Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015
Metabolic Modeling Tutorial
early discounted registration
ends Feb 21th, 2015

MetaCyc Compound Class: NAD(P)H

Synonyms: β-NAD(P)H

Superclasses: a nucleic acid component a nucleotide a dinucleotide a dinucleotide electron carrier
a nucleic acid component a nucleotide a dinucleotide electron carrier
a nucleic acid component an oligonucleotide a dinucleotide a dinucleotide electron carrier
a redox electron carrier

NAD(P)H is a class of compounds including the instances NADH and NADPH.


SMILES: C1(=C(CC=CN1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O[R])C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)

Unification Links: ChEBI:13392

Reactions known to consume the compound:

1,4-dichlorobenzene degradation , 2,4,5-trichlorophenoxyacetate degradation , 2,4,6-trichlorophenol degradation , 3,4,6-trichlorocatechol degradation , 3,5-dichlorocatechol degradation , 3-chlorocatechol degradation I (ortho) , 3-chlorocatechol degradation II (ortho) , 4,5-dichlorocatechol degradation , 4-aminophenol degradation , 4-chlorocatechol degradation , 4-hydroxyacetophenone degradation , 4-sulfocatechol degradation , chlorosalicylate degradation , γ-hexachlorocyclohexane degradation , pentachlorophenol degradation , resorcinol degradation :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+

1,5-anhydrofructose degradation :
1,5-anhydro-D-mannitol + NAD(P)+ ← 1,5-anhydro-D-fructose + NAD(P)H + H+

2'-deoxymugineic acid phytosiderophore biosynthesis :
2'-deoxymugineate + NAD(P)+ ← 3''-deamino-3''-oxonicotianamine + NAD(P)H + H+

2-hydroxyphenazine biosynthesis :
phenazine-1-carboxylate + NAD(P)H + oxygen + H+ → 2-hydroxyphenazine-1-carboxylate + NAD(P)+ + H2O

2-nitrobenzoate degradation II :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+
2-hydroxylaminobenzoate + NAD(P)H + H+ → anthranilate + NAD(P)+ + H2O

4-nitrobenzoate degradation :
4-nitrobenzoate + 2 NAD(P)H + 2 H+ → 4-hydroxylaminobenzoate + 2 NAD(P)+ + H2O

4-nitrophenol degradation I :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrophenol + NAD(P)H + oxygen + H+ → 1,4-benzoquinone + nitrite + NAD(P)+ + H2O

4-nitrophenol degradation II :
3-oxoadipate + NAD(P)+ ← 2-maleylacetate + NAD(P)H + H+
4-nitrocatechol + NAD(P)H + oxygen → 2-hydroxy-1,4-benzoquinone + nitrite + NAD(P)+ + H2O + H+

ajmaline and sarpagine biosynthesis :
10-deoxysarpagine + NAD(P)H + oxygen + H+ → sarpagine + NAD(P)+ + H2O

alginate degradation :
(4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate + NAD(P)H + H+ → 2-dehydro-3-deoxy-D-gluconate + NAD(P)+

alkane biosynthesis I :
a long-chain aldehyde + a holo-[acyl-carrier protein] + NAD(P)+ ← a long-chain acyl-[acp] + NAD(P)H + H+

alkylnitronates degradation , nitrate reduction V (assimilatory) :
ammonium + 3 NAD(P)+ + 2 H2O ← nitrite + 3 NAD(P)H + 5 H+

α-cyclopiazonate detoxification :
α-cyclopiazonate + NAD(P)H + H+ + oxygen → 2-oxocyclopiazonate + NAD(P)+ + H2O

anthranilate degradation I (aerobic) , indole-3-acetate degradation VIII (bacterial) :
anthranilate + NAD(P)H + oxygen + 3 H+ → catechol + CO2 + ammonium + NAD(P)+

anthranilate degradation II (aerobic) :
anthraniloyl-CoA + 2 NAD(P)H + oxygen + 2 H+ → 2-amino-5-oxocyclohex-1-enecarboxyl-CoA + 2 NAD(P)+ + H2O

arachidonate biosynthesis :
(8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA + NAD(P)H + H+ → (8Z,11Z,14Z)-3-hydroxy-icosatrienoyl-CoA + NAD(P)+

archaetidylserine and archaetidylethanolamine biosynthesis :
2,3-bis-O-phytanyl-sn-glycerol 1-phosphate + 8 NAD(P)+ ← 2,3-bis-O-(geranylgeranyl)glycerol 1-phosphate + 8 NAD(P)H + 8 H+

