Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
Pathway Tools
Intro Tutorial
discounted registration ends Sept 5, 2015 (Sat)
twitter

MetaCyc Compound Class: NAD(P)H

Synonyms: β-NAD(P)H

Superclasses: a nucleic acid component a nucleotide a dinucleotide a dinucleotide electron carrier
a nucleic acid component a nucleotide a dinucleotide electron carrier
a nucleic acid component an oligonucleotide a dinucleotide a dinucleotide electron carrier
an acceptor a redox electron carrier

Summary:
NAD(P)H is a class of compounds including the instances NADH and NADPH.

NAD(P)H compound structure

Instances:
NADH ,
NADPH

SMILES: C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O[R])C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)

Unification Links: ChEBI:13392

Reactions known to consume the compound:

1,4-dichlorobenzene degradation , 2,4,5-trichlorophenoxyacetate degradation , 2,4,6-trichlorophenol degradation , 3,4,6-trichlorocatechol degradation , 3,5-dichlorocatechol degradation , 3-chlorocatechol degradation I (ortho) , 3-chlorocatechol degradation II (ortho) , 4,5-dichlorocatechol degradation , 4-aminophenol degradation , 4-chlorocatechol degradation , 4-hydroxyacetophenone degradation , 4-sulfocatechol degradation , chlorosalicylate degradation , γ-hexachlorocyclohexane degradation , pentachlorophenol degradation , resorcinol degradation :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+

1,5-anhydrofructose degradation :
1,5-anhydro-D-mannitol + NAD(P)+ ← 1,5-anhydro-D-fructose + NAD(P)H + H+

2'-deoxymugineic acid phytosiderophore biosynthesis :
2'-deoxymugineate + NAD(P)+ ← 3''-deamino-3''-oxonicotianamine + NAD(P)H + H+

2-hydroxyphenazine biosynthesis :
phenazine-1-carboxylate + NAD(P)H + oxygen + H+ → 2-hydroxyphenazine-1-carboxylate + NAD(P)+ + H2O

2-nitrobenzoate degradation II :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+
2-hydroxylaminobenzoate + NAD(P)H + H+ → anthranilate + NAD(P)+ + H2O

4-methyl-proline biosynthesis :
4-methyl-proline + NAD(P)H + H+ + oxygen → 4-methyl-3-hydroxy-proline + NAD(P)+ + H2O

4-nitrobenzoate degradation :
4-nitrobenzoate + 2 NAD(P)H + 2 H+ → 4-hydroxylaminobenzoate + 2 NAD(P)+ + H2O

4-nitrophenol degradation I :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrophenol + NAD(P)H + oxygen + H+ → 1,4-benzoquinone + nitrite + NAD(P)+ + H2O

4-nitrophenol degradation II :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrocatechol + NAD(P)H + oxygen → 2-hydroxy-1,4-benzoquinone + nitrite + NAD(P)+ + H2O + H+

5,6-dimethylbenzimidazole biosynthesis :
FMNH2 + NAD(P)+ ← FMN + NAD(P)H + 2 H+

ajmaline and sarpagine biosynthesis :
10-deoxysarpagine + NAD(P)H + oxygen + H+ → sarpagine + NAD(P)+ + H2O

alkane biosynthesis I :
a long-chain aldehyde + a holo-[acyl-carrier protein] + NAD(P)+ ← a long-chain acyl-[acp] + NAD(P)H + H+

alkylnitronates degradation , nitrate reduction V (assimilatory) :
ammonium + 3 NAD(P)+ + 2 H2O ← nitrite + 3 NAD(P)H + 5 H+

α-cyclopiazonate detoxification :
α-cyclopiazonate + NAD(P)H + H+ + oxygen → 2-oxocyclopiazonate + NAD(P)+ + H2O

anthranilate degradation I (aerobic) , indole-3-acetate degradation VIII (bacterial) :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+

anthranilate degradation II (aerobic) :
anthraniloyl-CoA + 2 NAD(P)H + oxygen + 2 H+ → 2-amino-5-oxocyclohex-1-enecarboxyl-CoA + 2 NAD(P)+ + H2O

arachidonate biosynthesis I (lower eukaryotes) , arachidonate biosynthesis III (metazoa) :
3-oxo-dihomo γ-linolenoyl-CoA + NAD(P)H + H+ → 3R-hydroxy-dihomo γ-linolenoyl-CoA + NAD(P)+

archaetidylserine and archaetidylethanolamine biosynthesis :
2,3-bis-O-phytanyl-sn-glycerol 1-phosphate + 8 NAD(P)+ ← 2,3-bis-O-(geranylgeranyl)-sn-glycerol 1-phosphate + 8 NAD(P)H + 8 H+

arsenate detoxification III (mycothiol) , mycothiol oxidation :
2 mycothiol + NAD(P)+ ← mycothione + NAD(P)H + H+

aspyridone A biosynthesis :
preaspyridone A + NAD(P)H + H+ + oxygen → 14-hydroxypreaspyridone A + NAD(P)+ + H2O
preaspyridone A + NAD(P)H + oxygen + H+ → aspyridone A + NAD(P)+ + 2 H2O
acetyl-CoA + 3 malonyl-CoA + a holo-[acyl-carrier protein] + 2 S-adenosyl-L-methionine + 4 NAD(P)H + 5 H+ → 4,6-dimethyl-3-oxooctanoyl-ACP + 2 S-adenosyl-L-homocysteine + 3 CO2 + 4 coenzyme A + 4 NAD(P)+ + 2 H2O

