Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down 12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down 12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down 12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down 12/28 - 12/31
for maintenance.
Metabolic Modeling Tutorial
discounted EARLY registration ends Dec 31, 2014
BioCyc websites down 12/28 - 12/31
for maintenance.
twitter

Escherichia coli K-12 substr. MG1655 Compound: ADP

Synonyms: adenosine pyrophosphate, adenosine 5'-pyrophosphate, adenosine-5'-diphosphate, adenosine-diphosphate, adenosine-5-diphosphate

Superclasses: a nucleic acid component a nucleotide a nucleoside diphosphate a ribonucleoside diphosphate a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
a nucleic acid component a nucleotide a ribonucleotide a ribonucleoside diphosphate a purine ribonucleoside 5'-diphosphate
a nucleic acid component
an organic heterocyclic compound an organic heterobicyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate
an organic heterocyclic compound an organonitrogen heterocyclic compound a purine a purine nucleotide a purine ribonucleotide a purine ribonucleoside 5'-diphosphate

Component of: MgADP

Chemical Formula: C10H12N5O10P2

Molecular Weight: 424.18 Daltons

Monoisotopic Molecular Weight: 427.0294147485 Daltons

SMILES: C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])[O-])([O-])=O

InChI: InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1

InChIKey: InChIKey=XTWYTFMLZFPYCI-KQYNXXCUSA-K

Unification Links: CAS:58-64-0 , ChEBI:456216 , ChemSpider:5414423 , HMDB:HMDB01341 , IAF1260:33496 , KEGG:C00008 , MetaboLights:MTBLC456216 , PubChem:7058055

Standard Gibbs Free Energy of Change Formation (ΔfG in kcal/mol): -465.37

Reactions known to consume the compound:

adenosine deoxyribonucleotides de novo biosynthesis II :
dADP + an oxidized NrdH glutaredoxin-like protein + H2O ← ADP + a reduced NrdH glutaredoxin-like protein

allantoin degradation IV (anaerobic) :
ammonium + CO2 + ATP ← carbamoyl-phosphate + ADP + 2 H+

Not in pathways:
a nucleoside diphosphate + ATP → a nucleoside triphosphate + ADP
(S)-NADPHX + ADP → AMP + NADPH + phosphate + H+
ADP + (S)-NADHX → AMP + NADH + phosphate + H+
ATP + ADP + H+ → 5',5'''-diadenosine triphosphate + diphosphate


an oxidized thioredoxin + a 2'-deoxyribonucleoside 5'-diphosphate + H2O ← a reduced thioredoxin + a ribonucleoside diphosphate


a nucleoside diphosphate + H2O → a nucleoside 5'-monophosphate + phosphate + H+

Reactions known to produce the compound:

2-O-α-mannosyl-D-glycerate degradation , D-galactarate degradation I , D-glucarate degradation I :
ATP + D-glycerate → 2-phospho-D-glycerate + ADP + H+

4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis :
4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP

5-aminoimidazole ribonucleotide biosynthesis I :
ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + L-glutamate + phosphate + H+
ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+
ATP + 5-phospho-β-D-ribosylamine + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+

5-aminoimidazole ribonucleotide biosynthesis II :
ATP + N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + L-glutamine + H2O → ADP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine + L-glutamate + phosphate + H+
ATP + 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine → ADP + 5-amino-1-(5-phospho-β-D-ribosyl)imidazole + phosphate + H+
ATP + 5-phospho-β-D-ribosylamine + glycine → ADP + N1-(5-phospho-β-D-ribosyl)glycinamide + phosphate + H+
N1-(5-phospho-β-D-ribosyl)glycinamide + formate + ATP → N2-formyl-N1-(5-phospho-β-D-ribosyl)glycinamide + ADP + phosphate + H+

adenine and adenosine salvage V :
inosine + ATP → IMP + ADP + H+

adenosine deoxyribonucleotides de novo biosynthesis II :
dADP + ATP → dATP + ADP

adenosine ribonucleotides de novo biosynthesis :
AMP + ATP ↔ 2 ADP

adenosylcobalamin salvage from cobinamide I :
adenosylcobinamide + ATP → adenosyl-cobinamide phosphate + ADP + H+

ADP-L-glycero-β-D-manno-heptose biosynthesis :
D-glycero-D-manno-heptose 7-phosphate + ATP → D-glycero-β-D-manno-heptose 1,7-bisphosphate + ADP + H+

Aerotactic Two-Component Signal Transduction System , Chemotactic Two-Component Signal Transduction :
CheA + ATP → CheA-P + ADP

anhydromuropeptides recycling :
UDP-N-α-D-acetylmuramate + L-alanyl-γ-D-glutamyl-meso-diaminopimelate + ATP → UDP-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimelate + ADP + phosphate + H+
1,6-anhydro-N-acetyl-β-muramate + ATP + H2O → N-acetyl-β-muramate 6-phosphate + ADP + H+