arginine degradation VI (arginase 2 pathway) , ornithine degradation II (Stickland reaction) , proline biosynthesis I , proline biosynthesis II (from arginine) , proline biosynthesis III :
L-proline + NAD(P)+ ← (S)-1-pyrroline-5-carboxylate + NAD(P)H + 2 H+

arsenate detoxification III (mycothiol) , mycothiol oxidation :
2 mycothiol + NAD(P)+ ← mycothione + NAD(P)H + H+

aurachin A, B, C and D biosynthesis :
aurachin C epoxide + NAD(P)H + H+ → aurachin B + NAD(P)+ + H2O
aurachin C + NAD(P)H + oxygen + H+ → aurachin C epoxide + NAD(P)+ + H2O
aurachin B + NAD(P)H + oxygen + H+ → aurachin B epoxide + NAD(P)+ + H2O

avenacin A-1 biosynthesis :
16β-hydroxy-β-amyrin + NAD(P)H + oxygen + H+ → 12,13β-epoxy-16β-hydroxy-β-amyrin + NAD(P)+ + H2O
β-amyrin + NAD(P)H + oxygen + H+ → 16β-hydroxy-β-amyrin + NAD(P)+ + H2O
12,13β-epoxy-β-amyrin + NAD(P)H + oxygen + H+ → 12,13β-epoxy-16β-hydroxy-β-amyrin + NAD(P)+ + H2O
β-amyrin + NAD(P)H + oxygen + H+ → 12,13β-epoxy-β-amyrin + NAD(P)+ + H2O

bile acid biosynthesis, neutral pathway :
5β-cholestane-3α,7α-diol + NAD(P)+ ← 7α-hydroxy-5β-cholestan-3-one + NAD(P)H + H+
5β-cholestane-3α,7α,12α-triol + NAD(P)+ ← 7α,12α-dihydroxy-5β-cholestan-3-one + NAD(P)H + H+

caffeine degradation III (bacteria, via demethylation) :
caffeine + NAD(P)H + oxygen + H+ → paraxanthine + formaldehyde + NAD(P)+ + H2O
theobromine + NAD(P)H + oxygen + H+ → 7-methylxanthine + formaldehyde + NAD(P)+ + H2O
paraxanthine + NAD(P)H + oxygen + H+ → 7-methylxanthine + formaldehyde + NAD(P)+ + H2O
caffeine + NAD(P)H + oxygen + H+ → theobromine + formaldehyde + NAD(P)+ + H2O
7-methylxanthine + NAD(P)H + oxygen + H+ → xanthine + formaldehyde + NAD(P)+ + H2O

capsanthin and capsorubin biosynthesis :
antheraxanthin + NAD(P)H + H+ + oxygen → violaxanthin + NAD(P)+ + H2O

carbazole degradation :
9H carbazole + NAD(P)H + oxygen + H+ → 2'-aminobiphenyl-2,3-diol + NAD(P)+

CDP-2-glycerol biosynthesis :
DL-glyceraldehyde + NAD(P)H + H+ → glycerol + NAD(P)+
dihydroxyacetone + NAD(P)H + H+ → glycerol + NAD(P)+

CDP-4-dehydro-3,6-dideoxy-D-glucose biosynthesis :
CDP-4-dehydro-3,6-dideoxy-D-glucose + NAD(P)+ + H2O ← CDP-4-dehydro-6-deoxy-D-glucose + NAD(P)H + H+

CDP-archaeol biosynthesis :
sn-glycerol 1-phosphate + NAD(P)+ ← dihydroxyacetone phosphate + NAD(P)H + H+

CDP-ascarylose biosynthesis :
CDP-4-dehydro-3,6-dideoxy-D-glucose epimer + NAD(P)H + H+ → CDP-ascarylose + NAD(P)+

CDP-D-arabitol biosynthesis :
CDP-D-xylulose + NAD(P)H + H+ → CDP-D-arabinitol + NAD(P)+

CDP-D-mannitol biosynthesis :
CDP-D-fructose + NAD(P)H + H+ → CDP-D-mannitol + NAD(P)+