Reactions known to produce the compound:

(Z)-phenylmethanethial S-oxide biosynthesis :
phenylmethanesulfenate + NAD(P)+ → (Z)-phenylmethanethial S-oxide + NAD(P)H + H+

4-aminobutanoate degradation III :
succinate semialdehyde + NAD(P)+ + H2O → succinate + NAD(P)H + 2 H+

4-coumarate degradation (anaerobic) :
4-hydroxybenzaldehyde + NAD(P)+ + H2O → 4-hydroxybenzoate + NAD(P)H + 2 H+

abscisic acid biosynthesis shunt :
trans-abscisic alcohol + 2 NAD(P)+ + H2O → 2-trans-abscisate + 2 NAD(P)H + 3 H+
cis-abscisic alcohol + 2 NAD(P)+ + H2O → 2-cis-abscisate + 2 NAD(P)H + 3 H+

acrylate degradation :
3-oxopropanoate + coenzyme A + NAD(P)+ → acetyl-CoA + CO2 + NAD(P)H

allantoin degradation IV (anaerobic) :
S-ureidoglycolate + NAD(P)+ → oxalurate + NAD(P)H + H+

β-alanine biosynthesis I , β-alanine biosynthesis IV :
3-aminopropanal + NAD(P)+ + H2O → β-alanine + NAD(P)H + 2 H+

cholesterol biosynthesis I :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

cholesterol biosynthesis II (via 24,25-dihydrolanosterol) :
4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ → 4α-methyl-5α-cholesta-8-en-3-one + CO2 + NAD(P)H
4α-carboxy-5α-cholesta-8-en-3β-ol + NAD(P)+ → 5α-cholesta-8-en-3-one + CO2 + NAD(P)H

cholesterol biosynthesis III (via desmosterol) :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

dehydro-D-arabinono-1,4-lactone biosynthesis :
D-arabinofuranose + NAD(P)+ → D-arabinono-1,4-lactone + NAD(P)H + H+

ferulate and sinapate biosynthesis :
coniferaldehyde + NAD(P)+ + H2O → ferulate + NAD(P)H + 2 H+

fluorene degradation I :
9-fluorenol + NAD(P)+ → 9-fluorenone + NAD(P)H + H+

heterolactic fermentation :
D-gluconate 6-phosphate + NAD(P)+ → D-ribulose 5-phosphate + CO2 + NAD(P)H

homotaurine degradation :
3-sulfopropanal + NAD(P)+ + H2O → 3-sulfopropanoate + NAD(P)H + 2 H+

isopropylamine degradation :
L-alaninol + NAD(P)+ → L-2-aminopropionaldehyde + NAD(P)H + H+
L-2-aminopropionaldehyde + NAD(P)+ + H2O → L-alanine + NAD(P)H + 2 H+
propanal + NAD(P)+ + H2O → propanoate + NAD(P)H + 2 H+

kanamycin biosynthesis , paromamine biosynthesis I :
2-deoxy-scyllo-inosamine + NAD(P)+ → 3-amino-2,3-dideoxy-scyllo-inosose + NAD(P)H + H+

L-arabinose degradation III :
2,5-dioxopentanoate + NAD(P)+ + H2O → 2-oxoglutarate + NAD(P)H + 2 H+
L-arabinofuranose + NAD(P)+ → L-arabinono-1,4-lactone + NAD(P)H + H+

Reactions known to both consume and produce the compound:

allopregnanolone biosynthesis :
allopregnanolone + NAD(P)+ ↔ 5-α-pregnane-3,20-dione + NAD(P)H + H+

cholate degradation (bacteria, anaerobic) :
choloyl-CoA + NAD(P)+ ↔ 3-oxo-cholyl-CoA + NAD(P)H + H+

formaldehyde assimilation I (serine pathway) :
D-glycerate + NAD(P)+ ↔ hydroxypyruvate + NAD(P)H + H+

formaldehyde oxidation II (glutathione-dependent) :
S-hydroxymethylglutathione + NAD(P)+S-formylglutathione + NAD(P)H + H+

formaldehyde oxidation V (H4MPT pathway) :
5,10-methylene-tetrahydromethanopterin + NAD(P)+ ↔ 5,10-methenyltetrahydromethanopterin + NAD(P)H