ArcAB Two-Component Signal Transduction System, quinone dependent :
ArcB sensory histidine kinase[inner membrane] + ATP → ArcB sensory histidine kinase - his292 phosphorylated[inner membrane] + ADP

arginine biosynthesis I (via L-ornithine) , UMP biosynthesis :
2 ATP + L-glutamine + hydrogen carbonate + H2O → carbamoyl-phosphate + L-glutamate + 2 ADP + phosphate + 2 H+

AtoSC Two-Component Signal Transduction System :
AtoS[inner membrane] + ATP → AtoS-P[inner membrane] + ADP

BaeSR Two-Component Signal Transduction System :
BaeS[inner membrane] + ATP → BaeS sensory histidine kinase - phosphorylated[inner membrane] + ADP

BarA UvrY Two-Component Signal Transduction System :
BarA[inner membrane] + ATP → BarA sensory histidine kinase - his302 phosphorylated[inner membrane] + ADP

BasSR Two-Component Signal Transduction System :
ATP + BasS[inner membrane]ADP + BasS sensory histidine kinase - phosphorylated[inner membrane]

biotin biosynthesis from 8-amino-7-oxononanoate I :
CO2 + 7,8-diaminopelargonate + ATP → dethiobiotin + ADP + phosphate + 3 H+

biotin-carboxyl carrier protein assembly :
a biotinylated [BCCP dimer] + hydrogen carbonate + ATP → a carboxylated-biotinylated [BCCP dimer] + ADP + phosphate + H+
ATP + acetyl-CoA + a carboxylated-biotinylated [BCCP dimer] + H2O → malonyl-CoA + a biotinylated [BCCP dimer] + ADP + phosphate + H+

chorismate biosynthesis from 3-dehydroquinate :
shikimate + ATP → shikimate 3-phosphate + ADP + H+

CMP phosphorylation :
CDP + ATP → CTP + ADP
ATP + CMP ↔ ADP + CDP

coenzyme A biosynthesis I :
3'-dephospho-CoA + ATP → ADP + coenzyme A + H+

CpxAR Two-Component Signal Transduction System :
CpxA[inner membrane] + ATP → CpxA sensory histidine kinase - phosphorylated[inner membrane] + ADP

CreCB Two-Component Signal Transduction System :
ATP + CreC[inner membrane]ADP + CreC sensory histidine kinase - phosphorylated[inner membrane]

CusSR Two-Component Signal Transduction System :
CusS[inner membrane] + ATP → CusS sensory histidine kinase - phosphorylated[inner membrane] + ADP

D-allose degradation :
D-allopyranose + ATP → aldehydo-D-allose 6-phosphate + ADP + H+

D-arabinose degradation I :
D-ribulose + ATP → D-ribulose 1-phosphate + ADP + H+

D-fructuronate degradation , D-galacturonate degradation I :
2-dehydro-3-deoxy-D-gluconate + ATP → 2-dehydro-3-deoxy-D-gluconate 6-phosphate + ADP + H+

D-galactonate degradation :
2-dehydro-3-deoxy-D-galactonate + ATP → 2-dehydro-3-deoxy-D-galactonate 6-phosphate + ADP + H+

D-gluconate degradation , L-idonate degradation :
ATP + D-gluconate → ADP + D-gluconate 6-phosphate + H+

DcuSR Two-Component Signal Transduction System, dicarboxylate-dependent :
DcuS[inner membrane] + ATP → DcuS sensory histidine kinase - phosphorylated[inner membrane] + ADP

DpiBA Two-Component Signal Transduction System :
ATP + DpiB[inner membrane]ADP + DpiB sensory histidine kinase - phosphorylated[inner membrane]

EnvZ Two-Component Signal Transduction System, osmotic responsive :
EnvZ sensory histidine kinase[inner membrane] + ATP → ADP + EnvZ-Phis[inner membrane]

EvgSA Two-Component Signal Transduction System :
EvgS[inner membrane] + ATP → EvgS-Phis721[inner membrane] + ADP

fatty acid biosynthesis initiation I :
ATP + acetyl-CoA + hydrogen carbonate → malonyl-CoA + ADP + phosphate + H+

flavin biosynthesis I (bacteria and plants) :
riboflavin + ATP → ADP + FMN + H+

folate polyglutamylation :
10-formyl-tetrahydropteroyl-[γ-Glu](n) + L-glutamate + ATP → 10-formyl-tetrahydropteroyl-[γ-Glu](n+1) + ADP + phosphate
tetrahydropteroyl-[γ-Glu](n) + L-glutamate + ATP → tetrahydropteroyl-[γ-Glu](n+1) + ADP + phosphate
methylene-tetrahydropteroyl-[γ-Glu](n) + L-glutamate + ATP → methylene-tetrahydropteroyl-[γ-Glu](n+1) + ADP + phosphate

fructose degradation :
ATP + β-D-fructofuranose 1-phosphate → ADP + fructose 1,6-bisphosphate + H+

fructoselysine and psicoselysine degradation :
D-fructosyl-L-lysine + ATP → fructoselysine 6-phosphate + ADP + H+

fucose degradation :
L-fuculose + ATP → L-fuculose 1-phosphate + ADP + H+

galactitol degradation :
D-tagatofuranose 6-phosphate + ATP → D-tagatofuranose 1,6-bisphosphate + ADP + H+

galactose degradation I (Leloir pathway) :
α-D-galactose + ATP → α-D-galactose 1-phosphate + ADP + H+