CDP-diacylglycerol biosynthesis I , CDP-diacylglycerol biosynthesis II , CDP-diacylglycerol biosynthesis III :
sn-glycerol 3-phosphate + NAD(P)+ ← dihydroxyacetone phosphate + NAD(P)H + H+

ceramide de novo biosynthesis :
a dihydroceramide + NAD(P)H + oxygen + H+ → an N-acylsphingosine + NAD(P)+ + 2 H2O

chelerythrine biosynthesis :
chelerythrine + NAD(P)H → dihydrochelerythrine + NAD(P)+

chlorophyll cycle :
71-hydroxychlorophyll a + NAD(P)+ ← chlorophyll b + NAD(P)H

cholesterol biosynthesis I :
4α-formyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen → 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + 2 H2O
4,4-dimethylzymosterol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-formyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen → 4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + 2 H2O
4α-methyl-zymosterol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
lathosterol + NAD(P)H + oxygen + H+ → 7-dehydrocholesterol + NAD(P)+ + 2 H2O

cholesterol biosynthesis II (via 24,25-dihydrolanosterol) :
4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)H + oxygen → 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ + 2 H2O
4,4-dimethyl-5α-cholesta-8-en-3-β-ol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ + H2O
4α-formyl-5α-cholesta-8-en-3β-ol + NAD(P)H + oxygen → 4α-carboxy-5α-cholesta-8-en-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-5α-cholesta-8-en-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-5α-cholesta-8-en-3β-ol + NAD(P)+ + 2 H2O
4α-methyl-cholesta-8-enol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol + NAD(P)+ + H2O
lathosterol + NAD(P)H + oxygen + H+ → 7-dehydrocholesterol + NAD(P)+ + 2 H2O

cholesterol biosynthesis III (via desmosterol) :
4α-formyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen → 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + 2 H2O
4,4-dimethylzymosterol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-formyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen → 4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
4α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)H + oxygen + H+ → 4α-formyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + 2 H2O
4α-methyl-zymosterol + NAD(P)H + oxygen + H+ → 4α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ + H2O
5α-cholesta-7,24-dien-3β-ol + NAD(P)H + oxygen + H+ → 7-dehydrodesmosterol + NAD(P)+ + 2 H2O

chorismate biosynthesis from 3-dehydroquinate :
shikimate + NAD(P)+ ← 3-dehydroshikimate + NAD(P)H + H+

crepenynate biosynthesis :
linoleate + NAD(P)H + oxygen + H+ → crepenynate + NAD(P)+ + 2 H2O

D-arginine degradation :
2-ketoarginine + ammonium + NAD(P)H → L-arginine + NAD(P)+

D-galactarate degradation I , D-glucarate degradation I :
D-glycerate + NAD(P)+ ← tartronate semialdehyde + NAD(P)H + H+

DIBOA-glucoside biosynthesis :
HBOA + NAD(P)H + oxygen → DIBOA + NAD(P)+ + H2O
3-hydroxyindolin-2-one + NAD(P)H + oxygen + H+ → HBOA + NAD(P)+ + H2O
indolin-2-one + NAD(P)H + oxygen + H+ → 3-hydroxyindolin-2-one + NAD(P)+ + H2O
indole + NAD(P)H + oxygen + H+ → indolin-2-one + NAD(P)+ + H2O

docosahexanoate biosynthesis I :
(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosapentaenoyl-CoA + NAD(P)H + H+ → 3-hydroxy-docosapentaenoyl-CoA + NAD(P)+
(8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA + NAD(P)H + H+ → (8Z,11Z,14Z)-3-hydroxy-icosatrienoyl-CoA + NAD(P)+

docosahexanoate biosynthesis II :
(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosapentaenoyl-CoA + NAD(P)H + H+ → 3-hydroxy-docosapentaenoyl-CoA + NAD(P)+
3-oxo-eicosatrienoyl-CoA + NAD(P)H + H+ → 3-hydroxy-eicosatrienoyl-CoA + NAD(P)+

dTDP-6-deoxy-α-D-allose biosynthesis :
dTDP-6-deoxy-α-D-allose + NAD(P)+ ← dTDP-4-dehydro-6-deoxy-α-D-gulose + NAD(P)H + H+

dTDP-D-β-fucofuranose biosynthesis :
dTDP-α-D-fucopyranose + NAD(P)+ ← dTDP-4-dehydro-6-deoxy-α-D-glucopyranose + NAD(P)H + H+

dTDP-D-forosamine biosynthesis , dTDP-D-olivose, dTDP-D-oliose and dTDP-D-mycarose biosynthesis , dTDP-L-olivose biosynthesis :
dTDP-4-oxo-2,6-dideoxy-α-D-glucose + NAD(P)+ ← dTDP-(2R,6S)-6-hydroxy-2-methyl-3-oxo-3,6-dihydro-2H-pyran-4-olate + NAD(P)H + 2 H+