GABA shunt , L-glutamate biosynthesis II , L-glutamate degradation X , L-ornithine de novo biosynthesis :
L-glutamate + NAD(P)+ + H2O ↔ 2-oxoglutarate + ammonium + NAD(P)H + H+

glycerol degradation to butanol , pyruvate fermentation to butanol I , pyruvate fermentation to butanol II :
butanal + coenzyme A + NAD(P)+ ↔ butanoyl-CoA + NAD(P)H + H+

hydrogen production VIII :
a plastoquinone + NAD(P)H + H+ ↔ a plastoquinol + NAD(P)+

imidazole-lactate degradation , L-histidine degradation IV :
imidazole-lactate + NAD(P)+ ↔ imidazole-pyruvate + NAD(P)H + H+

L-idonate degradation :
L-idonate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+
D-gluconate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+

L-ornithine degradation II (Stickland reaction) :
(2R,4S)-2, 4-diaminopentanoate + NAD(P)+ + H2O ↔ 2-amino-4-oxopentanoate + ammonium + NAD(P)H + H+

L-sorbose degradation :
keto-L-sorbose 1-phosphate + NAD(P)H + H+ ↔ D-sorbitol 6-phosphate + NAD(P)+

morphine biosynthesis :
morphine + NAD(P)+ ↔ morphinone + NAD(P)H + H+

Not in pathways:
D-glyceraldehyde 3-phosphate + NAD(P)+ + phosphate ↔ 1,3-bisphospho-D-glycerate + NAD(P)H + H+
NAD(P)+ + H2NAD(P)H + H+
D-glucopyranose + NAD(P)+ ↔ D-glucono-1,5-lactone + NAD(P)H + H+
(2R)-3-sulfolactate + NAD(P)+ ↔ 3-sulfopyruvate + NAD(P)H + H+
(S)-malate + NAD(P)+ ↔ oxaloacetate + NAD(P)H + H+

In Reactions of unknown directionality:

Not in pathways:
16-α-hydroxysteroid + NAD(P)+ = 16-oxosteroid + NAD(P)H + H+
1-indanol + NAD(P)+ = indanone + NAD(P)H + H+
a protein dithiol + NAD(P)+ = a protein disulfide + NAD(P)H + H+
an n-alkanal + NAD(P)+ = an alk-2-enal + NAD(P)H + H+
nitrous oxide + NAD(P)+ + H2O = 2 nitric oxide + NAD(P)H + H+
23,24-dihydrocucurbitacin B + NAD(P)+ = cucurbitacin B + NAD(P)H + H+
2-acetamidofluorene + NAD(P)+ + H2O = N-hydroxy-2-acetamidofluorene + NAD(P)H + H+
thiomorpholine-3-carboxylate + NAD(P)+ = 3,4-dehydrothiomorpholine-3-carboxylate + NAD(P)H + 2 H+
3-oxopropanoate + NAD(P)+ + H2O = malonate + NAD(P)H + 2 H+
D-glycerate + CO2 + NAD(P)+ = 2-hydroxy-3-oxosuccinate + NAD(P)H + 2 H+
estradiol-17α + NAD(P)+ = estrone + NAD(P)H + H+
D-mannonate + NAD(P)+ = D-mannuronate + NAD(P)H + H+
D-ribitol 5-phosphate + NAD(P)+ = D-ribulose 5-phosphate + NAD(P)H + H+
2 a reduced rubredoxin + NAD(P)+ + H+ = 2 an oxidized rubredoxin + NAD(P)H
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
nitrite + NAD(P)+ + H2O = nitrate + NAD(P)H + H+
(+)-thujan-3-ol + NAD(P)+ = (+)-thujan-3-one + NAD(P)H + H+
(20S)-17,20-dihydroxypregn-4-en-3-one + NAD(P)+ = 17-α-hydroxyprogesterone + NAD(P)H + H+
5-α-androstan-3α,17β-diol + NAD(P)+ = 5-α-dihydrotestosterone + NAD(P)H + H+
L-quinate + NAD(P)+ = 3-dehydroquinate + NAD(P)H + H+
squalene + NAD(P)+ + diphosphate = presqualene diphosphate + NAD(P)H + H+
1-piperideine 6-carboxylate + NAD(P)+ + 2 H2O = L-2-aminoadipate + NAD(P)H + H+
3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate + NAD(P)+ = 4α-methyl-5α-cholest-7-en-3-one + CO2 + NAD(P)H
a 3β-hydroxy-4α-carboxysteroid + NAD(P)+ = a 3-oxosteroid + CO2 + NAD(P)H

In Redox half-reactions:
NAD(P)+[in] + H+[in] + 2 e-[membrane]NAD(P)H[in]

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: HMP-P synthase , UDP-galactopyranose mutase , flavin-dependent thymidylate synthase , flavin-dependent thymidylate synthase , (S)-2-hydroxypropylphosphonate epoxidase , GDP-D-mannose 4,6-dehydratase


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 19.0 on Thu Sep 3, 2015, biocyc13.