GlrKR Two-Component Signal Transduction System :
GlrK[inner membrane] + ATP → GlrK sensory histidine kinase - phosphorylated[inner membrane] + ADP

gluconeogenesis I :
oxaloacetate + ATP → CO2 + phosphoenolpyruvate + ADP

glucose and glucose-1-phosphate degradation , glycogen degradation I , trehalose degradation II (trehalase) :
β-D-glucose + ATP → β-D-glucose 6-phosphate + ADP + H+

glutamine biosynthesis I :
ammonium + L-glutamate + ATP → L-glutamine + ADP + phosphate + H+

glutathione biosynthesis :
L-cysteine + L-glutamate + ATP → γ-L-glutamyl-L-cysteine + ADP + phosphate + H+
glycine + γ-L-glutamyl-L-cysteine + ATP → glutathione + ADP + phosphate + H+

glutathionylspermidine biosynthesis :
spermidine + glutathione + ATP → glutathionylspermidine + ADP + phosphate + H+

glycerol degradation I :
glycerol + ATP → sn-glycerol 3-phosphate + ADP + H+

glycolate and glyoxylate degradation I :
D-glycerate + ATP → 3-phospho-D-glycerate + ADP + H+

glycolysis I (from glucose-6P) , glycolysis II (from fructose-6P) :
β-D-fructofuranose 6-phosphate + ATP → ADP + fructose 1,6-bisphosphate + H+

guanine and guanosine salvage III :
guanosine + ATP → GMP + ADP + H+

guanosine deoxyribonucleotides de novo biosynthesis II :
dGDP + ATP → dGTP + ADP

guanosine ribonucleotides de novo biosynthesis :
GMP + ATP ↔ GDP + ADP
GDP + ATP → GTP + ADP

homoserine biosynthesis , lysine biosynthesis I :
L-aspartate + ATP → L-aspartyl-4-phosphate + ADP

hydroxymethylpyrimidine salvage :
4-amino-2-methyl-5-phosphomethylpyrimidine + ATP → 4-amino-2-methyl-5-diphosphomethylpyrimidine + ADP
ATP + hydroxymethylpyrimidine → ADP + 4-amino-2-methyl-5-phosphomethylpyrimidine + H+

inosine-5'-phosphate biosynthesis I :
ATP + 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-aspartate → ADP + 5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole + phosphate + H+
5-amino-1-(5-phospho-β-D-ribosyl)imidazole + ATP + hydrogen carbonate → N5-carboxyaminoimidazole ribonucleotide + ADP + phosphate + 2 H+

KdpDE Two-Component Signal Transduction System, potassium-dependent :
ATP + KdpD[inner membrane] → KdpD sensory histidine kinase - phosphorylated[inner membrane] + ADP

L-arabinose degradation I :
L-ribulose + ATP → L-ribulose 5-phosphate + ADP + H+

L-ascorbate degradation II (bacterial, aerobic) :
3-keto-L-gulonate + ATP → 3-keto-L-gulonate 6-phosphate + ADP + H+

L-lyxose degradation :
L-xylulose + ATP → L-xylulose -5-phosphate + ADP + H+

L-rhamnose degradation I :
L-rhamnulofuranose + ATP → L-rhamnulose 1-phosphate + ADP + H+

Lipid A-core biosynthesis :
heptosyl-Kdo2-lipid A + ADP-L-glycero-β-D-manno-heptose → (heptosyl)2-Kdo2-lipid A + ADP + H+
glucosyl-(heptosyl)2-Kdo2-lipid A + ATP → glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP + H+
glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP-L-glycero-β-D-manno-heptose → glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + ADP + H+
glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + ATP → glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP + H+
galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP-L-glycero-β-D-manno-heptose → lipid A-core + ADP + H+
(KDO)2-lipid A + ADP-L-glycero-β-D-manno-heptose → heptosyl-Kdo2-lipid A + ADP + H+

lipid IVA biosynthesis :
lipid A disaccharide + ATP → lipid IVA + ADP + H+

methylerythritol phosphate pathway I :
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ATP → 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + H+

N-acetylneuraminate and N-acetylmannosamine degradation :
N-acetyl-D-mannosamine + ATP → N-acetyl-D-mannosamine 6-phosphate + ADP + H+

N10-formyl-tetrahydrofolate biosynthesis :
an N5-formyl-tetrahydrofolate + ATP → a 5,10-methenyltetrahydrofolate + ADP + phosphate