dTDP-L-mycarose biosynthesis :
dTDP-4-dehydro-2,6-dideoxy-α-D-allose + NAD(P)+ ← dTDP-(2R,6S)-6-hydroxy-2-methyl-3-oxo-3,6-dihydro-2H-pyran-4-olate + NAD(P)H + 2 H+

echinatin biosynthesis :
(2S)-liquiritigenin + NAD(P)H + oxygen → licodione + NAD(P)+ + H2O

epoxysqualene biosynthesis :
2 (2E,6E)-farnesyl diphosphate + NAD(P)H + H+ → squalene + NAD(P)+ + 2 diphosphate

estradiol biosynthesis I (via estrone) :
17β-estradiol + NAD(P)+ ← estrone + NAD(P)H + H+

fatty acid α-oxidation III :
an even numbered straight chain 2,3,4-saturated fatty acid + NAD(P)H + H+ + oxygen → a (R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acid + NAD(P)+ + H2O

fumiquinazoline D biosynthesis :
fumiquinazoline F + 2 NAD(P)H + 4 H+ + 2 oxygen → fumiquinazoline F-indoline-2,3-diol + 2 NAD(P)+ + 2 H2O

fusicoccin A biosynthesis :
8β-hydroxyfusicocca-1,10(14)-diene-16-al + NAD(P)H + H+ → fusicocca-1,10(14)-diene-8β,16-diol + NAD(P)+

GDP-6-deoxy-D-talose biosynthesis :
GDP-6-deoxy-α-D-talose + NAD(P)+ ← GDP-4-dehydro-α-D-rhamnose + NAD(P)H + H+

GDP-D-rhamnose biosynthesis :
GDP-α-D-rhamnose + NAD(P)+ ← GDP-4-dehydro-α-D-rhamnose + NAD(P)H + H+

GDP-L-colitose biosynthesis :
GDP-β-L-colitose + NAD(P)+ ← GDP-4-dehydro-3,6-dideoxy-α-D-mannose + NAD(P)H + H+

gibberellin inactivation III (epoxidation) :
gibberellin A4 + NAD(P)H + oxygen + H+ → 16α,17-epoxy gibberellin A4 + NAD(P)+ + H2O
gibberellin A12 + NAD(P)H + oxygen + H+ → 16α, 17-epoxy gibberellin A12 + NAD(P)+ + H2O
gibberellin A9 + NAD(P)H + oxygen + H+ → 16α, 17-epoxy gibberellin A9 + NAD(P)+ + H2O

gliotoxin biosynthesis :
cyclo(L-Phe-L-Ser) + 2 NAD(P)H + 2 H+ + 2 oxygen → 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine + 2 NAD(P)+ + 2 H2O

glucose degradation (oxidative) :
D-gluconate 6-phosphate + NAD(P)+ ← 6-phospho-2-dehydro-D-gluconate + NAD(P)H + H+

glutamate degradation IV :
4-hydroxybutanoate + NAD(P)+ ← succinate semialdehyde + NAD(P)H + H+

Reactions known to produce the compound:

4-aminobutyrate degradation III :
succinate semialdehyde + NAD(P)+ + H2O → succinate + NAD(P)H + 2 H+

4-coumarate degradation (anaerobic) :
4-hydroxybenzaldehyde + NAD(P)+ + H2O → 4-hydroxybenzoate + NAD(P)H + 2 H+

abscisic acid biosynthesis shunt :
cis-abscisic alcohol + NAD(P)+ + oxygen → 2-cis-abscisate + NAD(P)H + H2O
trans-abscisic alcohol + NAD(P)+ + oxygen → 2-trans-abscisate + NAD(P)H + H2O

acrylate degradation :
malonate semialdehyde + coenzyme A + NAD(P)+ → acetyl-CoA + CO2 + NAD(P)H

allantoin degradation IV (anaerobic) :
S-ureidoglycolate + NAD(P)+ → oxalurate + NAD(P)H + H+

