = 17-α-hydroxyprogesterone + NAD(P)H + H+
5-α-androstan-3α,17β-diol + NAD(P)+ = 17-β-hydroxy-5-α-androstan-3-one + NAD(P)H + H+
L-quinate + NAD(P)+ = 3-dehydroquinate + NAD(P)H + H+
1-piperideine 6-carboxylate + NAD(P)+ + 2 H2O = L-2-aminoadipate + NAD(P)H + H+
3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate + NAD(P)+ = 4α-methyl-5α-cholest-7-en-3-one + CO2 + NAD(P)H
a 3β-hydroxy-4α-carboxysteroid + NAD(P)+ = a 3-oxosteroid + CO2 + NAD(P)H
FADH2 + NAD(P)+ = FAD + NAD(P)H + 2 H+

In Redox half-reactions:
NAD(P)+[in] + H+[in] + 2 e-[membrane]NAD(P)H[in]

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: HMP-P synthase, UDP-galactopyranose mutase, flavin-dependent thymidylate synthase, flavin-dependent thymidylate synthase, (S)-2-hydroxypropylphosphonate epoxidase, GDP-D-mannose 4,6-dehydratase


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by Pathway Tools version 19.5 (software by SRI International) on Sun Feb 7, 2016, biocyc14.