NAD phosphorylation and dephosphorylation I :
ATP + NAD+ADP + NADP+ + H+

NAD salvage pathway I :
nicotinate + 5-phospho-α-D-ribose 1-diphosphate + ATP + H2O → β-nicotinate D-ribonucleotide + ADP + diphosphate + phosphate

NAD salvage pathway III :
1-(β-D ribofuranosyl)nicotinamide + ATP → β-nicotinamide D-ribonucleotide + ADP + H+

NarQ Two-Component Signal Transduction System, nitrate dependent :
ATP + NarQ[inner membrane]ADP + NarQ sensory histidine kinase - phosphorylated[inner membrane]

NarX Two-Component Signal Transduction System, nitrate dependent :
ATP + NarX[inner membrane]ADP + NarX sensory histidine kinase - phosphorylated[inner membrane]

Nitrogen Regulation Two-Component System :
ATP + NtrB → ADP + NtrB-Phis
adenylyl-[glutamine synthase] + phosphate → [a glutamine synthase] + ADP
ammonium + L-glutamate + ATP → L-glutamine + ADP + phosphate + H+

NtrBC Two-Component Signal Transduction System, nitrogen-dependent :
ATP + NtrB sensory histidine kinase → ADP + NtrB-Phis

ornithine biosynthesis :
N-acetyl-L-glutamate + ATP → N-acetylglutamyl-phosphate + ADP

PhoQP Two-Component Signal Transduction System, magnesium-dependent :
PhoQ[inner membrane] + ATP → PhoQ sensory histidine kinase - phosphorylated[inner membrane] + ADP

PhoRB Two-Component Signal Transduction System, phosphate-dependent :
PhoR[inner membrane] + ATP → ADP + PhoR sensory histidine kinase - phosphorylated[inner membrane]

phosphopantothenate biosynthesis I :
(R)-pantothenate + ATP → (R)-4'-phosphopantothenate + ADP + H+

ppGpp biosynthesis :
GDP + ATP → GTP + ADP

preQ0 biosynthesis :
7-carboxy-7-deazaguanine + ammonium + ATP → preQ0 + ADP + phosphate + H+ + H2O

Reactions known to both consume and produce the compound:

acetate formation from acetyl-CoA I :
acetate + ATP ↔ acetyl phosphate + ADP

adenosine deoxyribonucleotides de novo biosynthesis II :
dADP + an oxidized thioredoxin + H2O ↔ ADP + a reduced thioredoxin

adenosine ribonucleotides de novo biosynthesis :
ATP + 4 H+[cytosol] + H2O ↔ ADP + phosphate + 5 H+[periplasmic space]

gluconeogenesis I :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP

glycogen biosynthesis I (from ADP-D-Glucose) :
(1,4-α-D-glucosyl)(n) + ADP-α-D-glucose ↔ ADP + (1,4-α-D-glucosyl)(n+1)

glycolysis I (from glucose-6P) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ ADP + phosphoenolpyruvate + H+

glycolysis II (from fructose-6P) :
3-phospho-D-glycerate + ATP ↔ 1,3-bisphospho-D-glycerate + ADP
pyruvate + ATP ↔ ADP + phosphoenolpyruvate + H+

mixed acid fermentation :
acetate + ATP ↔ acetyl phosphate + ADP
pyruvate + ATP ↔ ADP + phosphoenolpyruvate + H+

sulfate activation for sulfonation :
adenosine 5'-phosphosulfate + ATP ↔ 3'-phosphoadenylyl-sulfate + ADP + H+

TCA cycle I (prokaryotic) :
succinate + ATP + coenzyme A ↔ succinyl-CoA + ADP + phosphate

threonine degradation I :
ATP + propanoate ↔ ADP + propanoyl phosphate

Not in pathways:
an isocitrate dehydrogenase + ATP ↔ ADP + a phosphorylated isocitrate dehydrogenase
ATP + (polyphosphate)(n)ADP + (polyphosphate)(n+1)
thiamin diphosphate + ADP + H+ ↔ adenosine thiamine triphosphate + phosphate


a single-stranded RNA + phosphate ↔ a single-stranded RNA + a nucleoside diphosphate

In Reactions of unknown directionality:

Not in pathways:
ATP + a 1,2-diacyl-sn-glycerol = a 1,2-diacyl-sn-glycerol 3-phosphate + ADP + H+
N-acetyl-β-D-glucosamine + ATP = N-acetyl-D-glucosamine 6-phosphate + ADP + H+
α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA + ADP-L-glycero-β-D-manno-heptose = heptosyl-Kdo2-lipid IVA + ADP + H+
a supercoiled duplex DNA + ATP = a single stranded DNA + ADP + phosphate
a double stranded DNA + ATP = a negatively supercoiled DNA + ADP + phosphate
N6-L-threonylcarbamoyladenine37 in tRNA + ATP = cyclic N6-L-threonylcarbamoyladenosine 37 in tRNA + ADP + phosphate