β-alanine biosynthesis I , β-alanine biosynthesis IV :
3-aminopropanal + NAD(P)+ + H2O → β-alanine + NAD(P)H + 2 H+

cholesterol biosynthesis I :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

cholesterol biosynthesis II (via 24,25-dihydrolanosterol) :
4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol + NAD(P)+ → 4α-methyl-5α-cholesta-8-en-3-one + CO2 + NAD(P)H
4α-carboxy-5α-cholesta-8-en-3β-ol + NAD(P)+ → 5α-cholesta-8-en-3-one + CO2 + NAD(P)H

cholesterol biosynthesis III (via desmosterol) :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

dehydro-D-arabinono-1,4-lactone biosynthesis :
D-arabinofuranose + NAD(P)+ → D-arabinono-1,4-lactone + NAD(P)H + H+

ferulate and sinapate biosynthesis :
coniferaldehyde + NAD(P)+ + H2O → ferulate + NAD(P)H + 2 H+

fluorene degradation I :
9-fluorenol + 2 NAD(P)+ → 9-fluorenone + 2 NAD(P)H

heterolactic fermentation , pentose phosphate pathway (oxidative branch) I :
D-gluconate 6-phosphate + NAD(P)+ → D-ribulose 5-phosphate + CO2 + NAD(P)H

homotaurine degradation :
3-sulfopropanal + NAD(P)+ + H2O → 3-sulfopropanoate + NAD(P)H + 2 H+

isopropylamine degradation :
L-alaninol + NAD(P)+ → L-2-aminopropionaldehyde + NAD(P)H + H+
L-2-aminopropionaldehyde + NAD(P)+ + H2O → L-alanine + NAD(P)H + 2 H+
propanal + NAD(P)+ + H2O → propanoate + NAD(P)H + 2 H+

kanamycin biosynthesis , paromamine biosynthesis I :
2-deoxy-scyllo-inosamine + NAD(P)+ → 3-amino-2,3-dideoxy-scyllo-inosose + NAD(P)H + H+

L-arabinose degradation III :
2,5-dioxopentanoate + NAD(P)+ + H2O → 2-oxoglutarate + NAD(P)H + 2 H+
L-arabinofuranose + NAD(P)+ → L-arabinono-1,4-lactone + NAD(P)H + H+

L-arabinose degradation IV :
L-arabinofuranose + NAD(P)+ → L-arabinono-1,4-lactone + NAD(P)H + H+

L-carnitine degradation III :
L-malic semialdehyde + NAD(P)+ + H2O → (S)-malate + NAD(P)H + 2 H+

L-lyxonate degradation :
2,5-dioxopentanoate + NAD(P)+ + H2O → 2-oxoglutarate + NAD(P)H + 2 H+

L-rhamnose degradation II , L-rhamnose degradation III :
L-rhamnofuranose + NAD(P)+ → L-rhamnono-1,4-lactone + NAD(P)H + H+

lysine degradation II (mammalian) , lysine degradation II (pipecolate pathway) :
(S)-2-amino-6-oxohexanoate + NAD(P)+ + H2O → L-2-aminoadipate + NAD(P)H + 2 H+

momilactone A biosynthesis :
3β-hydroxy-9β-pimara-7,15-diene-19,6β-olide + NAD(P)+ → momilactone A + NAD(P)H + H+

oryzalexin A, B, and C biosynthesis :
oryzalexin D + NAD(P)+ → oryzalexin A + NAD(P)H + H+
oryzalexin B + NAD(P)+ → oryzalexin C + NAD(P)H + H+
oryzalexin D + NAD(P)+ → oryzalexin B + NAD(P)H + H+
oryzalexin A + NAD(P)+ → oryzalexin C + NAD(P)H + H+

prodigiosin biosynthesis :
4-hydroxy-2,2'-bipyrrole-5-methanol + NAD(P)+ → 4-hydroxy-2,2'-bipyrrole-5-carbaldehyde + NAD(P)H + H+

putrescine degradation II :
4-(γ-glutamylamino)butanal + NAD(P)+ + H2O → 4-(γ-L-glutamylamino)butanoate + NAD(P)H + 2 H+

testosterone and androsterone degradation to androstendione :
testosterone + NAD(P)+ → androst-4-ene-3,17-dione + NAD(P)H + H+
androsterone + NAD(P)+ → 5α-androstane-3,17-dione + NAD(P)H + H+

tryptophan degradation V (side chain pathway) :
indole acetaldehyde + NAD(P)+ + H2O → indole-3-acetate + NAD(P)H + 2 H+

UDP-N-acetyl-α-D-galactosaminuronate biosynthesis :
UDP-N-acetyl-α-D-galactosamine + 2 NAD(P)+ + H2O → UDP-N-acetyl-α-D-galactosaminouronate + 2 NAD(P)H + 3 H+

xylose degradation IV :
a D-xylopyranose + NAD(P)+ → D-xylonolactone + NAD(P)H + H+

zymosterol biosynthesis :
4α-carboxy-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 5α-cholesta-8,24-dien-3-one + CO2 + NAD(P)H
4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol + NAD(P)+ → 3-dehydro-4-methylzymosterol + CO2 + NAD(P)H