RNA(n+1) + phosphate = RNA(n) + a nucleoside diphosphate

In Transport reactions:
ATP + L-proline[periplasmic space] + H2O → ADP + L-proline[cytosol] + phosphate + H+ ,
ATP + a peptide[periplasmic space] + H2O → ADP + a peptide[cytosol] + phosphate ,
ATP + L-isoleucine[periplasmic space] + H2O → ADP + L-isoleucine[cytosol] + phosphate + H+ ,
ATP + a dipeptide[periplasmic space] + H2O → ADP + a dipeptide[cytosol] + phosphate + H+ ,
ATP + L-leucine[periplasmic space] + H2O → ADP + L-leucine[cytosol] + phosphate + H+ ,
ATP + L-valine[periplasmic space] + H2O → ADP + L-valine[cytosol] + phosphate + H+ ,
Zn2+[periplasmic space] + ATP + H2O → Zn2+[cytosol] + ADP + phosphate + H+ ,
D-allose[periplasmic space] + ATP + H2O → D-allose[cytosol] + ADP + phosphate + H+ ,
ATP + thiamin[periplasmic space] + H2O → ADP + thiamin[cytosol] + phosphate + H+ ,
ATP + D-methionine[periplasmic space] + H2O → ADP + D-methionine[cytosol] + phosphate + H+ ,
ATP + L-methionine[periplasmic space] + H2O → ADP + L-methionine[cytosol] + phosphate + H+ ,
glutathione[periplasmic space] + ATP + H2O → glutathione[cytosol] + ADP + phosphate + H+ ,
a macrolide antibiotic[cytosol] + ATP + H2O → a macrolide antibiotic[extracellular space] + ADP + phosphate ,
Cu+[cytosol] + ATP + H2O → Cu+[periplasmic space] + ADP + phosphate + H+ ,
ATP + arsenate[cytosol] + H2O → ADP + arsenate[periplasmic space] + phosphate + H+ ,
L-cysteine[cytosol] + ATP + H2O → L-cysteine[periplasmic space] + ADP + phosphate + H+ ,
glutathione[cytosol] + ATP + H2O → glutathione[periplasmic space] + ADP + phosphate + H+ ,
selenite[periplasmic space] + ATP + H2O → selenite[cytosol] + ADP + phosphate + H+ ,
selenate[periplasmic space] + ATP + H2O → selenate[cytosol] + ADP + phosphate + H+ ,
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[periplasmic space] + ATP + H2O → (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran[cytosol] + ADP + phosphate + H+ ,
ATP + an aliphatic sulfonate[periplasmic space] + H2O → an aliphatic sulfonate[cytosol] + ADP + phosphate + H+ ,
ATP + L-aspartate[periplasmic space] + H2O → L-aspartate[cytosol] + ADP + phosphate + H+ ,
sulfate[periplasmic space] + ATP + H2O → sulfate[cytosol] + ADP + phosphate + H+ ,
K+[periplasmic space] + ATP + H2O → K+[cytosol] + ADP + phosphate + H+ ,
Mg2+[periplasmic space] + ATP + H2O → Mg2+[cytosol] + ADP + phosphate + H+ ,
a lipopolysaccharide[cytosol] + ATP + H2O → a lipopolysaccharide[periplasmic space] + ADP + phosphate + H+ ,
taurine[periplasmic space] + ATP + H2O → taurine[cytosol] + ADP + phosphate + H+ ,
ATP + ferric dicitrate[periplasmic space] + H2O → ADP + ferric dicitrate[cytosol] + phosphate + H+ ,
ATP + thiosulfate[periplasmic space] + H2O → ADP + thiosulfate[cytosol] + phosphate + H+ ,
ATP + cob(I)alamin[periplasmic space] + H2O → ADP + cob(I)alamin[cytosol] + phosphate + H+ ,
ATP + L-arginine[periplasmic space] + H2O → ADP + L-arginine[cytosol] + phosphate + H+ ,
ATP + L-ornithine[periplasmic space] + H2O → ADP + L-ornithine[cytosol] + phosphate + H+ ,
ATP + sn-glycerol 3-phosphate[periplasmic space] + H2O → ADP + sn-glycerol 3-phosphate[cytosol] + phosphate + H+ ,
L-lysine[periplasmic space] + ATP + H2O → L-lysine[cytosol] + ADP + phosphate + H+ ,
ATP + phosphate[periplasmic space] + H2O → ADP + 2 phosphate[cytosol] + H+ ,
ATP + putrescine[periplasmic space] + H2O → ADP + putrescine[cytosol] + phosphate + H+ ,
ATP + spermidine[periplasmic space] + H2O → ADP + spermidine[cytosol] + phosphate + H+ ,
Ni2+[periplasmic space] + ATP + H2O → Ni2+[cytosol] + ADP + phosphate + H+ ,
ATP + molybdate[periplasmic space] + H2O → ADP + molybdate[cytosol] + phosphate + H+ ,
ATP + β-D-galactose[periplasmic space] + H2O → ADP + β-D-galactose[cytosol] + phosphate + H+ ,
maltose[periplasmic space] + ATP + H2O → maltose[cytosol] + ADP + phosphate + H+ ,
ATP + L-histidine[periplasmic space] + H2O → ADP + L-histidine[cytosol] + phosphate + H+ ,
ATP + L-glutamate[periplasmic space] + H2O → ADP + L-glutamate[cytosol] + phosphate + H+ ,
ATP + L-glutamine[periplasmic space] + H2O → ADP + L-glutamine[cytosol] + phosphate + H+ ,
ATP + a ferric hydroxamate complex[periplasmic space] + H2O → ADP + a ferric hydroxamate complex[cytosol] + phosphate ,
ATP + ferric enterobactin complex[periplasmic space] + H2O → ADP + ferric enterobactin complex[cytosol] + phosphate + H+ ,
a quaternary amine[periplasmic space] + ATP + H2O → a quaternary amine[cytosol] + ADP + phosphate + H+ ,
α-D-galactofuranose[periplasmic space] + ATP + H2O → α-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
ATP + an alkylphosphonate[periplasmic space] + H2O → ADP + an alkylphosphonate[cytosol] + phosphate + H+ ,
β-D-galactofuranose[periplasmic space] + ATP + H2O → β-D-galactofuranose[cytosol] + ADP + phosphate + H+ ,
Zn2+[cytosol] + ATP + H2O → Zn2+[periplasmic space] + ADP + phosphate + H+ ,
ATP + β-D-ribopyranose[periplasmic space] + H2O → ADP + β-D-ribopyranose[cytosol] + phosphate + H+ ,
maltotriose[periplasmic space] + ATP + H2O → ADP + maltotriose[cytosol] + phosphate + H+ ,
maltotetraose[periplasmic space] + ATP + H2O → ADP + maltotetraose[cytosol] + phosphate + H+ ,
methyl-β-D-galactoside[periplasmic space] + ATP + H2O → methyl-β-D-galactoside[cytosol] + ADP + phosphate + H+ ,
an aminoalkylphosphonate[periplasmic space] + ATP + H2O → an aminoalkylphosphonate[cytosol] + ADP + phosphate + H+ ,
ATP + D-xylose[periplasmic space] + H2O → ADP + D-xylose[cytosol] + phosphate + H+ ,
ATP + L-arabinose[periplasmic space] + H2O → ADP + L-arabinose[cytosol] + phosphate + H+ ,
ATP + L-alanyl-γ-D-glutamyl-meso-diaminopimelate[periplasmic space] + H2O → L-alanyl-γ-D-glutamyl-meso-diaminopimelate[cytosol] + ADP + phosphate + H+ ,
a glycerophosphodiester[periplasmic space] + ATP + H2O → a glycerophosphodiester[cytosol] + ADP + phosphate + H+ ,
L-methionine S-oxide[periplasmic space] + ATP + H2O → L-methionine S-oxide[cytosol] + ADP + phosphate + H+ ,
N-acetyl-DL-methionine[periplasmic space] + ATP + H2O → N-acetyl-DL-methionine[cytosol] + ADP + phosphate + H+ ,
lipid A-core[cytosol] + ATP + H2O → lipid A-core[periplasmic space] + ADP + phosphate + H+ ,
heme b[cytosol] + ATP + H2O → heme b[periplasmic space] + ADP + phosphate + H+