Not in pathways:
a poly (U) tail + H2O → n an oligonucleotide
a poly(A) tail + H2O → n an oligonucleotide
5S rRNA precursor + 2 H2O → a mature 5S-rRNA + 2 an oligonucleotide

Reactions known to both consume and produce the compound:

5,6-dimethylbenzimidazole biosynthesis :
FMNH2 + NAD(P)+ ↔ FMN + NAD(P)H + 2 H+

allopregnanolone biosynthesis :
allopregnanolone + NAD(P)+ ↔ 5-α-pregnane-3,20-dione + NAD(P)H + H+

cholate degradation (bacteria, anaerobic) :
choloyl-CoA + NAD(P)+ ↔ 3-oxo-cholyl-CoA + NAD(P)H + H+

formaldehyde assimilation I (serine pathway) :
D-glycerate + NAD(P)+ ↔ hydroxypyruvate + NAD(P)H + H+

formaldehyde oxidation II (glutathione-dependent) :
S-hydroxymethylglutathione + NAD(P)+S-formylglutathione + NAD(P)H + H+

formaldehyde oxidation V (H4MPT pathway) :
5,10-methylene-tetrahydromethanopterin + NAD(P)+ ↔ 5,10-methenyltetrahydromethanopterin + NAD(P)H

GABA shunt , glutamate biosynthesis II , glutamate degradation X , ornithine de novo biosynthesis :
L-glutamate + NAD(P)+ + H2O ↔ 2-oxoglutarate + ammonium + NAD(P)H + H+

glycerol degradation to butanol , pyruvate fermentation to butanol I , pyruvate fermentation to butanol II :
butanal + coenzyme A + NAD(P)+ ↔ butanoyl-CoA + NAD(P)H + H+

histidine degradation IV , imidazole-lactate degradation :
imidazole-lactate + NAD(P)+ ↔ imidazole-pyruvate + NAD(P)H + H+

hydrogen production VIII :
a plastoquinone + NAD(P)H + H+ ↔ a plastoquinol + NAD(P)+

L-idonate degradation :
L-idonate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+
D-gluconate + NAD(P)+ ↔ 5-dehydro-D-gluconate + NAD(P)H + H+

L-sorbose degradation :
keto-L-sorbose 1-phosphate + NAD(P)H + H+ ↔ D-sorbitol 6-phosphate + NAD(P)+

mannitol cycle :
D-mannitol 1-phosphate + NAD(P)+ ↔ β-D-fructofuranose 6-phosphate + NAD(P)H + H+

morphine biosynthesis :
morphine + NAD(P)+ ↔ morphinone + NAD(P)H + H+

ornithine degradation II (Stickland reaction) :
(2R,4S)-2, 4-diaminopentanoate + NAD(P)+ + H2O ↔ 2-amino-4-oxopentanoate + ammonium + NAD(P)H + H+

Not in pathways:
D-glyceraldehyde 3-phosphate + NAD(P)+ + phosphate ↔ 1,3-bisphospho-D-glycerate + NAD(P)H + H+
NAD(P)+ + H2NAD(P)H + H+
D-glucopyranose + NAD(P)+ ↔ D-glucono-1,5-lactone + NAD(P)H + H+
(2R)-3-sulfolactate + NAD(P)+ ↔ 3-sulfopyruvate + NAD(P)H + H+
(S)-malate + NAD(P)+ ↔ oxaloacetate + NAD(P)H + H+

In Reactions of unknown directionality:

Not in pathways:
16-α-hydroxysteroid + NAD(P)+ = 16-oxosteroid + NAD(P)H + H+
1-indanol + NAD(P)+ = indanone + NAD(P)H + H+
2 coenzyme A + NAD(P)+ = CoA-disulfide + NAD(P)H + H+
a protein dithiol + NAD(P)+ = a protein disulfide + NAD(P)H + H+
an n-alkanal + NAD(P)+ = an alk-2-enal + NAD(P)H + H+
nitrous oxide + NAD(P)+ + H2O = 2 nitric oxide + NAD(P)H + H+
23,24-dihydrocucurbitacin B + NAD(P)+ = cucurbitacin B + NAD(P)H + H+
2-acetamidofluorene + NAD(P)+ + H2O = N-hydroxy-2-acetamidofluorene + NAD(P)H + H+
thiomorpholine-3-carboxylate + NAD(P)+ = 3,4-dehydrothiomorpholine-3-carboxylate + NAD(P)H + 2 H+
malonate semialdehyde + NAD(P)+ + H2O = malonate + NAD(P)H + 2 H+
D-glycerate + CO2 + NAD(P)+ = 2-hydroxy-3-oxosuccinate + NAD(P)H + 2 H+
estradiol-17α + NAD(P)+ = estrone + NAD(P)H + H+
D-mannonate + NAD(P)+ = D-mannuronate + NAD(P)H + H+
D-ribitol 5-phosphate + NAD(P)+ = D-ribulose 5-phosphate + NAD(P)H + H+
2 a reduced rubredoxin + NAD(P)+ + H+ = 2 an oxidized rubredoxin + NAD(P)H
an aldehyde + NAD(P)+ + H2O = a carboxylate + NAD(P)H + 2 H+
an alcohol + NAD(P)+ = an aldehyde + NAD(P)H + H+
nitrite + NAD(P)+ + H2O = nitrate + NAD(P)H + H+
(+)-thujan-3-ol + NAD(P)+ = (+)-thujan-3-one + NAD(P)H + H+
(20S)-17,20-dihydroxypregn-4-en-3-one + NAD(P)+ = 17-α-hydroxyprogesterone + NAD(P)H + H+
5-α-androstan-3α,17β-diol + NAD(P)+ = 5-α-dihydrotestosterone + NAD(P)H + H+
L-quinate + NAD(P)+ = 3-dehydroquinate + NAD(P)H + H+
squalene + NAD(P)+ + diphosphate = presqualene diphosphate + NAD(P)H + H+
3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate + NAD(P)+ = 4α-methyl-5α-cholest-7-en-3-one + CO2 + NAD(P)H
a 3β-hydroxy-4α-carboxysteroid + NAD(P)+ = a 3-oxosteroid + CO2 + NAD(P)H
FADH2 + NAD(P)+ = FAD + NAD(P)H + 2 H+
dTDP-L-pneumose + NAD(P)+ = dTDP-4-dehydro-β-L-rhamnose + NAD(P)H + H+
a 5,6,7,8-tetrahydropteridine + NAD(P)+ = a 6,7-dihydropteridine + NAD(P)H + H+
tetrahydrobiopterin + NAD(P)+ = 6,7-dihydrobiopterin + NAD(P)H + H+
(-)-endo-fenchol + NAD(P)+ = D-fenchone + NAD(P)H + H+
reduced riboflavin + NAD(P)+ = riboflavin + NAD(P)H + 2 H+
3-keto-L-gulonate + NAD(P)+ = 2,3-dioxo-L-gulonate + NAD(P)H + H+
4-hydroxyaminoquinoline-N-oxide + 2 NAD(P)+ + H2O = 4-nitroquinoline-N-oxide + 2 NAD(P)H + 2 H+
1,2-dihydrosantonin + NAD(P)+ = α-santonin + NAD(P)H + H+
cis-1,2-dihydroxy-4-methylcyclohexa-3,5-diene-1-carboxylate + NAD(P)+ = CO2 + 4-methylcatechol + NAD(P)H
2 a reduced [2Fe-2S] ferredoxin + NAD(P)+ + H+ = 2 an oxidized [2Fe-2S] ferredoxin + NAD(P)H
an L-glycol + NAD(P)+ = a 2-hydroxycarbonyl compound + NAD(P)H + H+
(S)-1-pyrroline-5-carboxylate + NAD(P)+ + 2 H2O = L-glutamate + NAD(P)H + H+
L-arogenate + NAD(P)+ = L-tyrosine + CO2 + NAD(P)H
xylitol + NAD(P)+ = aldehydo-D-xylose + NAD(P)H + H+
a 3α-hydroxysteroid + NAD(P)+ = a 3-oxosteroid + NAD(P)H + H+
an aldopyranose + NAD(P)+ = a D-aldonolactone + NAD(P)H + H+
β-D-galactose + NAD(P)+ = D-galactono-1,5-lactone + NAD(P)H + H+
D-glucopyranose 6-phosphate + NAD(P)+ = 6-phospho D-glucono-1,5-lactone + NAD(P)H + H+
L-tryptophan + NAD(P)+ + H2O = indole-3-pyruvate + ammonium + NAD(P)H + H+