Enzymes activated by ADP, sorted by the type of activation, are:

Activator (Allosteric) of: 6-phosphofructokinase [Blangy68]

Activator (Mechanism unknown) of: succinyl-CoA synthetase [Birney96] , isocitrate dehydrogenase phosphatase [Nimmo84]

Enzymes inhibited by ADP, sorted by the type of inhibition, are:

Inhibitor (Competitive) of: malate:quinone oxidoreductase [Narindrasorasak79] , GTP cyclohydrolase [Yim76] , nucleoside diphosphate kinase [Roisin78, Comment 1] , dethiobiotin synthetase [Krell70, Comment 2] , γ-glutamyl kinase [Smith84] , tRNA(i6A37) synthase [Leung97] , polyphosphate kinase [Comment 3] , 1-phosphofructokinase [Buschmeier85] , glycerol kinase [Helmward89, Comment 4] , phosphoribosylformylglycinamide cyclo-ligase [Schrimsher86, Comment 5] , glycogen synthase [Furukawa93, Comment 6]

Inhibitor (Noncompetitive) of: glycerol kinase [Thorner73] , phosphate acetyltransferase [Suzuki69, Comment 7] , adenylate cyclase [Yang83]

Inhibitor (Mechanism unknown) of: deoxyribonucleoside 5'-monophosphate phosphatase [Proudfoot04] , amidophosphoribosyl transferase [Messenger79] , phosphoenolpyruvate synthetase [Chulavatnatol73] , mannose isomerase [Itoh08] , thiamine phosphate synthase [Kayama73, Kawasaki79] , glutaminase B [Prusiner76] , NAD+ synthetase, NH3-dependent [Spencer67, Comment 8] , ADP-sugar pyrophosphatase [MorenoBruna01] , isocitrate dehydrogenase kinase [Nimmo84a] , N-acetyl-D-glucosamine kinase [Uehara04] , anhydro-N-acetylmuramic acid kinase [Uehara05] , phosphoribosylformylglycinamide cyclo-ligase [Schrimsher86, Comment 9] , thiamin monophosphate kinase [Nishino72, Comment 10] , ADP-L-glycero-D-mannoheptose-6-epimerase [Ding94] , fructose 1,6-bisphosphatase [Donahue00]

Inhibitor (Other types) of: guanosine kinase [Kawasaki00, Comment 11]


References

Ahn90: Ahn K, Kornberg A (1990). "Polyphosphate kinase from Escherichia coli. Purification and demonstration of a phosphoenzyme intermediate." J Biol Chem 1990;265(20);11734-9. PMID: 2164013

Birney96: Birney M, Um HD, Klein C (1996). "Novel mechanisms of Escherichia coli succinyl-coenzyme A synthetase regulation." J Bacteriol 178(10);2883-9. PMID: 8631677

Blangy68: Blangy D, Buc H, Monod J (1968). "Kinetics of the allosteric interactions of phosphofructokinase from Escherichia coli." J Mol Biol 31(1);13-35. PMID: 4229913

Buschmeier85: Buschmeier B, Hengstenberg W, Deutscher J (1985). "Purification and properties of 1-phosphofructokinase from Escherichia coli." FEMS Microbiol Lett 1985;29(3):231-235.

Chulavatnatol73: Chulavatnatol M, Atkinson DE (1973). "Phosphoenolpyruvate synthetase from Escherichia coli. Effects of adenylate energy charge and modifier concentrations." J Biol Chem 248(8);2712-5. PMID: 4572511

Ding94: Ding L, Seto BL, Ahmed SA, Coleman WG (1994). "Purification and properties of the Escherichia coli K-12 NAD-dependent nucleotide diphosphosugar epimerase, ADP-L-glycero-D-mannoheptose 6-epimerase." J Biol Chem 269(39);24384-90. PMID: 7929099

Donahue00: Donahue JL, Bownas JL, Niehaus WG, Larson TJ (2000). "Purification and characterization of glpX-encoded fructose 1, 6-bisphosphatase, a new enzyme of the glycerol 3-phosphate regulon of Escherichia coli." J Bacteriol 2000;182(19);5624-7. PMID: 10986273

Furukawa93: Furukawa K, Tagaya M, Tanizawa K, Fukui T (1993). "Role of the conserved Lys-X-Gly-Gly sequence at the ADP-glucose-binding site in Escherichia coli glycogen synthase." J Biol Chem 268(32);23837-42. PMID: 8226921

Haeusler92: Haeusler PA, Dieter L, Rittle KJ, Shepler LS, Paszkowski AL, Moe OA (1992). "Catalytic properties of Escherichia coli polyphosphate kinase: an enzyme for ATP regeneration." Biotechnol Appl Biochem 1992;15(2);125-33. PMID: 1316760

Helmward89: Helmward Z "Handbook of Enzyme Inhibitors. 2nd, revised and enlarged edition." Weinheim, Federal Republic of Germany ; New York, NY, USA , 1989.

Itoh08: Itoh T, Mikami B, Hashimoto W, Murata K (2008). "Crystal structure of YihS in complex with D-mannose: structural annotation of Escherichia coli and Salmonella enterica yihS-encoded proteins to an aldose-ketose isomerase." J Mol Biol 377(5);1443-59. PMID: 18328504

Kawasaki00: Kawasaki H, Shimaoka M, Usuda Y, Utagawa T (2000). "End-product regulation and kinetic mechanism of guanosine-inosine kinase from Escherichia coli." Biosci Biotechnol Biochem 2000;64(5);972-9. PMID: 10879466

Kawasaki79: Kawasaki T (1979). "Thiamine phosphate pyrophosphorylase." Methods Enzymol 1979;62;69-73. PMID: 374983

Kayama73: Kayama Y, Kawasaki T (1973). "Purification and properties of thiaminephosphate pyrophosphorylase of Escherichia coli." Arch Biochem Biophys 1973;158(1);242-8. PMID: 4580841

Krell70: Krell K, Eisenberg MA (1970). "The purification and properties of dethiobiotin synthetase." J Biol Chem 1970;245(24);6558-66. PMID: 4921568

Leung97: Leung HC, Chen Y, Winkler ME (1997). "Regulation of substrate recognition by the MiaA tRNA prenyltransferase modification enzyme of Escherichia coli K-12." J Biol Chem 272(20);13073-83. PMID: 9148919