L-aspartate + NAD(P)+ + H2O = oxaloacetate + ammonium + NAD(P)H + H+
15S-hydroxypentaenoate + NAD(P)+ = 15-KETE + NAD(P)H + H+
2 an Fe(II)-siderophore + NAD(P)+ + H+ = 2 an Fe(III)-siderophore + NAD(P)H
UDP-N-acetyl-β-L-pneumosamine + NAD(P)+ = UDP-2-acetamido-2,6-dideoxy-β-L-arabino-hexul-4-ose + NAD(P)H + H+
N-[2-chloro-6-(4-chloro-1H-pyrrol-3-yl)phenyl]hydroxylamine + NAD(P)+ = 3-chloro-4-(3-chloro-2-nitrosophenyl)-1H-pyrrole + NAD(P)H + H+
(4R)-(-)-ipsdienol + NAD(P)+ = ipsdienone + NAD(P)H + H+
(5Z)-(15S)-11-α-hydroxy-9,15-dioxoprostanoate + NAD(P)+ = (5Z)-(15S)-11-α-hydroxy-9,15-dioxoprosta-13-enoate + NAD(P)H + H+
tetrahydromethanopterin + NAD(P)+ = 7,8-dihydromethanopterin + NAD(P)H + H+
a (2S)-2-hydroxycarboxylate + NAD(P)+ = a 2-oxo carboxylate + NAD(P)H + H+
a sugar alcohol + NAD(P)+ = an aldose + NAD(P)H + H+
D-glyceraldehyde 3-phosphate + NAD(P)+ + H2O = 3-phospho-D-glycerate + NAD(P)H + 2 H+
2-mononitroglycerol + NAD(P)H = glycerol + nitrite + NAD(P)+
1-mononitroglycerol + NAD(P)H = glycerol + nitrite + NAD(P)+
3-chloro-4-(3-chloro-2-nitrosophenyl)-1H-pyrrole + NAD(P)H + oxygen + H+ = pyrrolnitrin + NAD(P)+ + H2O
aminopyrrolnitrin + NAD(P)H + oxygen + H+ = N-[2-chloro-6-(4-chloro-1H-pyrrol-3-yl)phenyl]hydroxylamine + NAD(P)+ + H2O
(6E)-8-oxogeranial + NAD(P)H + H+ = (+)-cis,trans-nepetalactol + NAD(P)+
2 Nω-hydroxy-L-arginine + NAD(P)H + 2 oxygen = 2 L-citrulline + 2 nitric oxide + NAD(P)+ + 2 H2O + H+
2 L-arginine + 2 NAD(P)H + 2 H+ + 2 oxygen = 2 Nω-hydroxy-L-arginine + 2 NAD(P)+ + 2 H2O
3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carbaldehyde + NAD(P)H + oxygen = 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate + NAD(P)+ + H2O
4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol + NAD(P)H + H+ + oxygen = 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carbaldehyde + NAD(P)+ + 2 H2O
4,4-dimethyl-5α-cholest-7-en-3β-ol + NAD(P)H + oxygen + H+ = 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol + NAD(P)+ + H2O
4-hydroxybutyraldehyde + NAD(P)H + H+ = 1,4-butanediol + NAD(P)+
4-hydroxybutanoyl-CoA + NAD(P)H + H+ = 4-hydroxybutyraldehyde + coenzyme A + NAD(P)+
2 ferrileghemoglobin + NAD(P)H = 2 ferroleghemoglobin + NAD(P)+ + H+
stearoyl-CoA + malonyl-CoA + 2 NAD(P)H + 3 H+ = arachidoyl-CoA + CO2 + coenzyme A + 2 NAD(P)+ + H2O
2,5-didehydro-D-gluconate + NAD(P)H + H+ = 2-keto-L-gulonate + NAD(P)+
cycloartenol + 2 NAD(P)H = 24(25)-dihydrocycloartenol + 2 NAD(P)+

a nucleotide + a 2'-deoxynucleoside = a nucleoside + a 2'-deoxyribonucleoside 5'-monophosphate

This compound has been characterized as a cofactor or prosthetic group of the following enzymes: HMP-P synthase , flavin-dependent thymidylate synthase , flavin-dependent thymidylate synthase , (S)-2-hydroxypropylphosphonate epoxidase , GDP-D-mannose 4,6-dehydratase

Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of MetaCyc: Caspi et al, Nucleic Acids Research 42:D459-D471 2014
Page generated by SRI International Pathway Tools version 18.5 on Sat Jan 31, 2015, BIOCYC13A.