Messenger79: Messenger LJ, Zalkin H (1979). "Glutamine phosphoribosylpyrophosphate amidotransferase from Escherichia coli. Purification and properties." J Biol Chem 1979;254(9);3382-92. PMID: 372191

MorenoBruna01: Moreno-Bruna B, Baroja-Fernandez E, Munoz FJ, Bastarrica-Berasategui A, Zandueta-Criado A, Rodriguez-Lopez M, Lasa I, Akazawa T, Pozueta-Romero J (2001). "Adenosine diphosphate sugar pyrophosphatase prevents glycogen biosynthesis in Escherichia coli." Proc Natl Acad Sci U S A 98(14);8128-32. PMID: 11416161

Narindrasorasak79: Narindrasorasak S, Goldie AH, Sanwal BD (1979). "Characteristics and regulation of a phospholipid-activated malate oxidase from Escherichia coli." J Biol Chem 1979;254(5);1540-5. PMID: 368072

Nimmo84: Nimmo GA, Borthwick AC, Holms WH, Nimmo HG (1984). "Partial purification and properties of isocitrate dehydrogenase kinase/phosphatase from Escherichia coli ML308." Eur J Biochem 141(2);401-8. PMID: 6329756

Nimmo84a: Nimmo GA, Nimmo HG (1984). "The regulatory properties of isocitrate dehydrogenase kinase and isocitrate dehydrogenase phosphatase from Escherichia coli ML308 and the roles of these activities in the control of isocitrate dehydrogenase." Eur J Biochem 1984;141(2);409-14. PMID: 6329757

Nishino72: Nishino H (1972). "Biogenesis of cocarboxylase in Escherichia coli. Partial purification and some properties of thiamine monophosphate kinase." J Biochem (Tokyo) 1972;72(5);1093-100. PMID: 4567662

Proudfoot04: Proudfoot M, Kuznetsova E, Brown G, Rao NN, Kitagawa M, Mori H, Savchenko A, Yakunin AF (2004). "General enzymatic screens identify three new nucleotidases in Escherichia coli. Biochemical characterization of SurE, YfbR, and YjjG." J Biol Chem 279(52);54687-94. PMID: 15489502

Prusiner76: Prusiner S, Stadtman ER (1976). "Regulation of glutaminase B in Escherichia coli. III. Control by nucleotides and divalent cations." J Biol Chem 1976;251(11);3463-9. PMID: 776970

Roisin78: Roisin MP, Kepes A (1978). "Nucleosidediphosphate kinase of Escherichia coli, a periplasmic enzyme." Biochim Biophys Acta 1978;526(2);418-28. PMID: 214126

Schrimsher86: Schrimsher JL, Schendel FJ, Stubbe J, Smith JM (1986). "Purification and characterization of aminoimidazole ribonucleotide synthetase from Escherichia coli." Biochemistry 1986;25(15);4366-71. PMID: 3530323

Smith84: Smith CJ, Deutch AH, Rushlow KE (1984). "Purification and characteristics of a gamma-glutamyl kinase involved in Escherichia coli proline biosynthesis." J Bacteriol 1984;157(2);545-51. PMID: 6319365

Spencer67: Spencer RL, Preiss J (1967). "Biosynthesis of diphosphopyridine nucleotide. The purification and the properties of diphospyridine nucleotide synthetase from Escherichia coli b." J Biol Chem 1967;242(3);385-92. PMID: 4290215

Suzuki69: Suzuki T (1969). "Phosphotransacetylase of Escherichia coli B, activation by pyruvate and inhibition by NADH and certain nucleotides." Biochim Biophys Acta 1969;191(3);559-69. PMID: 4312205

Thorner73: Thorner JW, Paulus H (1973). "Catalytic and allosteric properties of glycerol kinase from Escherichia coli." J Biol Chem 1973;248(11);3922-32. PMID: 4575199

Uehara04: Uehara T, Park JT (2004). "The N-acetyl-D-glucosamine kinase of Escherichia coli and its role in murein recycling." J Bacteriol 186(21);7273-9. PMID: 15489439

Uehara05: Uehara T, Suefuji K, Valbuena N, Meehan B, Donegan M, Park JT (2005). "Recycling of the anhydro-N-acetylmuramic acid derived from cell wall murein involves a two-step conversion to N-acetylglucosamine-phosphate." J Bacteriol 187(11);3643-9. PMID: 15901686

Yang83: Yang JK, Epstein W (1983). "Purification and characterization of adenylate cyclase from Escherichia coli K12." J Biol Chem 1983;258(6);3750-8. PMID: 6300054

Yim76: Yim JJ, Brown GM (1976). "Characteristics of guanosine triphosphate cyclohydrolase I purified from Escherichia coli." J Biol Chem 1976;251(16);5087-94. PMID: 821948


Report Errors or Provide Feedback
Please cite the following article in publications resulting from the use of EcoCyc: Nucleic Acids Research 41:D605-12 2013
Page generated by SRI International Pathway Tools version 18.5 on Fri Dec 19, 2014, biocyc12.